1.0 2010-04-08 22:05:38 UTC 2019-11-26 02:58:23 UTC FDB003041 (Z)-9-Heptadecenoic acid Minor constituent of several animal and vegetable fats. (Z)-9-Heptadecenoic acid is found in fats and oils and italian sweet red pepper. (e)-Heptadec-9-enoate (E)-Heptadec-9-enoic acid 9-heptadecylenic Acid 9E-Heptadecenoic acid C17H32O2 268.4348 268.240230268 (9E)-heptadec-9-enoic acid 9E-heptadecenoic acid 1981-50-6 CCCCCCC\C=C\CCCCCCCC(O)=O InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h8-9H,2-7,10-16H2,1H3,(H,18,19)/b9-8+ QSBYPNXLFMSGKH-CMDGGOBGSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Monounsaturated fatty acids Unsaturated fatty acids long-chain fatty acid Liquid logp 7.22 ALOGPS logs -6.08 ALOGPS solubility 2.23e-04 g/l ALOGPS melting_point Mp 14.5° logp 6.34 ChemAxon pka_strongest_acidic 4.99 ChemAxon iupac (9E)-heptadec-9-enoic acid ChemAxon average_mass 268.4348 ChemAxon mono_mass 268.240230268 ChemAxon smiles CCCCCCC\C=C\CCCCCCCC(O)=O ChemAxon formula C17H32O2 ChemAxon inchi InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h8-9H,2-7,10-16H2,1H3,(H,18,19)/b9-8+ ChemAxon inchikey QSBYPNXLFMSGKH-CMDGGOBGSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 82.8 ChemAxon polarizability 35.53 ChemAxon rotatable_bond_count 14 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 19651 Specdb::CMs 42323 Specdb::CMs 154849 Specdb::MsMs 52971 Specdb::MsMs 52972 Specdb::MsMs 52973 Specdb::MsMs 159555 Specdb::MsMs 159556 Specdb::MsMs 159557 Specdb::MsMs 2425105 Specdb::MsMs 2425106 Specdb::MsMs 2425107 Specdb::MsMs 2510182 Specdb::MsMs 2510183 Specdb::MsMs 2510184 HMDB31046 #<Reference:0x000055ce306debe8> Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fats and oils Unknown generic Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Italian sweet red pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Milk (Cow) Type 2 specific Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823