1.0 2010-04-08 22:05:38 UTC 2025-11-18 22:47:04 UTC FDB003050 Methyl hexadecanoate Methyl hexadecanoic acid, also known as palmitic acid methyl ester, belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O) OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Methyl hexadecanoic acid is very hydrophobic, practically insoluble in water, and relatively neutral. Methyl hexadecanoic acid has a fatty, oily, and waxy taste. Methyl hexadecanoic acid has been detected in cauliflowers, cloves, and evergreen blackberries. This could make methyl hexadecanoic acid a potential biomarker for the consumption of these foods. Hexadecanoic acid methyl ester Hexadecanoic acid, methyl ester Metholene 2216 Methyl hexadecanate Methyl hexadecanoate Methyl n-hexadecanoate Methyl palmitate N-hexadecanoic acid methyl ester Palmitic acid methyl ester Palmitic acid, methyl ester Palmitic acid, methyl ester (8CI) Uniphat A60 C17H34O2 270.4507 270.255880332 methyl hexadecanoate methyl hexadecanoate 112-39-0 CCCCCCCCCCCCCCCC(=O)OC InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 FLIACVVOZYBSBS-UHFFFAOYSA-N belongs to the class of organic compounds known as fatty acid methyl esters. Fatty acid methyl esters are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. Fatty acid methyl esters Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acid esters Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Methyl esters Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid methyl ester Hydrocarbon derivative Methyl ester Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Wax monoesters fatty acid methyl ester logp 7.41 ALOGPS logs -6.56 ALOGPS solubility 7.53e-05 g/l ALOGPS melting_point Mp 30.5° logp 6.4 ChemAxon pka_strongest_basic -7 ChemAxon iupac methyl hexadecanoate ChemAxon average_mass 270.4507 ChemAxon mono_mass 270.255880332 ChemAxon smiles CCCCCCCCCCCCCCCC(=O)OC ChemAxon formula C17H34O2 ChemAxon inchi InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 ChemAxon inchikey FLIACVVOZYBSBS-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 81.85 ChemAxon polarizability 36.41 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1656 Specdb::CMs 28227 Specdb::CMs 28245 Specdb::CMs 28639 Specdb::CMs 28872 Specdb::CMs 32313 Specdb::CMs 34125 Specdb::CMs 155493 Specdb::MsMs 62151 Specdb::MsMs 62152 Specdb::MsMs 62153 Specdb::MsMs 118824 Specdb::MsMs 118825 Specdb::MsMs 118826 Specdb::MsMs 1476264 Specdb::MsMs 1476265 Specdb::MsMs 1476266 Specdb::MsMs 1476267 Specdb::MsMs 1476268 Specdb::MsMs 1476269 Specdb::MsMs 1476270 Specdb::MsMs 1476271 Specdb::MsMs 1476272 Specdb::MsMs 1476273 Specdb::MsMs 1476274 Specdb::MsMs 1476275 Specdb::MsMs 1476276 Specdb::MsMs 2409349 Specdb::MsMs 2409350 Specdb::MsMs 2409351 Specdb::MsMs 2553442 Specdb::MsMs 2553443 Specdb::MsMs 2553444 HMDB0061859 564095 Blackberry Type 1 specific Rubus Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 Cloves Type 1 specific Syzygium aromaticum 219868 Evergreen blackberry Type 1 specific Rubus laciniatus fatty oily waxy