1.0 2010-04-08 22:05:41 UTC 2015-10-09 22:32:39 UTC FDB003166 Hydroxycobalamin Vitamin (haematopoietic) A B 12 vitamin. It has been used therapeutically in the treatment and prevention of vitamin B 12 deficiency. -- Pubchem; Hydroxocobalamin (OHCbl) is a natural analog of vitamin B-12, a basic member of the cobalamin family of compounds. It has an intense red color. Vitamin B12 is a term that refers to a group of compounds called cobalamins that are available in the human body in a variety of mostly interconvertible forms. Together with folic acid, cobalamins are essential cofactors required for DNA synthesis in cells where chromosomal replication and division are occurring?most notably the bone marrow and myeloid cells. As a cofactor, cobalamins are essential for two cellular reactions: (1) the mitochondrial methylmalonylcoenzyme A mutase conversion of methylmalonic acid (MMA) to succinate, which links lipid and carbohydrate metabolism, and (2) activation of methionine synthase, which is the rate limiting step in the synthesis of methionine from homocysteine and tetrahydrofolate (Katzung, 1989).; Hydroxocobalamin is a synthetic, injectable form of Vitamin B12. Hydroxocobalamin is actually a precursor of two cofactors or vitamins (Vitamin B12 and Methylcobalamin) which are involved in various biological systems in man. Vitamin B12 is required for the conversion of methylmalonate to succinate. Deficiency of this enzyme could therefore interfere with the production of lipoprotein in myelin sheath tissue and so give rise to neurological lesions. The second cofactor, Methylcobalamin, is necessary for the conversion of homocysteine to methionine which is essential for the metabolism of folic acid. Deficiency of tetrahydrafolate leads to reduced synthesis of thymidylate resulting in reduced synthesis of DNA which is essential for cell maturation. Vitamin B12 is also concerned in the maintenance of sulphydryl groups in reduced form, deficiency leading to decreased amounts of reduced SH content of erythrocytes and liver cells. Overall, vitamin B12 acts as a coenzyme for various metabolic functions, including fat and carbohydrate metabolism and protein synthesis. It is necessary for growth, cell replication, hematopoiesis, and nucleoprotein as well as myelin synthesis. This is largely due to its effects on metabolism of methionine folic acid, and malonic acid. a-(5,6-Dimethylbenzimidazolyl)hydroxocobamide Alpha cobione alpha-(5,6-Dimethylbenzimidazolyl)hydroxocobamide AlphaRedisol Axlon Ciplamin h Cobalex Cobalin h Cobinamide dihydroxide dihydrogen phosphate (ester) mono (inner salt) 3'-ester with 5,6-dimethyl -1-a-D-ribofuranosyl-1H-benzimidazole, 9CI Cobinamide hydroxide ate 3'-ester with 5,6-dimethyl-1-a-D-ribofuranosylbenzimidazole inner salt Cobinamide hydroxide ate 3'-ester with 5,6-dimethyl-1-alpha-delta-ribofuranosylbenzimidazole inner salt Codroxomin Docclan Docelan Docevita Droxomin Ducobee HY Duradoce Duralta-12 Hydrocobalamin Hydrogrisevit Hydrovit Hydroxocobalamin Hydroxocobalamine Hydroxycobalamin Hydroxycobalamin, BAN, INN, USAN Lipflavonoid Neo-Betalin 12 Oh-CBL Sytobex H Vibeden vitamin B-12b C62H89CoN13O15P 1346.3551 1345.567070949 cobalt(3+) ion 3-[13-(3-azanidyl-3-oxopropyl)-4-{2-[(2-{[hydroxy({[4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-1-methylidene-3H-1lambda5,3-benzodiazol-3-yl)oxolan-3-yl]oxy})phosphoryl]oxy}propyl)-C-hydroxycarbonimidoyl]ethyl}-18-[2-(C-hydroxycarbonimidoyl)ethyl]-3,14,19-tris[(C-hydroxycarbonimidoyl)methyl]-1,4,6,9,9,14,16,19-octamethyl-20,21,22,23-tetraazapentacyclo[15.2.1.1^{2,5}.1^{7,10}.1^{12,15}]tricosa-5(23),6,10(22),11,15(21),16-hexaen-8-yl]propanecarboximidate hydrate cobalt(3+) ion 3-[13-(3-azanidyl-3-oxopropyl)-4-{2-[(2-{[hydroxy([4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-1-methylidene-1lambda5,3-benzodiazol-3-yl)oxolan-3-yl]oxy)phosphoryl]oxy}propyl)-C-hydroxycarbonimidoyl]ethyl}-18-[2-(C-hydroxycarbonimidoyl)ethyl]-3,14,19-tris(C-hydroxycarbonimidoylmethyl)-1,4,6,9,9,14,16,19-octamethyl-20,21,22,23-tetraazapentacyclo[15.2.1.1^{2,5}.1^{7,10}.1^{12,15}]tricosa-5(23),6,10(22),11,15(21),16-hexaen-8-yl]propanecarboximidate hydrate 13422-51-0 O=C(CCC1C2=C(C3=[N]4C(=CC5=[N]6C(C(C5(C)C)CCC(=O)N)=C(C5=[N]7C8C(N2[Co+]467(C[N]2=CN(C4=CC(C)=CC=C24)C2OC(CO)C(OP(=O)(OC(C)CNC(=O)CCC5(C)C8CC(=O)N)[O-])C2O)O)(C1(CC(=O)N)C)C)C)C(CCC(N)=O)C3(CC(=O)N)C)C)N InChI=1S/C62H90N13O14P.Co.H2O/c1-30-12-16-39-40(22-30)75(29-74(39)11)57-52(84)53(41(28-76)87-57)89-90(85,86)88-31(2)27-69-49(83)20-21-59(7)37(23-46(66)80)56-62(10)61(9,26-48(68)82)36(15-19-45(65)79)51(73-62)33(4)55-60(8,25-47(67)81)34(13-17-43(63)77)38(70-55)24-42-58(5,6)35(14-18-44(64)78)50(71-42)32(3)54(59)72-56;;/h12,16,22,24,29,31,34-37,41,52-53,56-57,76,84H,11,13-15,17-21,23,25-28H2,1-10H3,(H15,63,64,65,66,67,68,69,70,71,72,73,77,78,79,80,81,82,83,85,86);;1H2/q;+3;/p-3 OHTROZZULXOIDW-UHFFFAOYSA-K belongs to the class of organic compounds known as cobalamin derivatives. These are organic compounds containing a corrin ring, a cobalt atom, an a nucleotide moiety. Cobalamin Derivatives are actually derived from vitamin B12. Cobalamin derivatives Organic compounds Organoheterocyclic compounds Tetrapyrroles and derivatives Corrinoids Aromatic heteropolycyclic compounds Amino acids and derivatives Azacyclic compounds Benzimidazoles Carbene-type 1,3-dipolar compounds Carbonyl compounds Carboxamidines Carboximidic acids Dialkyl phosphates Dialkylamines Diaminotoluenes Enamines Glycosylamines Hydrocarbon derivatives Ketimines Metallotetrapyrroles Monosaccharide phosphates Organic cobalt salts Organic oxides Organic zwitterions Organopnictogen compounds Oxacyclic compounds Pentose phosphates Primary alcohols Propargyl-type 1,3-dipolar organic compounds Pyrrolidines Pyrrolines Secondary alcohols Tetrahydrofurans Triarylamines Alcohol Alkyl phosphate Amidine Amine Amino acid or derivatives Aromatic heteropolycyclic compound Azacycle Benzenoid Benzimidazole Carbene-type 1,3-dipolar compound Carbonyl group Carboximidic acid Carboximidic acid derivative Carboxylic acid amidine Carboxylic acid derivative Cobalamin Dialkyl phosphate Diaminotoluene Enamine Glycosyl compound Hydrocarbon derivative Imine Ketimine Metallotetrapyrrole skeleton Monosaccharide Monosaccharide phosphate N-glycosyl compound Organic 1,3-dipolar compound Organic cobalt salt Organic nitrogen compound Organic oxide Organic oxygen compound Organic phosphoric acid derivative Organic salt Organic transition metal salt Organic zwitterion Organonitrogen compound Organooxygen compound Organopnictogen compound Oxacycle Pentose phosphate Phosphoric acid ester Primary alcohol Propargyl-type 1,3-dipolar organic compound Pyrrolidine Pyrroline Secondary alcohol Secondary aliphatic amine Secondary amine Tertiary amine Tertiary aromatic amine Tetrahydrofuran Solid logp 2.91 ALOGPS logs -4.42 ALOGPS solubility 5.48e-02 g/l ALOGPS melting_point 200 oC iupac cobalt(3+) ion 3-[13-(3-azanidyl-3-oxopropyl)-4-{2-[(2-{[hydroxy({[4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-1-methylidene-3H-1lambda5,3-benzodiazol-3-yl)oxolan-3-yl]oxy})phosphoryl]oxy}propyl)-C-hydroxycarbonimidoyl]ethyl}-18-[2-(C-hydroxycarbonimidoyl)ethyl]-3,14,19-tris[(C-hydroxycarbonimidoyl)methyl]-1,4,6,9,9,14,16,19-octamethyl-20,21,22,23-tetraazapentacyclo[15.2.1.1^{2,5}.1^{7,10}.1^{12,15}]tricosa-5(23),6,10(22),11,15(21),16-hexaen-8-yl]propanecarboximidate hydrate ChemAxon average_mass 1346.3551 ChemAxon mono_mass 1345.567070949 ChemAxon smiles O=C(CCC1C2=C(C3=[N]4C(=CC5=[N]6C(C(C5(C)C)CCC(=O)N)=C(C5=[N]7C8C(N2[Co+]467(C[N]2=CN(C4=CC(C)=CC=C24)C2OC(CO)C(OP(=O)(OC(C)CNC(=O)CCC5(C)C8CC(=O)N)[O-])C2O)O)(C1(CC(=O)N)C)C)C)C(CCC(N)=O)C3(CC(=O)N)C)C)N ChemAxon formula C62H89CoN13O15P ChemAxon inchi InChI=1S/C62H90N13O14P.Co.H2O/c1-30-12-16-39-40(22-30)75(29-74(39)11)57-52(84)53(41(28-76)87-57)89-90(85,86)88-31(2)27-69-49(83)20-21-59(7)37(23-46(66)80)56-62(10)61(9,26-48(68)82)36(15-19-45(65)79)51(73-62)33(4)55-60(8,25-47(67)81)34(13-17-43(63)77)38(70-55)24-42-58(5,6)35(14-18-44(64)78)50(71-42)32(3)54(59)72-56;;/h12,16,22,24,29,31,34-37,41,52-53,56-57,76,84H,11,13-15,17-21,23,25-28H2,1-10H3,(H15,63,64,65,66,67,68,69,70,71,72,73,77,78,79,80,81,82,83,85,86);;1H2/q;+3;/p-3 ChemAxon inchikey OHTROZZULXOIDW-UHFFFAOYSA-K ChemAxon polar_surface_area 465.43 ChemAxon refractivity 419.97 ChemAxon polarizability 133.74 ChemAxon rotatable_bond_count 26 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon HMDB02308 27786 #<Reference:0x000055ce2ecc3998> #<Reference:0x000055ce2ecc3560> #<Reference:0x000055ce2ecc3128> #<Reference:0x000055ce2ecc2cc8> #<Reference:0x000055ce2ecc2610> #<Reference:0x000055ce2ecc1e40> #<Reference:0x000055ce2ecc1238> #<Reference:0x000055ce2ecc0f18> Acerola Type 1 specific Malpighia emarginata 151847 0.0 0.0 0.0 mg/100 g Acorn Type 1 specific Quercus 3511 0.0 0.0 0.0 mg/100 g Acorn squash Type 1 Cucurbita pepo var. turbinata 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Agave Type 1 specific Agave 39509 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allspice Type 1 specific Pimenta dioica 375272 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Almond milk Type 1 0.0 0.0 0.0 mg/100 g Amaranth Type 1 specific Amaranthus 3564 0.0 0.0 0.0 mg/100 g American butterfish Type 1 specific Peprilus triacanthus 183653 1.9 1.9 1.9 mg/100 g American lobster Type 1 specific Homarus americanus 6706 0.625 1.25 0.0 mg/100 g American shad Type 1 specific Alosa sapidissima 34773 0.075 0.15 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 11.154 54.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.31 0.62 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 1.5 3.0 0.0 mg/100 g Anise Type 1 specific Pimpinella anisum 271192 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apple cider Type 2 specific 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arrowhead Type 1 specific Sagittaria latifolia 15008 0.0 0.0 0.0 mg/100 g Arrowroot Type 1 specific Maranta arundinacea 210060 0.0 0.0 0.0 mg/100 g Asian pear Type 1 specific Pyrus pyrifolia 3767 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic cod Type 1 specific Gadus morhua 8049 0.455 0.91 0.0 mg/100 g Atlantic croaker Type 1 specific Micropogonias undulatus 29154 1.25 2.5 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.4125 0.825 0.0 mg/100 g Atlantic herring Type 1 specific Clupea harengus harengus 7950 6.835 13.67 0.0 mg/100 g Atlantic pollock Type 1 specific Pollachius pollachius 185739 4.355 8.71 0.0 mg/100 g Atlantic salmon Type 1 specific Salmo salar 8030 3.18 3.18 3.18 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 2.03 2.03 2.03 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Avocado oil Type 2 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Banana Type 1 specific Musa acuminata 4641 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Beech nut Type 1 specific Fagus 21024 0.0 0.0 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 2.42 2.42 2.42 mg/100 g Beer Type 2 specific 0.01 0.02 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 0.17 0.17 0.17 mg/100 g Bitter gourd Type 1 specific Momordica charantia 3673 0.0 0.0 0.0 mg/100 g Black raisin Type 1 0.0 0.0 0.0 mg/100 g Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue cheese Type 2 0.61 1.22 0.0 mg/100 g Blue crab Type 1 specific Callinectes sapidus 6763 9.0 9.0 9.0 mg/100 g Blue mussel Type 1 specific Mytilus edulis 6550 6.0 12.0 0.0 mg/100 g Bluefish Type 1 specific Pomatomus saltatrix 75034 5.39 5.39 5.39 mg/100 g Borage Type 1 specific Borago officinalis 13363 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breadfruit Type 1 specific Artocarpus altilis 194251 0.0 0.0 0.0 mg/100 g Breadnut tree seed Type 1 specific Brosimum alicastrum 194253 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 1.66 1.66 1.66 mg/100 g Bulgur Type 2 specific 0.0 0.0 0.0 mg/100 g Burbot Type 1 specific Lota lota 69944 0.8 0.8 0.8 mg/100 g Burdock Type 1 specific Arctium lappa 4217 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 0.0225 0.045 0.0 mg/100 g Buttermilk Type 2 specific 0.23 0.46 0.0 mg/100 g Butternut Type 1 specific Juglans cinerea 91214 0.0 0.0 0.0 mg/100 g Butternut squash Type 1 specific Cucurbita moschata 3662 0.0 0.0 0.0 mg/100 g Cabbage Type 1 specific Brassica oleracea var. capitata 3716 0.0 0.0 0.0 mg/100 g Calabash Type 1 specific Lagenaria siceraria 3668 0.0 0.0 0.0 mg/100 g Capers Type 1 specific Capparis spinosa 65558 0.0 0.0 0.0 mg/100 g Caraway Type 1 specific Carum carvi 48032 0.0 0.0 0.0 mg/100 g Cardamom Type 1 specific Elettaria cardamomum 105181 0.0 0.0 0.0 mg/100 g Cardoon Type 1 specific Cynara cardunculus 4265 0.0 0.0 0.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.765 1.53 0.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.0 0.0 0.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 2.23 2.23 2.23 mg/100 g Catjang pea Type 1 specific Vigna unguiculata ssp. cylindrica 3840 0.0 0.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery stalks Type 1 specific Apium graveolens var. dulce 117781 0.0 0.0 0.0 mg/100 g Channel catfish Type 1 specific Ictalurus punctatus 7998 2.23 2.23 2.23 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheddar Cheese Type 2 Cheddar Cheese 0.5 0.5 0.5 mg/100 g Cheese Type 2 specific 0.8 0.8 0.8 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chia Type 1 specific Salvia hispanica 49212 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.025 0.025 0.025 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chicory roots Type 1 specific Cichorium intybus var. sativum 13427 0.0 0.0 0.0 mg/100 g Chinese broccoli Type 1 specific Brassica alboglabra 3714 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese chestnut Type 1 specific Castanea mollissima 60419 0.0 0.0 0.0 mg/100 g Chinese chives Type 1 specific Allium tuberosum 4683 0.0 0.0 0.0 mg/100 g Chinook salmon Type 1 specific Oncorhynchus tshawytscha 74940 1.3 1.3 1.3 mg/100 g Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chum salmon Type 1 specific Oncorhynchus keta 8018 3.0 3.0 3.0 mg/100 g Cichlidae (Tilapia) Type 1 specific Cichlidae 8113 0.79 1.58 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 0.0 0.0 0.0 mg/100 g Cisco Type 1 specific Coregonus artedi 36181 1.0 1.0 1.0 mg/100 g Clam Type 1 1.6 3.2 0.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.625 1.25 0.0 mg/100 g Cloud ear fungus Type 1 specific Auricularia polytricha 29893 0.0 0.0 0.0 mg/100 g Cloves Type 1 specific Syzygium aromaticum 219868 0.0 0.0 0.0 mg/100 g Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.0 0.0 0.0 mg/100 g Coconut milk Type 1 1.25 1.25 1.25 mg/100 g Coho salmon Type 1 specific Oncorhynchus kisutch 8019 2.085 4.17 0.0 mg/100 g Colorado pinyon Type 1 specific Pinus edulis 3340 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.446667 0.47 0.4 mg/100 g Common beet Type 1 specific Beta vulgaris 161934 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common carp Type 1 specific Cyprinus carpio 7962 0.765 1.53 0.0 mg/100 g Common hazelnut Type 1 specific Corylus avellana 13451 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.56 0.56 0.56 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 10.0 20.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.0 0.0 0.0 mg/100 g Common persimmon Type 1 specific Diospyros virginiana 13493 0.0 0.0 0.0 mg/100 g Common salsify Type 1 specific Tragopogon porrifolius 13731 0.0 0.0 0.0 mg/100 g Common thyme Type 1 specific Thymus vulgaris 49992 0.0 0.0 0.0 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 0.0 0.0 0.0 mg/100 g Cottage cheese Type 2 0.145 0.145 0.145 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Cottonseed oil Type 2 0.0 0.0 0.0 mg/100 g Cowpea Type 1 specific Vigna unguiculata 3917 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 9.0 9.0 9.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 1.366667 2.1 0.0 mg/100 g Cream Type 2 specific 0.0875 0.52 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cumin Type 1 specific Cuminum cyminum 52462 0.0 0.0 0.0 mg/100 g Cusk Type 1 specific Brosme brosme 81638 1.04 1.04 1.04 mg/100 g Custard apple Type 1 specific Annona reticulata 301862 0.0 0.0 0.0 mg/100 g Cuttlefish Type 1 specific Sepiidae 6608 3.0 3.0 3.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 6.31 6.31 6.31 mg/100 g Dessert wine Type 2 0.0 0.0 0.0 mg/100 g Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Dock Type 1 specific Rumex 3618 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 1.13 1.13 1.13 mg/100 g Dungeness crab Type 1 specific Cancer magister 29965 9.0 9.0 9.0 mg/100 g Durian Type 1 specific Durio zibethinus 66656 0.0 0.0 0.0 mg/100 g Eastern oyster Type 1 specific Crassostrea virginica 6565 4.375 8.75 0.0 mg/100 g Egg substitute Type 2 specific 0.965 3.52 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.835 0.835 0.835 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 0.12 0.12 0.12 mg/100 g Emu Type 1 specific Dromaius novaehollandiae 8790 0.89 0.89 0.89 mg/100 g Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g Epazote Type 1 specific Dysphania ambrosioides 330163 0.0 0.0 0.0 mg/100 g European anchovy Type 1 specific Engraulis encrasicolus 184585 0.31 0.62 0.0 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.0 0.0 0.0 mg/100 g Feijoa Type 1 specific Feijoa sellowiana 260130 0.0 0.0 0.0 mg/100 g Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 0.0 0.0 0.0 mg/100 g Fireweed Type 1 specific Chamerion angustifolium 13055 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.075 0.15 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g Florida pompano Type 1 specific Trachinotus carolinus 173342 0.65 1.3 0.0 mg/100 g Freshwater drum Type 1 specific Aplodinotus grunniens 225389 2.0 2.0 2.0 mg/100 g Freshwater eel Type 1 specific Anguilla 7935 1.5 3.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.45 0.91 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.455 0.91 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden onion Type 1 specific Allium cepa 4679 0.0 0.0 0.0 mg/100 g Garden onion (var.) Type 1 specific Allium cepa var. cepa 4679 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garland chrysanthemum Type 1 specific Chrysanthemum coronarium 99038 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.0 0.0 0.0 mg/100 g German camomile Type 1 specific Matricaria recutita 127986 0.0 0.0 0.0 mg/100 g Giant butterbur Type 1 specific Petasites japonicus 186965 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Ginkgo nuts Type 1 specific Ginkgo biloba 3311 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Grapefruit/Pummelo hybrid Type 1 specific Citrus paradisi X Citrus maxima 37656 0.0 0.0 0.0 mg/100 g Grapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Greater sturgeon Type 1 specific Acipenser 7901 1.1 2.2 0.0 mg/100 g Greek feta cheese Type 2 0.845 1.69 0.0 mg/100 g Green cabbage Type 1 Brassica oleracea var. sabauda L. 0.0 0.0 0.0 mg/100 g Green lentil Type 1 Lens culinaris 0.0 0.0 0.0 mg/100 g Green plum Type 1 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Green zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.5 1.0 0.0 mg/100 g Grouper Type 1 specific Epinephelus 94231 0.6 0.6 0.6 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 0.37 0.37 0.37 mg/100 g Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.3 0.3 0.3 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Heart of palm Type 1 specific 0.0 0.0 0.0 mg/100 g Hibiscus tea Type 1 specific Hibiscus sabbariffa 183260 0.0 0.0 0.0 mg/100 g Hickory nut Type 1 specific Carya 13402 0.0 0.0 0.0 mg/100 g Hippoglossus (Common halibut) Type 1 specific Hippoglossus 8266 0.05 0.1 0.0 mg/100 g Honey Type 2 specific 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 3.0 3.0 3.0 mg/100 g Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hyacinth bean Type 1 specific Lablab purpureus 35936 0.0 0.0 0.0 mg/100 g Iceberg lettuce Type 1 0.0 0.0 0.0 mg/100 g Irish moss Type 1 specific Chondrus crispus 2769 0.0 0.0 0.0 mg/100 g Italian oregano Type 1 specific Origanum X majoricum 1384207 0.0 0.0 0.0 mg/100 g Jackfruit Type 1 specific Artocarpus heterophyllus 3489 0.0 0.0 0.0 mg/100 g Jalapeno pepper Type 1 Capsicum annuum 'Jalapeño' 0.0 0.0 0.0 mg/100 g Japanese chestnut Type 1 specific Castanea crenata 103480 0.0 0.0 0.0 mg/100 g Japanese persimmon Type 1 specific Diospyros kaki 35925 0.0 0.0 0.0 mg/100 g Japanese sea bass Type 1 Lateolabrax japonicus 0.15 0.3 0.0 mg/100 g Java plum Type 1 specific Syzygium cumini 260142 0.0 0.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Jew's ear Type 1 specific Auricularia auricula-judae 29892 0.0 0.0 0.0 mg/100 g Jicama Type 1 specific Pachyrhizus erosus 109171 0.0 0.0 0.0 mg/100 g Jujube Type 1 specific Ziziphus zizyphus 48393 0.0 0.0 0.0 mg/100 g Jute Type 1 specific Corchorus olitorius 93759 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 0.01 0.02 0.0 mg/100 g Kelp Type 1 specific Laminaria 33637 0.0 0.0 0.0 mg/100 g King mackerel Type 1 specific Scomberomorus cavalla 13679 15.6 15.6 15.6 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lambsquarters Type 1 specific Chenopodium album 3559 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon grass Type 1 specific Cymbopogon citratus 66014 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.075 0.15 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingcod Type 1 specific Ophiodon elongatus 225387 3.6 3.6 3.6 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Longan Type 1 specific Dimocarpus longan 128017 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lotus Type 1 specific Nelumbo 4430 0.0 0.0 0.0 mg/100 g Lupine Type 1 specific Lupinus 3869 0.0 0.0 0.0 mg/100 g Macadamia nut Type 1 specific Macadamia 4329 0.0 0.0 0.0 mg/100 g Macadamia nut (M. tetraphylla) Type 1 specific Macadamia tetraphylla 512563 0.0 0.0 0.0 mg/100 g Maitake Type 1 specific Grifola frondosa 5627 0.0 0.0 0.0 mg/100 g Malabar spinach Type 1 specific Basella alba 3589 0.0 0.0 0.0 mg/100 g Mamey sapote Type 1 specific Pouteria sapota 233744 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.0 0.0 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 6.0 12.0 0.0 mg/100 g Mexican oregano Type 1 specific Lippia graveolens 0.0 0.0 0.0 mg/100 g Milkfish Type 1 specific Chanos chanos 29144 3.4 3.4 3.4 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Molasses Type 2 specific 0.0 0.0 0.0 mg/100 g Monk fruit Type 1 Siraitia grosvenorii 0.0 0.0 0.0 mg/100 g Monkfish Type 1 specific Lophius piscatorius 8074 0.9 0.9 0.9 mg/100 g Moth bean Type 1 specific Vigna aconitifolia 3918 0.0 0.0 0.0 mg/100 g Mountain yam Type 1 specific Dioscorea pentaphylla 167592 0.0 0.0 0.0 mg/100 g Mozzarella cheese Type 2 0.875 0.875 0.875 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard spinach Type 1 specific Brassica perviridis 0.0 0.0 0.0 mg/100 g Napa cabbage Type 1 specific Brassica rapa var. pekinensis 51351 0.0 0.0 0.0 mg/100 g New Zealand spinach Type 1 specific Tetragonia tetragonioides 45318 0.0 0.0 0.0 mg/100 g Nopal Type 1 specific Opuntia cochenillifera 338184 0.0 0.0 0.0 mg/100 g Northern bluefin tuna Type 1 specific Thunnus thynnus 8237 4.715 9.43 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 1.0 2.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.3 0.3 0.3 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.9 0.9 0.9 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Ocean pout Type 1 specific Zoarces americanus 8199 0.9 0.9 0.9 mg/100 g Ohelo berry Type 1 specific Vaccinium reticulatum 180767 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 0.0 0.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Orange roughy Type 1 specific Hoplostethus atlanticus 96778 0.19 0.38 0.0 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 4.09125 5.01 1.475 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific cod Type 1 specific Gadus macrocephalus 80720 0.445 0.89 0.0 mg/100 g Pacific halibut Type 1 specific Hippoglossus stenolepis 195615 0.05 0.1 0.0 mg/100 g Pacific herring Type 1 specific Clupea pallasii 30724 10.0 10.0 10.0 mg/100 g Pacific jack mackerel Type 1 specific Trachurus symmetricus 271940 2.2 4.4 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.25 0.5 0.0 mg/100 g Pacific oyster Type 1 specific Crassostrea gigas 29159 16.0 16.0 16.0 mg/100 g Pacific rockfish Type 1 specific Sebastes 34820 0.36 0.72 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parmesan cheese Type 2 0.35 0.35 0.35 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pea shoots Type 1 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Peanut oil Type 2 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pectin Type 2 specific 0.0 0.0 0.0 mg/100 g Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Peppermint Type 1 specific Mentha X piperita 34256 0.0 0.0 0.0 mg/100 g Percoidei (Bass and others) Type 1 specific Percoidei 8112 3.82 3.82 3.82 mg/100 g Persian lime Type 1 specific Citrus latifolia 200541 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 0.84 0.84 0.84 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.0 0.0 0.0 mg/100 g Pili nut Type 1 specific Canarium ovatum 43691 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pink salmon Type 1 specific Oncorhynchus gorbuscha 8017 0.025 0.05 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pitanga Type 1 specific Eugenia uniflora 119951 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.9 0.9 0.9 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Pummelo Type 1 specific Citrus maxima 37334 0.0 0.0 0.0 mg/100 g Pumpkinseed sunfish Type 1 specific Lepomis gibbosus 270329 2.0 2.0 2.0 mg/100 g Purple laver Type 1 specific Porphyra laciniata 0.0 0.0 0.0 mg/100 g Purslane Type 1 specific Portulaca oleracea 46147 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 0.47 0.47 0.47 mg/100 g Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Quinoa Type 1 specific Chenopodium quinoa 63459 0.0 0.0 0.0 mg/100 g Radish Type 1 specific Raphanus sativus 3726 0.0 0.0 0.0 mg/100 g Rainbow smelt Type 1 specific Osmerus mordax 8014 1.72 3.44 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 4.45 4.45 4.45 mg/100 g Rambutan Type 1 specific Nephelium lappaceum 151071 0.0 0.0 0.0 mg/100 g Rapeseed oil Type 2 0.0 0.0 0.0 mg/100 g Red king crab Type 1 specific Paralithodes camtschaticus 6741 9.0 9.0 9.0 mg/100 g Red rice Type 1 specific Oryza rufipogon 4529 0.0 0.0 0.0 mg/100 g Red wine Type 2 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 0.0 0.0 0.0 mg/100 g Roe Type 2 generic 5.0 10.0 0.0 mg/100 g Roman camomile Type 1 specific Chamaemelum nobile 99037 0.0 0.0 0.0 mg/100 g Rosé wine Type 2 0.005 0.01 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 0.0 0.0 0.0 mg/100 g Rosemary Type 1 specific Rosmarinus officinalis 39367 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Sablefish Type 1 specific Anoplopoma fimbria 229290 1.5 1.5 1.5 mg/100 g Saffron Type 1 specific Crocus sativus 82528 0.0 0.0 0.0 mg/100 g Sake Type 2 specific 0.0 0.0 0.0 mg/100 g Salted butter Type 1 0.0225 0.045 0.0 mg/100 g Sapodilla Type 1 specific Manilkara zapota 3741 0.0 0.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scallop Type 1 specific Pectinidae 6566 0.0 0.0 0.0 mg/100 g Scup Type 1 specific Stenotomus chrysops 35579 0.7 1.4 0.0 mg/100 g Sea trout Type 1 specific Salmo trutta forma trutta 13028 3.0 3.0 3.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sesame oil Type 2 0.0 0.0 0.0 mg/100 g Sesbania flower Type 1 specific Sesbania bispinosa 485725 0.0 0.0 0.0 mg/100 g Shallot Type 1 specific Allium ascalonicum 1476995 0.0 0.0 0.0 mg/100 g Shark Type 1 specific Squaliformes 282414 0.745 1.49 0.0 mg/100 g Sheefish Type 1 specific Stenodus leucichthys 59296 2.95 5.9 0.0 mg/100 g Sheepshead Type 1 specific Archosargus probatocephalus 119682 2.0 2.0 2.0 mg/100 g Skipjack tuna Type 1 specific Katsuwonus pelamis 8226 1.9 1.9 1.9 mg/100 g Snail Type 1 specific Gastropoda 6448 0.25 0.5 0.0 mg/100 g Snapper Type 1 specific Lutjanidae 30850 1.5 3.0 0.0 mg/100 g Sockeye salmon Type 1 specific Oncorhynchus nerka 8023 0.63 1.26 0.0 mg/100 g Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682 0.0 0.0 0.0 mg/100 g Sorghum Type 1 specific Sorghum bicolor 4558 0.0 0.0 0.0 mg/100 g Sour cream Type 2 0.21 0.42 0.0 mg/100 g Soursop Type 1 specific Annona muricata 13337 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.85 0.85 0.85 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Soybean oil Type 2 0.0 0.0 0.0 mg/100 g Spanish mackerel Type 1 specific Scomberomorus maculatus 99344 1.2 2.4 0.0 mg/100 g Spearmint Type 1 specific Mentha spicata 29719 0.0 0.0 0.0 mg/100 g Spelt Type 1 specific Triticum spelta 58933 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny lobster Type 1 specific Palinuridae 6731 3.5 3.5 3.5 mg/100 g Spirulina Type 1 specific Spirulina 551299 0.0 0.0 0.0 mg/100 g Spot croaker Type 1 specific Leiostomus xanthurus 59837 3.0 3.0 3.0 mg/100 g Squab Type 1 specific Columba 8931 0.47 0.47 0.47 mg/100 g Squid Type 1 specific Teuthida 551290 0.65 1.3 0.0 mg/100 g Star anise Type 1 specific Illicium verum 124778 0.0 0.0 0.0 mg/100 g Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry guava Type 1 specific Psidium cattleianum 375274 0.0 0.0 0.0 mg/100 g Striped bass Type 1 specific Morone saxatilis 34816 3.82 3.82 3.82 mg/100 g Striped mullet Type 1 specific Mugil cephalus 48193 0.11 0.22 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 1.1 2.2 0.0 mg/100 g Summer savory Type 1 specific Satureja hortensis 49987 0.0 0.0 0.0 mg/100 g Sunflower oil Type 2 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet basil Type 1 specific Ocimum basilicum 39350 0.0 0.0 0.0 mg/100 g Sweet marjoram Type 1 specific Origanum majorana 268884 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.0 0.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Swiss cheese Type 2 0.8 0.8 0.8 mg/100 g Swordfish Type 1 specific Xiphias gladius 8245 0.4 0.8 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tapioca pearl Type 2 specific 0.0 0.0 0.0 mg/100 g Taro Type 1 specific Colocasia esculenta 4460 0.0 0.0 0.0 mg/100 g Tilefish Type 1 specific Lopholatilus chamaeleonticeps 390349 2.2 2.2 2.2 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g Tree fern Type 1 specific Cyathea 0.0 0.0 0.0 mg/100 g Triticale Type 1 specific X Triticosecale rimpaui 0.0 0.0 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.2 0.4 0.0 mg/100 g True sole Type 1 specific Soleidae 30948 0.075 0.15 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 2.2 2.2 2.2 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.62 1.24 0.0 mg/100 g Turmeric Type 1 specific Curcuma longa 136217 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Ucuhuba Type 1 specific Virola surinamensis 224910 0.0 0.0 0.0 mg/100 g Vanilla Type 1 specific Vanilla 51238 0.0 0.0 0.0 mg/100 g Vinegar Type 2 specific 0.0 0.0 0.0 mg/100 g Vodka Type 2 specific 0.0 0.0 0.0 mg/100 g Wakame Type 1 specific Undaria pinnatifida 74381 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Wasabi Type 1 specific Wasabia japonica 75806 0.0 0.0 0.0 mg/100 g Water spinach Type 1 Ipomoea aquatica 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wax gourd Type 1 specific Benincasa hispida 102211 0.0 0.0 0.0 mg/100 g Welsh onion Type 1 specific Allium fistulosum 35875 0.0 0.0 0.0 mg/100 g Whelk Type 1 specific Buccinidae 37796 4.535 9.07 0.0 mg/100 g White sucker Type 1 specific Catostomus commersonii 7971 2.0 2.0 2.0 mg/100 g White wine Type 2 0.0 0.0 0.0 mg/100 g Whitefish Type 1 specific Coregonus 27772 0.5 1.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 1.15 2.3 0.0 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Wild leek Type 1 specific Allium ampeloprasum 4681 0.0 0.0 0.0 mg/100 g Wild rice Type 1 specific Zizania 15949 0.0 0.0 0.0 mg/100 g Winged bean Type 1 specific Psophocarpus tetragonolobus 3891 0.0 0.0 0.0 mg/100 g Winter squash Type 1 specific Cucurbita maxima 3661 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Yardlong bean Type 1 specific Vigna unguiculata ssp. sesquipedalis 138955 0.0 0.0 0.0 mg/100 g Yautia Type 1 specific Xanthosoma sagittifolium 28478 0.0 0.0 0.0 mg/100 g Yellow zucchini Type 1 specific Cucurbita pepo var. cylindrica 0.0 0.0 0.0 mg/100 g Yellowfin tuna Type 1 specific Thunnus albacares 8236 0.35 0.7 0.0 mg/100 g Yellowtail amberjack Type 1 specific Seriola lalandi 302047 1.3 1.3 1.3 mg/100 g Cob(I)yrinic acid a,c-diamide adenosyltransferase, mitochondrial Q96EY8 MMAB Methylmalonic aciduria type A protein, mitochondrial Q8IVH4 MMAA Methylmalonyl-CoA mutase, mitochondrial P22033 MUT