1.0 2010-04-08 22:05:45 UTC 2025-11-18 22:50:29 UTC FDB003306 Nonanoic acid Pelargonic acid, also known as nonanoic acid or pelargon, belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Pelargonic acid is an oily liquid with an unpleasant, rancid odor. It is a very hydrophobic molecule, practically insoluble in water but very soluble in organic solvents. The biosynthesis of fatty acid occurs through the acetate pathway and the process is catalyzed by the Fatty Acid Synthase (FAS) enzymes. Structurally, FAS varies significantly across different organisms but essentially, they all perform the same task using the same mechanisms. Nonanoic acid is also used in the preparation of plasticizers and lacquers. Synthetic esters of nonanoic acid, such as methyl nonanoate, are used as flavorings. The derivative 4-nonanoylmorpholine is an ingredient in some pepper sprays. The ammonium salt of nonanoic acid, ammonium nonanoate, is an herbicide. It is commonly used in conjunction with glyphosate, a non-selective herbicide, to control weeds in turfgrass (https://en.wikipedia.org/wiki/Nonanoic_acid). Nonanoic acid may be used to treat seizures (PMID 23177536). 1-Nonanoate 1-Nonanoic acid 1-Octanecarboxylate 1-Octanecarboxylic acid CH3-[CH2]7-COOH Cirrasol 185a Emery 1202 Emery'S L-114 Emfac 1202 FEMA 2784 Hexacid C-9 N-Nonanoate N-Nonanoic acid N-Nonoate N-Nonoic acid N-Nonylate N-Nonylic acid N-Pelargonate N-Pelargonic acid Nonanoate Nonansaeure Nonoate Nonoic acid Nonylate Nonylic acid Octane-1-carboxylic acid Pelargate Pelargic acid Pelargon Pelargonate Pelargonic acid Pelargonsaeure Pergonate Pergonic acid C9H18O2 158.238 158.13067982 nonanoic acid nonanoic acid 112-05-0 CCCCCCCCC(O)=O InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11) FBUKVWPVBMHYJY-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Straight chain fatty acids Straight chain fatty acids medium-chain fatty acid straight-chain saturated fatty acid Liquid logp 3.47 ALOGPS logs -2.75 ALOGPS solubility 2.81e-01 g/l ALOGPS melting_point Fp 12.24° logp 3.14 ChemAxon pka_strongest_acidic 5.23 ChemAxon iupac nonanoic acid ChemAxon average_mass 158.238 ChemAxon mono_mass 158.13067982 ChemAxon smiles CCCCCCCCC(O)=O ChemAxon formula C9H18O2 ChemAxon inchi InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11) ChemAxon inchikey FBUKVWPVBMHYJY-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 44.88 ChemAxon polarizability 19.49 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 793 Specdb::CMs 656 Specdb::CMs 1075 Specdb::CMs 3413 Specdb::CMs 29031 Specdb::CMs 29470 Specdb::CMs 30119 Specdb::CMs 30649 Specdb::CMs 31245 Specdb::CMs 31947 Specdb::CMs 37800 Specdb::CMs 137156 Specdb::CMs 144890 Specdb::CMs 1079462 Specdb::NmrTwoD 1507 Specdb::MsIr 905 Specdb::MsIr 906 Specdb::MsIr 907 Specdb::NmrOneD 1565 Specdb::NmrOneD 2158 Specdb::NmrOneD 2845 Specdb::NmrOneD 5079 Specdb::NmrOneD 5080 Specdb::MsMs 1193 Specdb::MsMs 1194 Specdb::MsMs 1195 Specdb::MsMs 4715 Specdb::MsMs 4716 Specdb::MsMs 4717 Specdb::MsMs 4718 Specdb::MsMs 4719 Specdb::MsMs 4720 Specdb::MsMs 4721 Specdb::MsMs 7523 Specdb::MsMs 7524 Specdb::MsMs 7525 Specdb::MsMs 14195 Specdb::MsMs 14196 Specdb::MsMs 14197 Specdb::MsMs 438325 Specdb::MsMs 438326 Specdb::MsMs 438327 Specdb::MsMs 438328 Specdb::MsMs 438329 Specdb::MsMs 438670 Specdb::MsMs 2226880 Specdb::MsMs 2227809 Specdb::MsMs 2229244 HMDB00847 29019 KNA #<Reference:0x000055ce32554708> #<Reference:0x000055ce32554550> #<Reference:0x000055ce32554398> #<Reference:0x000055ce325541e0> #<Reference:0x000055ce32554028> #<Reference:0x000055ce32553e20> #<Reference:0x000055ce32553c68> #<Reference:0x000055ce32553ab0> Adzuki bean Type 1 specific Vigna angularis 3914 0.0 0.0 0.0 mg/100 g Agar Type 1 specific Eucheuma 31444 0.0 0.0 0.0 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.0 0.0 0.0 mg/100 g Allium Type 1 specific Allium 4678 0.0 0.0 0.0 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.0 0.0 0.0 mg/100 g Anatidae Type 1 specific Anatidae 8830 0.0 0.0 0.0 mg/100 g Anchovy Type 1 specific Engraulidae 43062 0.0 0.0 0.0 mg/100 g Anguilliformes Type 1 specific Anguilliformes 7933 0.0 0.0 0.0 mg/100 g Apple Type 1 specific Malus pumila 283210 0.0 0.0 0.0 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.0 0.0 0.0 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.0 0.0 0.0 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.0 0.0 0.0 mg/100 g Atlantic halibut Type 1 specific Hippoglossus hippoglossus 8267 0.0 0.0 0.0 mg/100 g Atlantic wolffish Type 1 specific Anarhichas lupus 8204 0.0 0.0 0.0 mg/100 g Avocado Type 1 specific Persea americana 3435 0.0 0.0 0.0 mg/100 g Baby food Type 2 specific 0.0 0.0 0.0 mg/100 g Bamboo shoots Type 1 specific Phyllostachys edulis 38705 0.0 0.0 0.0 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.0 0.0 0.0 mg/100 g Beefalo Type 1 specific Bos taurus X Bison bison 297284 Beer Type 2 specific 0.0 0.0 0.0 mg/100 g Bilberry Type 1 specific Vaccinium myrtillus 180763 0.0 0.0 0.0 mg/100 g Biscuit Type 2 specific 233.5 513.0 0.0 mg/100 g Bison Type 1 specific Bison bison 9901 Black salsify Type 1 specific Scorzonera hispanica 114289 0.0 0.0 0.0 mg/100 g Black tea Type 1 0.0 0.0 0.0 mg/100 g Black walnut Type 1 specific Juglans nigra 16719 0.0 0.0 0.0 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.0 0.0 0.0 mg/100 g Blue whiting Type 1 specific Micromesistius poutassou 81636 0.0 0.0 0.0 mg/100 g Brazil nut Type 1 specific Bertholletia excelsa 3645 0.0 0.0 0.0 mg/100 g Breakfast cereal Type 2 specific 0.0 0.0 0.0 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.0 0.0 0.0 mg/100 g Brussel sprouts Type 1 specific Brassica oleracea var. gemmifera 178616 0.0 0.0 0.0 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Burbot Type 1 specific Lota lota 69944 0.0 0.0 0.0 mg/100 g Butter Type 2 specific 2415.0 2630.0 2200.0 mg/100 g Buttermilk Type 2 specific 16.0 16.0 16.0 mg/100 g Carp bream Type 1 specific Abramis brama 38527 0.0 0.0 0.0 mg/100 g Carrot Type 1 specific Daucus carota ssp. sativus 79200 0.0 0.0 0.0 mg/100 g Casein Type 2 specific 46.0 46.0 46.0 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 74.5 132.0 17.0 mg/100 g Cassava Type 1 specific Manihot esculenta 3983 0.0 0.0 0.0 mg/100 g Catfish Type 1 specific Siluriformes 7995 0.0 0.0 0.0 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 0.0 0.0 0.0 mg/100 g Cauliflower Type 1 specific Brassica oleracea var. botrytis 3715 0.0 0.0 0.0 mg/100 g Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 0.0 0.0 0.0 mg/100 g Celery leaves Type 1 specific Apium graveolens var. secalinum 941588 0.0 0.0 0.0 mg/100 g Cetacea (Dolphin, Porpoise, Whale) Type 1 specific Cetacea 9721 0.0 0.0 0.0 mg/100 g Chanterelle Type 1 specific Cantharellus cibarius 36066 0.0 0.0 0.0 mg/100 g Charr Type 1 specific Salvelinus 8033 0.0 0.0 0.0 mg/100 g Chayote Type 1 specific Sechium edule 184140 0.0 0.0 0.0 mg/100 g Cheese Type 2 specific 714.033333 1380.0 12.0 mg/100 g Cherimoya Type 1 specific Annona cherimola 49314 0.0 0.0 0.0 mg/100 g Chervil Type 1 specific Anthriscus cerefolium 40888 0.0 0.0 0.0 mg/100 g Chestnut Type 1 specific Castanea 21019 0.0 0.0 0.0 mg/100 g Chewing gum Type 2 specific 0.0 0.0 0.0 mg/100 g Chicken Type 1 specific Gallus gallus 9031 0.0 0.0 0.0 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.0 0.0 0.0 mg/100 g Chicory Type 1 specific Cichorium intybus 13427 0.0 0.0 0.0 mg/100 g Chinese cabbage Type 1 specific Brassica rapa 3711 0.0 0.0 0.0 mg/100 g Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260 Chives Type 1 specific Allium schoenoprasum 74900 0.0 0.0 0.0 mg/100 g Chocolate Type 2 specific 41.0 112.0 0.0 mg/100 g Chocolate spread Type 2 specific 0.0 0.0 0.0 mg/100 g Cinnamon Type 1 specific Cinnamomum 13428 5.0 5.0 5.0 mg/100 g Clawed lobster Type 1 specific Nephropidae 6704 0.0 0.0 0.0 mg/100 g Clupeinae (Herring, Sardine, Sprat) Type 1 specific Clupeinae 7948 5.6 112.0 0.0 mg/100 g Cocoa bean Type 1 specific Theobroma cacao 3641 Cocoa butter Type 2 specific 0.0 0.0 0.0 mg/100 g Cocoa powder Type 2 specific 0.0 0.0 0.0 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 4747.5 6000.0 2570.0 mg/100 g Coffee Type 1 generic Coffea 13442 0.0 0.0 0.0 mg/100 g Cold cut Type 2 specific 0.0 0.0 0.0 mg/100 g Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 0.0 0.0 0.0 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.0 0.0 0.0 mg/100 g Common buckwheat Type 1 specific Fagopyrum esculentum 3617 0.0 0.0 0.0 mg/100 g Common cabbage Type 1 specific Brassica oleracea 3712 0.0 0.0 0.0 mg/100 g Common dab Type 1 specific Limanda limanda 27771 0.0 0.0 0.0 mg/100 g Common ling Type 1 specific Molva molva 163112 0.0 0.0 0.0 mg/100 g Common mushroom Type 1 specific Agaricus bisporus 5341 0.0 0.0 0.0 mg/100 g Common octopus Type 1 specific Octopus vulgaris 6645 0.0 0.0 0.0 mg/100 g Common oregano Type 1 specific Origanum vulgare 39352 0.09 0.09 0.09 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.0 0.0 0.0 mg/100 g Coriander Type 1 specific Coriandrum sativum 4047 0.0 0.0 0.0 mg/100 g Corn Type 1 specific Zea mays 4577 73.333333 660.0 0.0 mg/100 g Cottonseed Type 1 specific Gossypium 3633 0.0 0.0 0.0 mg/100 g Crab Type 1 specific Brachyura 6752 0.0 0.0 0.0 mg/100 g Cracker Type 2 specific 0.0 0.0 0.0 mg/100 g Crayfish Type 1 specific Astacidea 6712 0.0 0.0 0.0 mg/100 g Cream Type 2 specific 587.444444 1240.0 281.0 mg/100 g Crisp bread Type 2 specific 0.0 0.0 0.0 mg/100 g Cucumber Type 1 specific Cucumis sativus 3659 0.0 0.0 0.0 mg/100 g Cucurbita Type 1 specific Cucurbita 3660 0.0 0.0 0.0 mg/100 g Curry powder Type 2 specific 0.0 0.0 0.0 mg/100 g Daikon radish Type 1 specific Raphanus sativus var. longipinnatus 41679 0.0 0.0 0.0 mg/100 g Dandelion Type 1 specific Taraxacum officinale 50225 0.0 0.0 0.0 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.0 0.0 0.0 mg/100 g Deer Type 1 specific Cervidae 9850 Dill Type 1 specific Anethum graveolens 40922 0.0 0.0 0.0 mg/100 g Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 3.938272 32.0 0.0 mg/100 g Dragée Type 2 specific 0.0 0.0 0.0 mg/100 g Dried milk Type 2 specific 430.0 836.0 24.0 mg/100 g Dumpling Type 2 specific 0.0 0.0 0.0 mg/100 g Eggplant Type 1 specific Solanum melongena 4111 0.0 0.0 0.0 mg/100 g Eggs Unknown generic 0.0 0.0 0.0 mg/100 g Elderberry Type 1 specific Sambucus 4201 0.0 0.0 0.0 mg/100 g Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 Endive Type 1 specific Cichorium endivia 114280 0.0 0.0 0.0 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.0 0.0 0.0 mg/100 g European rabbit Type 1 specific Oryctolagus 9984 Fennel Type 1 specific Foeniculum vulgare 48038 0.0 0.0 0.0 mg/100 g Fig Type 1 specific Ficus carica 3494 18.666667 56.0 0.0 mg/100 g Fish oil Type 1 0.0 0.0 0.0 mg/100 g Flatfish Type 1 specific Pleuronectiformes 8252 0.0 0.0 0.0 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.0 0.0 0.0 mg/100 g French plantain Type 1 specific Musa X paradisiaca 89151 0.0 0.0 0.0 mg/100 g Fruit gum Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit juice Type 2 specific 0.0 0.0 0.0 mg/100 g Fruit preserve Type 2 specific 0.0 0.0 0.0 mg/100 g Gadiformes Type 1 specific Gadiformes 8043 0.0 0.0 0.0 mg/100 g Gadus (Common cod) Type 1 specific Gadus 8048 0.0 0.0 0.0 mg/100 g Garden cress Type 1 specific Lepidium sativum 33125 0.0 0.0 0.0 mg/100 g Garden rhubarb Type 1 specific Rheum rhabarbarum 3621 0.0 0.0 0.0 mg/100 g Garden tomato Type 1 specific Solanum lycopersicum 4081 0.0 0.0 0.0 mg/100 g Garfish Type 1 specific Belone belone 129037 0.0 0.0 0.0 mg/100 g Garlic Type 1 specific Allium sativum 4682 2.5 3.0 2.0 mg/100 g Gelatin Type 2 specific 0.0 0.0 0.0 mg/100 g Gelatin dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Ginger Type 1 specific Zingiber officinale 94328 0.0 0.0 0.0 mg/100 g Globe artichoke Type 1 specific Cynara scolymus 59895 0.0 0.0 0.0 mg/100 g Gooseberry Type 1 specific Ribes uva-crispa 135518 0.0 0.0 0.0 mg/100 g Grape Type 1 specific Vitis 3603 0.0 0.0 0.0 mg/100 g Grape wine Type 2 specific 0.0 0.0 0.0 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.0 0.0 0.0 mg/100 g Green tea Type 1 0.0 0.0 0.0 mg/100 g Greenland halibut/turbot Type 1 specific Reinhardtius hippoglossoides 111784 0.0 0.0 0.0 mg/100 g Greylag goose Type 1 specific Anser anser 8843 Groundcherry Type 1 specific Physalis 24663 0.0 0.0 0.0 mg/100 g Guava Type 1 specific Psidium guajava 120290 0.0 0.0 0.0 mg/100 g Guinea hen Type 1 specific Numida meleagris 8996 Haddock Type 1 specific Melanogrammus aeglefinus 8056 0.0 0.0 0.0 mg/100 g Hard wheat Type 1 specific Triticum durum 4567 0.0 0.0 0.0 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.0 0.0 0.0 mg/100 g Herbal tea Type 1 0.0 0.0 0.0 mg/100 g Horse Type 1 specific Equus caballus 9796 Horseradish Type 1 specific Armoracia rusticana 3704 0.0 0.0 0.0 mg/100 g Hot chocolate Type 2 specific 35.0 55.0 16.0 mg/100 g Hyssop Type 1 specific Hyssopus officinalis 39324 Ice cream Type 2 specific 84.8 257.0 0.0 mg/100 g Jerusalem artichoke Type 1 specific Helianthus tuberosus 4233 0.0 0.0 0.0 mg/100 g Kale Type 1 specific Brassica napus var. pabularia 0.0 0.0 0.0 mg/100 g Kefir Type 2 specific 112.0 112.0 112.0 mg/100 g Ketchup Type 2 specific 0.0 0.0 0.0 mg/100 g Kiwi Type 1 specific Actinidia chinensis 3625 0.0 0.0 0.0 mg/100 g Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.0 0.0 0.0 mg/100 g Kombu Type 1 specific Saccharina japonica 88149 0.0 0.0 0.0 mg/100 g Kumquat Type 1 specific Fortunella 2706 0.0 0.0 0.0 mg/100 g Lake trout Type 1 specific Salvelinus namaycush 8040 0.0 0.0 0.0 mg/100 g Lard Type 2 specific 0.0 0.0 0.0 mg/100 g Leavening agent Type 2 specific 0.0 0.0 0.0 mg/100 g Leek Type 1 specific Allium porrum 0.0 0.0 0.0 mg/100 g Lemon Type 1 specific Citrus limon 2708 0.0 0.0 0.0 mg/100 g Lemon sole Type 1 specific Microstomus kitt 106175 0.0 0.0 0.0 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.0 0.0 0.0 mg/100 g Lettuce Type 1 specific Lactuca sativa 4236 0.0 0.0 0.0 mg/100 g Lichee Type 1 specific Litchi chinensis 151069 0.0 0.0 0.0 mg/100 g Lime Type 1 specific Citrus aurantiifolia 159033 0.0 0.0 0.0 mg/100 g Lingonberry Type 1 specific Vaccinium vitis-idaea 180772 0.0 0.0 0.0 mg/100 g Liquor Type 2 specific 42.0 336.0 0.0 mg/100 g Liquorice Type 2 specific 0.0 0.0 0.0 mg/100 g Loganberry Type 1 specific Rubus loganobaccus 0.0 0.0 0.0 mg/100 g Loquat Type 1 specific Eriobotrya japonica 32224 0.0 0.0 0.0 mg/100 g Lumpsucker Type 1 specific Cyclopteridae 8101 0.0 0.0 0.0 mg/100 g Mallard duck Type 1 specific Anas platyrhynchos 8839 Malus (Crab apple) Type 1 specific Malus 3749 0.0 0.0 0.0 mg/100 g Mandarin orange (Clementine, Tangerine) Type 1 specific Citrus reticulata 85571 0.033333 0.1 0.0 mg/100 g Mango Type 1 specific Mangifera indica 29780 0.0 0.0 0.0 mg/100 g Margarine Type 2 specific 41.666667 130.0 0.0 mg/100 g Margarine-like spread Type 2 specific 1670.0 1670.0 1670.0 mg/100 g Marine mussel Type 1 specific Mytilidae 6547 0.0 0.0 0.0 mg/100 g Marshmallow Type 2 specific 0.0 0.0 0.0 mg/100 g Marzipan Type 2 specific 0.0 0.0 0.0 mg/100 g Meat bouillon Type 2 specific 0.0 0.0 0.0 mg/100 g Meatball Type 2 specific 0.0 0.0 0.0 mg/100 g Meringue Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Cow) Type 2 specific 35.428375 109.0 0.251 mg/100 g Milk (Human) Type 2 specific 0.0 0.0 0.0 mg/100 g Milk (Other mammals) Type 2 specific 284.0 284.0 284.0 mg/100 g Millet Type 1 specific Panicum miliaceum 4540 0.0 0.0 0.0 mg/100 g Miso Type 2 specific 0.0 0.0 0.0 mg/100 g Mountain hare Type 1 specific Lepus timidus 62621 0.0 0.0 0.0 mg/100 g Mule deer Type 1 specific Odocoileus 9871 Mung bean Type 1 specific Vigna radiata 157791 0.0 0.0 0.0 mg/100 g Muskmelon Type 1 specific Cucumis melo 3656 0.0 0.0 0.0 mg/100 g Mustard Type 2 specific 0.0 0.0 0.0 mg/100 g Nectarine Type 1 specific Prunus persica var. nucipersica 323851 0.0 0.0 0.0 mg/100 g Northern pike Type 1 specific Esox lucius 8010 0.0 0.0 0.0 mg/100 g Norway haddock Type 1 specific Sebastes viviparus 394708 0.0 0.0 0.0 mg/100 g Norway lobster Type 1 specific Nephrops norvegicus 6829 0.0 0.0 0.0 mg/100 g Norway pout Type 1 specific Trisopterus esmarkii 80723 0.0 0.0 0.0 mg/100 g Nutmeg Type 1 specific Myristica fragrans 51089 0.0 0.0 0.0 mg/100 g Oat Type 1 specific Avena sativa 4498 0.0 0.0 0.0 mg/100 g Oil palm Type 1 specific Elaeis 51952 1850.0 3700.0 0.0 mg/100 g Okra Type 1 specific Abelmoschus esculentus 455045 0.0 0.0 0.0 mg/100 g Olive Type 1 specific Olea europaea 4146 0.0 0.0 0.0 mg/100 g Orange mint Type 1 specific Mentha aquatica 190902 0.105 0.105 0.105 mg/100 g Ostrich Type 1 specific Struthio camelus 8801 Other alcoholic beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Other animal fat Type 2 specific 33.0 66.0 0.0 mg/100 g Other bread Type 2 specific 3.222222 26.0 0.0 mg/100 g Other bread product Type 2 specific 0.0 0.0 0.0 mg/100 g Other candy Type 2 specific 0.0 0.0 0.0 mg/100 g Other dish Type 2 specific 0.0 0.0 0.0 mg/100 g Other fermented milk Type 2 specific 110.5 112.0 109.0 mg/100 g Other fish product Type 2 specific 0.0 0.0 0.0 mg/100 g Other frozen dessert Type 2 specific 0.0 0.0 0.0 mg/100 g Other fruit product Type 2 specific 67.0 67.0 67.0 mg/100 g Other snack food Type 2 specific 430.666667 758.0 0.0 mg/100 g Oyster mushroom Type 1 specific Pleurotus ostreatus 5322 0.0 0.0 0.0 mg/100 g Pacific ocean perch Type 1 specific Sebastes alutus 72055 0.0 0.0 0.0 mg/100 g Pak choy Type 1 specific Brassica rapa var. chinensis 93385 0.0 0.0 0.0 mg/100 g Papaya Type 1 specific Carica papaya 3649 0.0 0.0 0.0 mg/100 g Parsley Type 1 specific Petroselinum crispum 4043 0.0 0.0 0.0 mg/100 g Parsnip Type 1 specific Pastinaca sativa 4041 0.0 0.0 0.0 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.0 0.0 0.0 mg/100 g Pasta Type 2 specific 0.0 0.0 0.0 mg/100 g Pastry Type 2 specific 155.636364 518.0 0.0 mg/100 g Pate Type 2 specific 0.0 0.0 0.0 mg/100 g Peach Type 1 specific Prunus persica 3760 0.0 0.0 0.0 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.0 0.0 0.0 mg/100 g Pear Type 1 specific Pyrus communis 23211 0.0 0.0 0.0 mg/100 g Pecan nut Type 1 specific Carya illinoinensis 32201 0.0 0.0 0.0 mg/100 g Pepper Type 1 specific Capsicum annuum 4072 0.0 0.0 0.0 mg/100 g Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Pepper (Spice) Type 1 specific Piper nigrum 13216 0.0 0.0 0.0 mg/100 g Perciformes Type 1 specific Perciformes 8111 0.0 0.0 0.0 mg/100 g Persimmon Type 1 specific Diospyros 13492 0.0 0.0 0.0 mg/100 g Pheasant Type 1 specific Phasianus colchicus 9054 Pikeperch Type 1 specific Sander lucioperca 283035 0.0 0.0 0.0 mg/100 g Pine nut Type 1 specific Pinus 3337 0.0 0.0 0.0 mg/100 g Pineapple Type 1 specific Ananas comosus 4615 0.0 0.0 0.0 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 0.0 0.0 0.0 mg/100 g Pizza Type 2 specific 0.0 0.0 0.0 mg/100 g Pleuronectidae (Dab, Halibut, Plaice) Type 1 specific Pleuronectidae 8256 0.0 0.0 0.0 mg/100 g Pollock Type 1 specific Pollachius 8059 0.0 0.0 0.0 mg/100 g Pomegranate Type 1 specific Punica granatum 22663 0.0 0.0 0.0 mg/100 g Poppy Type 1 specific Papaver 3468 0.0 0.0 0.0 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 1.8 15.0 0.0 mg/100 g Prickly pear Type 1 specific Opuntia 106975 0.0 0.0 0.0 mg/100 g Prunus (Cherry, Plum) Type 1 specific Prunus 3754 0.0 0.0 0.0 mg/100 g Quail Type 1 specific Phasianidae 9005 Quince Type 1 specific Cydonia oblonga 36610 0.0 0.0 0.0 mg/100 g Rabbit Type 1 specific Leporidae 9979 0.0 0.0 0.0 mg/100 g Rainbow trout Type 1 specific Oncorhynchus mykiss 8022 0.0 0.0 0.0 mg/100 g Rape Type 1 specific Brassica napus var. napus 138011 0.0 0.0 0.0 mg/100 g Red beetroot Type 1 specific Beta vulgaris var. rubra 0.0 0.0 0.0 mg/100 g Red tea Type 1 0.0 0.0 0.0 mg/100 g Redcurrant Type 1 specific Ribes rubrum 175228 0.0 0.0 0.0 mg/100 g Remoulade Type 2 specific 0.0 0.0 0.0 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.0 0.0 0.0 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.0 0.0 0.0 mg/100 g Rock ptarmigan Type 1 specific Lagopus muta 64668 0.0 0.0 0.0 mg/100 g Rocket salad (ssp.) Type 1 specific Eruca vesicaria ssp. sativa 29727 Rose hip Type 1 specific Rosa 3764 0.0 0.0 0.0 mg/100 g Roselle Type 1 specific Hibiscus sabdariffa 183260 Rubus (Blackberry, Raspberry) Type 1 specific Rubus 23216 0.0 0.0 0.0 mg/100 g Rye Type 1 specific Secale cereale 4550 0.0 0.0 0.0 mg/100 g Rye bread Type 2 specific 1.647059 26.0 0.0 mg/100 g Safflower Type 1 specific Carthamus tinctorius 4222 0.0 0.0 0.0 mg/100 g Salad dressing Type 2 specific 0.0 0.0 0.0 mg/100 g Salmonidae (Salmon, Trout) Type 1 specific Salmonidae 8015 0.0 0.0 0.0 mg/100 g Salt Type 2 specific 0.0 0.0 0.0 mg/100 g Sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Sausage Type 2 specific 1.235294 21.0 0.0 mg/100 g Savoy cabbage Type 1 specific Brassica oleracea var. sabauda 1216010 0.0 0.0 0.0 mg/100 g Scombridae (Bonito, Mackerel, Tuna) Type 1 specific Scombridae 8224 0.0 0.0 0.0 mg/100 g Semolina Type 2 specific 0.0 0.0 0.0 mg/100 g Sesame Type 1 specific Sesamum orientale 4182 0.0 0.0 0.0 mg/100 g Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 0.0 0.0 0.0 mg/100 g Sherry Type 2 specific 0.0 0.0 0.0 mg/100 g Shrimp Type 1 specific Caridea 6694 0.0 0.0 0.0 mg/100 g Snail Type 1 specific Gastropoda 6448 0.0 0.0 0.0 mg/100 g Soft drink Type 2 specific 0.0 0.0 0.0 mg/100 g Sorrel Type 1 specific Rumex acetosa 41241 0.0 0.0 0.0 mg/100 g Soup Type 2 specific 0.0 0.0 0.0 mg/100 g Soy bean Type 1 specific Glycine max 3847 0.0 0.0 0.0 mg/100 g Soy milk Type 2 specific 0.0 0.0 0.0 mg/100 g Soy sauce Type 2 specific 0.0 0.0 0.0 mg/100 g Spinach Type 1 specific Spinacia oleracea 3562 0.0 0.0 0.0 mg/100 g Spiny dogfish Type 1 specific Squalus acanthias 7797 0.0 0.0 0.0 mg/100 g Spirit Type 2 specific 0.0 0.0 0.0 mg/100 g Squab Type 1 specific Columba 8931 Star fruit Type 1 specific Averrhoa carambola 28974 0.0 0.0 0.0 mg/100 g Strawberry Type 1 specific Fragaria X ananassa 3747 0.0 0.0 0.0 mg/100 g Sturgeon Type 1 specific Acipenseridae 7900 0.0 0.0 0.0 mg/100 g Sugar Type 2 specific 0.0 0.0 0.0 mg/100 g Sugar substitute Type 2 specific 0.0 0.0 0.0 mg/100 g Sunflower Type 1 specific Helianthus annuus 4232 0.0 0.0 0.0 mg/100 g Swede Type 1 specific Brassica napus 3708 0.0 0.0 0.0 mg/100 g Sweet bay Type 1 specific Laurus nobilis 85223 Sweet orange Type 1 specific Citrus sinensis 2711 0.0 0.0 0.0 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.333333 1.0 0.0 mg/100 g Swiss chard Type 1 specific Beta vulgaris ssp. cicla 1527200 0.0 0.0 0.0 mg/100 g Syrup Type 2 specific 0.0 0.0 0.0 mg/100 g Tallow Type 2 specific 0.0 0.0 0.0 mg/100 g Tamarind Type 1 specific Tamarindus indica 58860 0.0 0.0 0.0 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.0 0.0 0.0 mg/100 g Thistle Type 1 specific Cirsium 41549 0.0 0.0 0.0 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.0 0.0 0.0 mg/100 g Toffee Type 2 specific 0.0 0.0 0.0 mg/100 g Tofu Type 2 specific 0.0 0.0 0.0 mg/100 g True frog Type 1 specific Ranidae 8397 0.0 0.0 0.0 mg/100 g True seal Type 1 specific Phocidae 9709 0.0 0.0 0.0 mg/100 g Turbot Type 1 specific Scophthalmus maximus 52904 0.0 0.0 0.0 mg/100 g Turkey Type 1 specific Meleagris gallopavo 9103 0.0 0.0 0.0 mg/100 g Turnip Type 1 specific Brassica rapa var. rapa 51350 0.0 0.0 0.0 mg/100 g Unclassified food or beverage Type 2 specific 0.0 0.0 0.0 mg/100 g Vaccinium (Blueberry, Cranberry, Huckleberry) Type 1 specific Vaccinium 13749 0.0 0.0 0.0 mg/100 g Vegetable juice Type 2 specific 0.0 0.0 0.0 mg/100 g Velvet duck Type 1 specific Melanitta fusca 371864 Vermouth Type 2 specific 0.0 0.0 0.0 mg/100 g Walnut Type 1 specific Juglans 16718 0.0 0.0 0.0 mg/100 g Water Type 2 specific 0.0 0.0 0.0 mg/100 g Watercress Type 1 specific Rorippa nasturtium-aquaticum 135518 0.0 0.0 0.0 mg/100 g Watermelon Type 1 specific Citrullus lanatus 3654 0.0 0.0 0.0 mg/100 g Wheat Type 1 specific Triticum 4564 4.571429 18.0 0.0 mg/100 g Wheat bread Type 2 specific 0.210526 4.0 0.0 mg/100 g Whey Type 2 specific 289.0 842.0 6.0 mg/100 g Whisky Type 2 specific 0.0 0.0 0.0 mg/100 g White bread Type 1 1.0 1.0 1.0 mg/100 g White mustard Type 1 specific Sinapis alba 3728 Whitefish Type 1 specific Coregonus 27772 0.0 0.0 0.0 mg/100 g Whiting Type 1 specific Merlangius merlangus 8058 0.0 0.0 0.0 mg/100 g Wild boar Type 1 specific Sus scrofa 9823 Wild celery Type 1 specific Apium graveolens 4045 0.0 0.0 0.0 mg/100 g Yam Type 1 specific Dioscorea 4672 0.0 0.0 0.0 mg/100 g Ymer Type 2 specific 80.0 104.0 56.0 mg/100 g Yogurt Type 2 specific 90.2 240.0 0.0 mg/100 g cheese cultured dairy dirty fat green waxy Name 936 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. Perfumery 1206 A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell.