1.0 2010-04-08 22:05:48 UTC 2015-07-20 21:55:15 UTC FDB003429 Cyclohexylethyl acetate Flavouring ingredient 2-Cyclohexylethyl acetate Acetic acid, cyclohexylethyl ester Cyclohexane ethyl acetate Cyclohexaneethanol acetate Cyclohexaneethanol, 1-acetate Cyclohexaneethanol, acetate Cyclohexaneethyl acetate Cyclohexylethyl acetate Ethylcyclohexyl acetate FEMA 2348 Hexahydrophenethyl acetate Hexahydrophenyl ethyl acetate C10H18O2 170.2487 170.13067982 2-cyclohexylethyl acetate cyclohexaneethanol, acetate 21722-83-8 CC(=O)OCCC1CCCCC1 InChI=1S/C10H18O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h10H,2-8H2,1H3 NOTFZGFABLVTIG-UHFFFAOYSA-N belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). Carboxylic acid esters Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acid derivatives Aliphatic homomonocyclic compounds Carbonyl compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound logp 3.34 ALOGPS logs -3.41 ALOGPS solubility 6.68e-02 g/l ALOGPS logp 2.4 ChemAxon pka_strongest_basic -7 ChemAxon iupac 2-cyclohexylethyl acetate ChemAxon average_mass 170.2487 ChemAxon mono_mass 170.13067982 ChemAxon smiles CC(=O)OCCC1CCCCC1 ChemAxon formula C10H18O2 ChemAxon inchi InChI=1S/C10H18O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h10H,2-8H2,1H3 ChemAxon inchikey NOTFZGFABLVTIG-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 47.84 ChemAxon polarizability 20.19 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 12830 Specdb::CMs 28505 Specdb::CMs 100756 Specdb::CMs 175421 Specdb::MsIr 4411 Specdb::MsIr 4412 Specdb::MsMs 100164 Specdb::MsMs 100165 Specdb::MsMs 100166 Specdb::MsMs 165414 Specdb::MsMs 165415 Specdb::MsMs 165416 Specdb::MsMs 2776175 Specdb::MsMs 2776176 Specdb::MsMs 2776177 Specdb::MsMs 2906352 Specdb::MsMs 2906353 Specdb::MsMs 2906354 HMDB31362 #<Reference:0x000055ce305169c8> green mint plant plastic raspberry rose