1.0 2010-04-08 22:05:51 UTC 2025-11-18 22:53:06 UTC FDB003573 Auxin Auxins are a class of plant growth substances and morphogens (often called phytohormone or plant hormone). Auxins have an essential role in coordination of many growth and behavioral processes in the plant's life cycle. IAA (indole-3-acetic acid) is the most abundant and the basic native auxin in plants. Auxin is found in soft-necked garlic. C10H8NO2 174.18 174.056052082 2-(1H-indol-3-yl)acetate β-indoleacetate [O-]C(=O)CC1=CNC2=CC=CC=C12 InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 SEOVTRFCIGRIMH-UHFFFAOYSA-M belongs to the class of organic compounds known as indole-3-acetic acid derivatives. Indole-3-acetic acid derivatives are compounds containing an acetic acid (or a derivative) linked to the C3 carbon atom of an indole. Indole-3-acetic acid derivatives Organic compounds Organoheterocyclic compounds Indoles and derivatives Indolyl carboxylic acids and derivatives Aromatic heteropolycyclic compounds 3-alkylindoles Azacyclic compounds Benzenoids Carbonyl compounds Carboxylic acids Heteroaromatic compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic anions Organic oxides Organonitrogen compounds Organopnictogen compounds Substituted pyrroles 3-alkylindole Aromatic heteropolycyclic compound Azacycle Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Hydrocarbon derivative Indole Indole-3-acetic acid derivative Monocarboxylic acid or derivatives Organic anion Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrole Substituted pyrrole a plant hormone indol-3-yl carboxylic acid anion logp 1.80 ALOGPS logs -1.88 ALOGPS solubility 2.53e+00 g/l ALOGPS logp 1.71 ChemAxon pka_strongest_acidic 4.66 ChemAxon iupac 2-(1H-indol-3-yl)acetate ChemAxon average_mass 174.18 ChemAxon mono_mass 174.056052082 ChemAxon smiles [O-]C(=O)CC1=CNC2=CC=CC=C12 ChemAxon formula C10H8NO2 ChemAxon inchi InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 ChemAxon inchikey SEOVTRFCIGRIMH-UHFFFAOYSA-M ChemAxon polar_surface_area 55.92 ChemAxon refractivity 59.29 ChemAxon polarizability 17.36 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge -1 ChemAxon Specdb::MsMs 89067 Specdb::MsMs 89068 Specdb::MsMs 89069 Specdb::MsMs 151917 Specdb::MsMs 151918 Specdb::MsMs 151919 22676 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682