1.0 2010-04-08 22:05:52 UTC 2025-11-18 22:53:07 UTC FDB003578 Chitinase Phosphoglucomutase, also known as rnase, pancreatic or pancreatic rnase, is a member of the class of compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Phosphoglucomutase is soluble (in water) and a weakly acidic compound (based on its pKa). Phosphoglucomutase can be found in soy bean, which makes phosphoglucomutase a potential biomarker for the consumption of this food product. Phosphoglucomutase (EC 5.4.2.2) is an enzyme that transfers a phosphate group on an α-D-glucose monomer from the 1' to the 6' position in the forward direction or the 6' to the 1' position in the reverse direction . C9H14N4O3 226.2325 226.106590334 2-[(3-amino-1-hydroxypropylidene)amino]-3-(1H-imidazol-5-yl)propanoic acid 2-[(3-amino-1-hydroxypropylidene)amino]-3-(3H-imidazol-4-yl)propanoic acid 9001-06-3 NCCC(=O)NC(CC1=CNC=N1)C(O)=O InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) CQOVPNPJLQNMDC-UHFFFAOYSA-N belongs to the class of organic compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Hybrid peptides Organic compounds Organic acids and derivatives Peptidomimetics Hybrid peptides Aromatic heteromonocyclic compounds Amino acids Azacyclic compounds Beta amino acids and derivatives Carbonyl compounds Carboxylic acids Heteroaromatic compounds Histidine and derivatives Hydrocarbon derivatives Imidazolyl carboxylic acids and derivatives Monoalkylamines Monocarboxylic acids and derivatives N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Secondary carboxylic acid amides Alpha-amino acid or derivatives Amine Amino acid Amino acid or derivatives Aromatic heteromonocyclic compound Azacycle Azole Beta amino acid or derivatives Carbonyl group Carboxamide group Carboxylic acid Carboxylic acid derivative Heteroaromatic compound Histidine or derivatives Hybrid peptide Hydrocarbon derivative Imidazole Imidazolyl carboxylic acid derivative Monocarboxylic acid or derivatives N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Secondary carboxylic acid amide logp -3.04 ALOGPS logs -1.97 ALOGPS solubility 2.44e+00 g/l ALOGPS logp -4.9 ChemAxon pka_strongest_acidic 3.42 ChemAxon pka_strongest_basic 10.3 ChemAxon iupac 2-[(3-amino-1-hydroxypropylidene)amino]-3-(1H-imidazol-5-yl)propanoic acid ChemAxon average_mass 226.2325 ChemAxon mono_mass 226.106590334 ChemAxon smiles NCCC(=O)NC(CC1=CNC=N1)C(O)=O ChemAxon formula C9H14N4O3 ChemAxon inchi InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) ChemAxon inchikey CQOVPNPJLQNMDC-UHFFFAOYSA-N ChemAxon polar_surface_area 124.59 ChemAxon refractivity 56.08 ChemAxon polarizability 22.25 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 6 ChemAxon donor_count 4 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 69933 Specdb::MsMs 69934 Specdb::MsMs 69935 Specdb::MsMs 128319 Specdb::MsMs 128320 Specdb::MsMs 128321 Specdb::CMs 107724 Specdb::CMs 120140 Specdb::CMs 125869 Soft-necked garlic Type 1 specific Allium sativum L. var. sativum 4682