1.0 2010-04-08 22:05:59 UTC 2025-11-18 22:54:15 UTC FDB003883 Lirodenine Lirodenine is a member of the class of compounds known as benzonitriles. Benzonitriles are organic compounds containing a benzene bearing a nitrile substituent. Lirodenine is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Lirodenine can be found in custard apple, which makes lirodenine a potential biomarker for the consumption of this food product. C26H18N2O2P2 452.3808 452.084350854 4-{[(4-cyanophenyl)(phenyl)phosphoroso](phenyl)phosphoroso}benzonitrile 4-[4-cyanophenyl(phenyl)phosphoroso(phenyl)phosphoroso]benzonitrile O=P(C1=CC=CC=C1)(C1=CC=C(C=C1)C#N)P(=O)(C1=CC=CC=C1)C1=CC=C(C=C1)C#N InChI=1S/C26H18N2O2P2/c27-19-21-11-15-25(16-12-21)31(29,23-7-3-1-4-8-23)32(30,24-9-5-2-6-10-24)26-17-13-22(20-28)14-18-26/h1-18H LOQRLFDLUYKOGD-UHFFFAOYSA-N belongs to the class of organic compounds known as benzonitriles. These are organic compounds containing a benzene bearing a nitrile substituent. Benzonitriles Organic compounds Benzenoids Benzene and substituted derivatives Benzonitriles Aromatic homomonocyclic compounds Hydrocarbon derivatives Nitriles Organic oxides Organophosphorus compounds Organopnictogen compounds Aromatic homomonocyclic compound Benzonitrile Carbonitrile Hydrocarbon derivative Nitrile Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organophosphorus compound Organopnictogen compound logp 4.06 ALOGPS logs -4.22 ALOGPS solubility 2.74e-02 g/l ALOGPS logp 5.94 ChemAxon pka_strongest_basic -8.4 ChemAxon iupac 4-{[(4-cyanophenyl)(phenyl)phosphoroso](phenyl)phosphoroso}benzonitrile ChemAxon average_mass 452.3808 ChemAxon mono_mass 452.084350854 ChemAxon smiles O=P(C1=CC=CC=C1)(C1=CC=C(C=C1)C#N)P(=O)(C1=CC=CC=C1)C1=CC=C(C=C1)C#N ChemAxon formula C26H18N2O2P2 ChemAxon inchi InChI=1S/C26H18N2O2P2/c27-19-21-11-15-25(16-12-21)31(29,23-7-3-1-4-8-23)32(30,24-9-5-2-6-10-24)26-17-13-22(20-28)14-18-26/h1-18H ChemAxon inchikey LOQRLFDLUYKOGD-UHFFFAOYSA-N ChemAxon polar_surface_area 81.72 ChemAxon refractivity 126.63 ChemAxon polarizability 44.94 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 4 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 93750 Specdb::MsMs 93751 Specdb::MsMs 93752 Specdb::MsMs 157575 Specdb::MsMs 157576 Specdb::MsMs 157577 Specdb::MsMs 3599567 Specdb::MsMs 3599568 Specdb::MsMs 3599569 Specdb::MsMs 3599570 Specdb::MsMs 3599571 Specdb::MsMs 3599572 Custard apple Type 1 specific Annona reticulata 301862 Calcium antagonist 748 Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances.