1.0 2010-04-08 22:06:00 UTC 2025-11-18 22:54:17 UTC FDB003895 3-N-Butyl-4,5-dihydrophthalide 3-n-butyl-4,5-dihydrophthalide, also known as nbpa or sedanenolide, is a member of the class of compounds known as isobenzofurans. Isobenzofurans are organic aromatic compounds containing an isobenzofuran moiety. 3-n-butyl-4,5-dihydrophthalide is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 3-n-butyl-4,5-dihydrophthalide is a herbal tasting compound found in dill, lovage, parsley, and wild celery, which makes 3-n-butyl-4,5-dihydrophthalide a potential biomarker for the consumption of these food products. 3-butyl-4,5-dihydro-3H-2-benzofuran-1-one Sedanenolide Senkyunolide C12H16O2 192.2542 192.115029756 3-butyl-1,3,4,5-tetrahydro-2-benzofuran-1-one 3-butyl-4,5-dihydro-3H-2-benzofuran-1-one 62006-39-7 CCCCC1OC(=O)C2=C1CCC=C2 InChI=1S/C12H16O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7,11H,2-4,6,8H2,1H3 ZPIKVDODKLJKIN-UHFFFAOYSA-N belongs to the class of organic compounds known as isobenzofurans. These are organic aromatic compounds containing an isobenzofuran moiety. Isobenzofurans Organic compounds Organoheterocyclic compounds Isobenzofurans Aliphatic heteropolycyclic compounds Butenolides Carbonyl compounds Enoate esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds 2-furanone Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dihydrofuran Enoate ester Hydrocarbon derivative Isobenzofuran Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle logp 3.47 ALOGPS logs -2.63 ALOGPS solubility 4.51e-01 g/l ALOGPS logp 3.07 ChemAxon pka_strongest_acidic 15.49 ChemAxon pka_strongest_basic -7 ChemAxon iupac 3-butyl-1,3,4,5-tetrahydro-2-benzofuran-1-one ChemAxon average_mass 192.2542 ChemAxon mono_mass 192.115029756 ChemAxon smiles CCCCC1OC(=O)C2=C1CCC=C2 ChemAxon formula C12H16O2 ChemAxon inchi InChI=1S/C12H16O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h5,7,11H,2-4,6,8H2,1H3 ChemAxon inchikey ZPIKVDODKLJKIN-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 56.55 ChemAxon polarizability 21.99 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 113851 Specdb::CMs 127722 Specdb::MsMs 95835 Specdb::MsMs 95836 Specdb::MsMs 95837 Specdb::MsMs 160185 Specdb::MsMs 160186 Specdb::MsMs 160187 Celeriac Type 1 specific Apium graveolens var. rapaceum 278110 Celery stalks Type 1 specific Apium graveolens var. dulce 117781 Dill Type 1 specific Anethum graveolens 40922 Lovage Type 1 specific Levisticum officinale 48042 Parsley Type 1 specific Petroselinum crispum 4043 0.5 0.5 0.5 mg/100 g Wild celery Type 1 specific Apium graveolens 4045 31.625 49.75 13.5 mg/100 g herbal Sedative 1311 A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety.