1.0 2010-04-08 22:06:03 UTC 2025-11-18 22:54:41 UTC FDB004011 7-Hexadecenoic acid 7z-palmitoleic acid, also known as (Z)-7-hexadecenoic acid or 16:1 cis7, is a member of the class of compounds known as long-chain fatty acids. Long-chain fatty acids are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Thus, 7z-palmitoleic acid is considered to be a fatty acid lipid molecule. 7z-palmitoleic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 7z-palmitoleic acid can be found in peanut, which makes 7z-palmitoleic acid a potential biomarker for the consumption of this food product. 7z-palmitoleic acid can be found primarily in blood. C16H30O2 254.4082 254.224580204 (7Z)-hexadec-7-enoic acid 7-hexadecenoic acid 2416-19-5 CCCCCCCC\C=C/CCCCCC(O)=O InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h9-10H,2-8,11-15H2,1H3,(H,17,18)/b10-9- PJHOFUXBXJNUAC-KTKRTIGZSA-N belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Long-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Unsaturated fatty acids hexadecenoic acid logp 6.74 ALOGPS logs -5.77 ALOGPS solubility 4.37e-04 g/l ALOGPS logp 5.89 ChemAxon pka_strongest_acidic 4.89 ChemAxon iupac (7Z)-hexadec-7-enoic acid ChemAxon average_mass 254.4082 ChemAxon mono_mass 254.224580204 ChemAxon smiles CCCCCCCC\C=C/CCCCCC(O)=O ChemAxon formula C16H30O2 ChemAxon inchi InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h9-10H,2-8,11-15H2,1H3,(H,17,18)/b10-9- ChemAxon inchikey PJHOFUXBXJNUAC-KTKRTIGZSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 78.2 ChemAxon polarizability 32.87 ChemAxon rotatable_bond_count 13 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 10574 Specdb::CMs 38304 Specdb::CMs 137532 Specdb::CMs 145266 Specdb::MsMs 74784 Specdb::MsMs 74785 Specdb::MsMs 74786 Specdb::MsMs 134265 Specdb::MsMs 134266 Specdb::MsMs 134267 Specdb::MsMs 2456883 Specdb::MsMs 2456884 Specdb::MsMs 2456885 Specdb::MsMs 2481403 Specdb::MsMs 2481404 Specdb::MsMs 2481405 HMDB0002186 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Peanut Type 1 specific Arachis hypogaea 3818 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823