1.0 2010-04-08 22:06:04 UTC 2019-11-26 02:59:45 UTC FDB004048 Sarkosin Sarcosine, also known as N-methylglycine or (methylamino)acetic acid, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Sarcosine is soluble (in water) and a moderately acidic compound (based on its pKa). Sarcosine can be found in peanut, which makes sarcosine a potential biomarker for the consumption of this food product. Sarcosine can be found primarily in most biofluids, including blood, saliva, cerebrospinal fluid (CSF), and feces, as well as in human muscle, prostate and skeletal muscle tissues. Sarcosine exists in all living organisms, ranging from bacteria to humans. In humans, sarcosine is involved in few metabolic pathways, which include glycine and serine metabolism, methionine metabolism, and sarcosine oncometabolite pathway. Sarcosine is also involved in several metabolic disorders, some of which include homocystinuria-megaloblastic anemia due to defect in cobalamin metabolism, cblg complementation type, hyperglycinemia, non-ketotic, hypermethioninemia, and dimethylglycine dehydrogenase deficiency. Moreover, sarcosine is found to be associated with sarcosinemia. Sarcosine is a non-carcinogenic (not listed by IARC) potentially toxic compound. C3H7NO2 89.0932 89.047678473 2-(methylamino)acetic acid sarcosine CNCC(O)=O InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) FSYKKLYZXJSNPZ-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary aliphatic amine Secondary amine N-alkylglycine N-methyl-amino acid N-methylglycines logp -3.06 ALOGPS logs 0.54 ALOGPS solubility 3.08e+02 g/l ALOGPS logp -3.2 ChemAxon pka_strongest_acidic 2.06 ChemAxon pka_strongest_basic 10.35 ChemAxon iupac 2-(methylamino)acetic acid ChemAxon average_mass 89.0932 ChemAxon mono_mass 89.047678473 ChemAxon smiles CNCC(O)=O ChemAxon formula C3H7NO2 ChemAxon inchi InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) ChemAxon inchikey FSYKKLYZXJSNPZ-UHFFFAOYSA-N ChemAxon polar_surface_area 49.33 ChemAxon refractivity 20.78 ChemAxon polarizability 8.66 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::EiMs 880 Specdb::MsIr 372 Specdb::MsIr 373 Specdb::MsIr 374 Specdb::NmrTwoD 1011 Specdb::NmrTwoD 1250 Specdb::CMs 507 Specdb::CMs 508 Specdb::CMs 923 Specdb::CMs 20878 Specdb::CMs 30021 Specdb::CMs 30687 Specdb::CMs 30860 Specdb::CMs 31110 Specdb::CMs 32285 Specdb::CMs 37395 Specdb::CMs 146150 Specdb::CMs 1056496 Specdb::CMs 1056497 Specdb::CMs 1056499 Specdb::NmrOneD 1224 Specdb::NmrOneD 1307 Specdb::NmrOneD 2114 Specdb::NmrOneD 2807 Specdb::NmrOneD 143250 Specdb::NmrOneD 143251 Specdb::NmrOneD 143252 Specdb::NmrOneD 143253 Specdb::NmrOneD 143254 Specdb::NmrOneD 143255 Specdb::NmrOneD 143256 Specdb::NmrOneD 143257 Specdb::NmrOneD 143258 Specdb::NmrOneD 143259 Specdb::NmrOneD 143260 Specdb::NmrOneD 143261 Specdb::NmrOneD 143262 Specdb::NmrOneD 143263 Specdb::NmrOneD 143264 Specdb::NmrOneD 143265 Specdb::NmrOneD 143266 Specdb::NmrOneD 143267 Specdb::NmrOneD 143268 Specdb::NmrOneD 143269 Specdb::NmrOneD 166453 Specdb::MsMs 472 Specdb::MsMs 473 Specdb::MsMs 474 Specdb::MsMs 3885 Specdb::MsMs 3886 Specdb::MsMs 3887 Specdb::MsMs 3888 Specdb::MsMs 3889 Specdb::MsMs 3890 Specdb::MsMs 3891 Specdb::MsMs 3892 Specdb::MsMs 7130 Specdb::MsMs 7131 Specdb::MsMs 7132 Specdb::MsMs 13802 Specdb::MsMs 13803 Specdb::MsMs 13804 Specdb::MsMs 438428 Specdb::MsMs 438429 Specdb::MsMs 438430 Specdb::MsMs 446941 Specdb::MsMs 446942 Specdb::MsMs 446943 Specdb::MsMs 446944 Specdb::MsMs 446945 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Peanut Type 1 specific Arachis hypogaea 3818 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823