1.0 2010-04-08 22:06:04 UTC 2025-11-18 22:54:51 UTC FDB004049 Sterculic acid Sterculic acid, also known as 2-octyl-1-cyclopropene-1-octanoic acid or 8-(2-octyl-cycloprop-1-enyl)-octansaeure, is a member of the class of compounds known as medium-chain fatty acids. Medium-chain fatty acids are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Thus, sterculic acid is considered to be a fatty acid lipid molecule. Sterculic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Sterculic acid can be found in peanut and roselle, which makes sterculic acid a potential biomarker for the consumption of these food products. C19H34O2 294.4721 294.255880332 8-(2-octylcycloprop-1-en-1-yl)octanoic acid sterculic acid CCCCCCCCC1=C(CCCCCCCC(O)=O)C1 InChI=1S/C19H34O2/c1-2-3-4-5-7-10-13-17-16-18(17)14-11-8-6-9-12-15-19(20)21/h2-16H2,1H3,(H,20,21) PQRKPYLNZGDCFH-UHFFFAOYSA-N belongs to the class of organic compounds known as medium-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Medium-chain fatty acids Organic compounds Lipids and lipid-like molecules Fatty Acyls Fatty acids and conjugates Aliphatic homomonocyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic homomonocyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Medium-chain fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Carbocyclic fatty acids Carbocyclic fatty acids Fatty acids cyclopropenyl fatty acid long-chain fatty acid monounsaturated fatty acid logp 6.37 ALOGPS logs -5.17 ALOGPS solubility 1.99e-03 g/l ALOGPS logp 6.36 ChemAxon pka_strongest_acidic 4.75 ChemAxon iupac 8-(2-octylcycloprop-1-en-1-yl)octanoic acid ChemAxon average_mass 294.4721 ChemAxon mono_mass 294.255880332 ChemAxon smiles CCCCCCCCC1=C(CCCCCCCC(O)=O)C1 ChemAxon formula C19H34O2 ChemAxon inchi InChI=1S/C19H34O2/c1-2-3-4-5-7-10-13-17-16-18(17)14-11-8-6-9-12-15-19(20)21/h2-16H2,1H3,(H,20,21) ChemAxon inchikey PQRKPYLNZGDCFH-UHFFFAOYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 89.56 ChemAxon polarizability 38.42 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 81843 Specdb::MsMs 81844 Specdb::MsMs 81845 Specdb::MsMs 143055 Specdb::MsMs 143056 Specdb::MsMs 143057 Specdb::CMs 114233 Specdb::CMs 128238 Specdb::CMs 983182 Specdb::CMs 983183 Peanut Type 1 specific Arachis hypogaea 3818 Roselle Type 1 specific Hibiscus sabdariffa 183260 Delta9-desaturase inhibitor 867 A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. Insecticide 1040 Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. Juvabional 1058 Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests.