1.0 2010-04-08 22:06:05 UTC 2025-11-18 22:55:12 UTC FDB004104 Germacranolide Germacranolides are a group of sesquiterpene lactones. Germacranolide is found in burdock and dandelion. C15H22O2 234.339 234.161979948 3,6,10-trimethyl-2H,3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-2-one 3,6,10-trimethyl-3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-2-one [H]\C1=C(C)/CC2OC(=O)C(C)C2C\C([H])=C(C)\CC1 InChI=1S/C15H22O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,12-14H,4-5,8-9H2,1-3H3/b10-7+,11-6+ QJRFOUJEGHRZIU-NXAIOARDSA-N belongs to the class of organic compounds known as germacranolides and derivatives. These are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Germacranolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Carbonyl compounds Carboxylic acid esters Gamma butyrolactones Germacrane sesquiterpenoids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteropolycyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Germacrane sesquiterpenoid Germacranolide Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Sesquiterpenoid Tetrahydrofuran logp 4.23 ALOGPS logs -3.38 ALOGPS solubility 9.68e-02 g/l ALOGPS logp 3.52 ChemAxon pka_strongest_basic -7.1 ChemAxon iupac 3,6,10-trimethyl-2H,3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-2-one ChemAxon average_mass 234.339 ChemAxon mono_mass 234.161979948 ChemAxon smiles [H]\C1=C(C)/CC2OC(=O)C(C)C2C\C([H])=C(C)\CC1 ChemAxon formula C15H22O2 ChemAxon inchi InChI=1S/C15H22O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h6-7,12-14H,4-5,8-9H2,1-3H3/b10-7+,11-6+ ChemAxon inchikey QJRFOUJEGHRZIU-NXAIOARDSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 70.3 ChemAxon polarizability 26.86 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 61257 Specdb::MsMs 61258 Specdb::MsMs 61259 Specdb::MsMs 117747 Specdb::MsMs 117748 Specdb::MsMs 117749 Specdb::MsMs 3599960 Specdb::MsMs 3599961 Specdb::MsMs 3599962 Specdb::MsMs 3599963 Specdb::MsMs 3599964 Specdb::MsMs 3599965 Burdock Type 1 specific Arctium lappa 4217 Dandelion Type 1 specific Taraxacum officinale 50225