1.0 2010-04-08 22:06:06 UTC 2025-11-18 22:55:21 UTC FDB004146 Hydroxycinnamic acid Trans-4-coumaric acid, also known as 4-hydroxycinnamic acid or trans-P-hydroxycinnamate, is a member of the class of compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Trans-4-coumaric acid is slightly soluble (in water) and a weakly acidic compound (based on its pKa). Trans-4-coumaric acid can be found in a number of food items such as garden onion, lowbush blueberry, german camomile, and garden rhubarb, which makes trans-4-coumaric acid a potential biomarker for the consumption of these food products. Trans-4-coumaric acid can be found primarily in blood, feces, and urine, as well as in human fibroblasts tissue. Trans-4-coumaric acid exists in all eukaryotes, ranging from yeast to humans. C9H8O3 164.158 164.047344122 (2E)-3-(4-hydroxyphenyl)prop-2-enoic acid coumaric acid 7400-08-0 501-98-4 OC(=O)\C=C\C1=CC=C(O)C=C1 InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ NGSWKAQJJWESNS-ZZXKWVIFSA-N belongs to the class of organic compounds known as hydroxycinnamic acids. Hydroxycinnamic acids are compounds containing an cinnamic acid where the benzene ring is hydroxylated. Hydroxycinnamic acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Carbonyl compounds Carboxylic acids Cinnamic acids Coumaric acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Styrenes 1-hydroxy-2-unsubstituted benzenoid Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Coumaric acid or derivatives Hydrocarbon derivative Hydroxycinnamic acid Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol Styrene 4-coumaric acid Paracoumaryl alcohol derivatives logp 1.74 ALOGPS logs -2.21 ALOGPS solubility 1.02e+00 g/l ALOGPS logp 1.83 ChemAxon pka_strongest_acidic 4 ChemAxon pka_strongest_basic -6 ChemAxon iupac (2E)-3-(4-hydroxyphenyl)prop-2-enoic acid ChemAxon average_mass 164.158 ChemAxon mono_mass 164.047344122 ChemAxon smiles OC(=O)\C=C\C1=CC=C(O)C=C1 ChemAxon formula C9H8O3 ChemAxon inchi InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ ChemAxon inchikey NGSWKAQJJWESNS-ZZXKWVIFSA-N ChemAxon polar_surface_area 57.53 ChemAxon refractivity 45.04 ChemAxon polarizability 16.43 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 887 Specdb::CMs 1682 Specdb::CMs 3278 Specdb::CMs 28714 Specdb::CMs 29925 Specdb::CMs 30665 Specdb::CMs 31384 Specdb::CMs 32086 Specdb::CMs 38236 Specdb::CMs 163406 Specdb::EiMs 1872 Specdb::MsIr 1553 Specdb::MsIr 1554 Specdb::MsIr 1555 Specdb::NmrOneD 4900 Specdb::NmrOneD 4901 Specdb::NmrOneD 328032 Specdb::NmrOneD 328033 Specdb::NmrOneD 328034 Specdb::NmrOneD 328035 Specdb::NmrOneD 328036 Specdb::NmrOneD 328037 Specdb::NmrOneD 328038 Specdb::NmrOneD 328039 Specdb::NmrOneD 328040 Specdb::NmrOneD 328041 Specdb::NmrOneD 328042 Specdb::NmrOneD 328043 Specdb::NmrOneD 328044 Specdb::NmrOneD 328045 Specdb::NmrOneD 328046 Specdb::NmrOneD 328047 Specdb::NmrOneD 328048 Specdb::NmrOneD 328049 Specdb::NmrOneD 328050 Specdb::NmrOneD 328051 Specdb::MsMs 6485 Specdb::MsMs 6486 Specdb::MsMs 6487 Specdb::MsMs 6488 Specdb::MsMs 6489 Specdb::MsMs 6490 Specdb::MsMs 6492 Specdb::MsMs 6493 Specdb::MsMs 6494 Specdb::MsMs 6495 Specdb::MsMs 179817 Specdb::MsMs 179818 Specdb::MsMs 179819 Specdb::MsMs 182151 Specdb::MsMs 182152 Specdb::MsMs 182153 Specdb::MsMs 374051 Specdb::MsMs 374069 Specdb::MsMs 437395 Specdb::MsMs 437396 Specdb::MsMs 437397 Specdb::MsMs 437398 Specdb::MsMs 437399 Specdb::MsMs 439156 Specdb::MsMs 439266 HMDB0002035 American cranberry Type 1 specific Vaccinium macrocarpon 13750 129.1 129.1 129.1 mg/100 g Apple Type 1 specific Malus pumila 283210 134.0 134.0 134.0 mg/100 g Apple cider Type 2 specific Beer Type 2 specific Blackberry Type 1 specific Rubus Coffee Type 1 generic Coffea 13442 Endive Type 1 specific Cichorium endivia 114280 European cranberry Type 1 specific Vaccinium oxycoccos 516948 Fruit juice Type 2 specific Garden tomato Type 1 specific Solanum lycopersicum 4081 Horseradish Type 1 specific Armoracia rusticana 3704 Olive Type 1 specific Olea europaea 4146 Peanut Type 1 specific Arachis hypogaea 3818 Red raspberry Type 1 specific Rubus idaeus 32247 Strawberry Type 1 specific Fragaria X ananassa 3747 Wheat bread Type 2 specific