1.0 2010-04-08 22:06:10 UTC 2025-11-18 22:55:44 UTC FDB004286 Cynaustine Cynaustine belongs to alkaloids and derivatives class of compounds. Those are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic propertiesand is also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Cynaustine is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Cynaustine can be found in borage, which makes cynaustine a potential biomarker for the consumption of this food product. (+)-cyanustine Cyanustine Cyanustine (8CI) Cyanustine hydrochloride Supinin hydrochloride C15H26ClNO4 319.824 319.155036032 (7aR)-7-({[(2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoyl]oxy}methyl)-1,2,3,4,5,7a-hexahydropyrrolizin-4-ium chloride (7aR)-1-({[(2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoyl]oxy}methyl)-3,4,5,6,7,7a-hexahydropyrrolizin-4-ium chloride [Cl-].CC(C)[C@@](O)([C@H](C)O)C(=O)OCC1=CC[NH+]2CCC[C@H]12 InChI=1S/C15H25NO4.ClH/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16;/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3;1H/t11-,13+,15+;/m0./s1 IAZXZAXZQOMXBB-QWMUGUDESA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aliphatic heteropolycyclic compounds 1,2-diols Amino acids and derivatives Azacyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives N-alkylpyrrolidines Organic chloride salts Organic oxides Organic zwitterions Organopnictogen compounds Pyrrolines Pyrrolizines Secondary alcohols Tertiary alcohols Trialkylamines 1,2-diol Alcohol Aliphatic heteropolycyclic compound Alkaloid or derivatives Amine Amino acid or derivatives Azacycle Beta-hydroxy acid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives N-alkylpyrrolidine Organic chloride salt Organic nitrogen compound Organic oxide Organic oxygen compound Organic salt Organic zwitterion Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrolidine Pyrroline Pyrrolizine Secondary alcohol Tertiary alcohol Tertiary aliphatic amine Tertiary amine logp -1.19 ALOGPS logs -2.94 ALOGPS solubility 3.65e-01 g/l ALOGPS logp 0.86 ChemAxon pka_strongest_acidic 11.34 ChemAxon pka_strongest_basic 8.36 ChemAxon iupac (7aR)-7-({[(2R)-2-hydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoyl]oxy}methyl)-1,2,3,4,5,7a-hexahydropyrrolizin-4-ium chloride ChemAxon average_mass 319.824 ChemAxon mono_mass 319.155036032 ChemAxon smiles [Cl-].CC(C)[C@@](O)([C@H](C)O)C(=O)OCC1=CC[NH+]2CCC[C@H]12 ChemAxon formula C15H26ClNO4 ChemAxon inchi InChI=1S/C15H25NO4.ClH/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16;/h6,10-11,13,17,19H,4-5,7-9H2,1-3H3;1H/t11-,13+,15+;/m0./s1 ChemAxon inchikey IAZXZAXZQOMXBB-QWMUGUDESA-N ChemAxon polar_surface_area 71.2 ChemAxon refractivity 87.64 ChemAxon polarizability 31.2 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 3 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 98523 Specdb::MsMs 98524 Specdb::MsMs 98525 Specdb::MsMs 163467 Specdb::MsMs 163468 Specdb::MsMs 163469 Borage Type 1 specific Borago officinalis 13363