1.0 2010-04-08 22:06:10 UTC 2019-11-26 02:59:55 UTC FDB004288 Intermedine Intermedine, also known as 9-(+)-trachelanthylretronecine or beta-msh, belongs to alkaloids and derivatives class of compounds. Those are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic propertiesand is also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Intermedine is soluble (in water) and a very weakly acidic compound (based on its pKa). Intermedine can be found in borage, which makes intermedine a potential biomarker for the consumption of this food product. 9-(+)-Trachelanthylretronecine Beta-melanocyte-stimulating hormone Beta-melanotropin Beta-MSH Intermedin Intermedina Intermedine Intermedinum Mel-stimulating hormone Melanocyte stimulating hormones Melanocyte-stimulating hormones Melanophore hormone Melanophore stimulating hormone Melanophore-expanding hormone Melanophore-stimulating hormone Melanotropin MSH MSH (melanocyte-stimulating hormones) Pigment hormone C15H25NO5 299.3627 299.173272915 [(1R,7aR)-1-hydroxy-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2S)-2-hydroxy-2-[(1R)-1-hydroxyethyl]-3-methylbutanoate ( )-intermedine 10285-06-0 [H][C@@]12[C@H](O)CCN1CC=C2COC(=O)[C@](O)(C(C)C)[C@@H](C)O InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12-,13-,15+/m1/s1 SFVVQRJOGUKCEG-OPQSFPLASA-N belongs to the class of organic compounds known as alkaloids and derivatives. These are naturally occurring chemical compounds that contain mostly basic nitrogen atoms. This group also includes some related compounds with neutral and even weakly acidic properties. Also some synthetic compounds of similar structure are attributed to alkaloids. In addition to carbon, hydrogen and nitrogen, alkaloids may also contain oxygen, sulfur and more rarely other elements such as chlorine, bromine, and phosphorus. Alkaloids and derivatives Organic compounds Alkaloids and derivatives Aliphatic heteropolycyclic compounds Amino acids and derivatives Azacyclic compounds Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acid esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives N-alkylpyrrolidines Organic oxides Organopnictogen compounds Pyrrolines Pyrrolizines Secondary alcohols Tertiary alcohols Trialkylamines Alcohol Aliphatic heteropolycyclic compound Alkaloid or derivatives Amine Amino acid or derivatives Azacycle Beta-hydroxy acid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Fatty acid ester Fatty acyl Hydrocarbon derivative Hydroxy acid Monocarboxylic acid or derivatives N-alkylpyrrolidine Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Pyrrolidine Pyrroline Pyrrolizine Secondary alcohol Tertiary alcohol Tertiary aliphatic amine Tertiary amine Pyrrolizidine alkaloids azabicycloalkane carboxylic ester pyrrolizines logp 0.41 ALOGPS logs -0.77 ALOGPS solubility 5.08e+01 g/l ALOGPS logp -0.29 ChemAxon pka_strongest_acidic 11.34 ChemAxon pka_strongest_basic 8.82 ChemAxon iupac [(1R,7aR)-1-hydroxy-2,3,5,7a-tetrahydro-1H-pyrrolizin-7-yl]methyl (2S)-2-hydroxy-2-[(1R)-1-hydroxyethyl]-3-methylbutanoate ChemAxon average_mass 299.3627 ChemAxon mono_mass 299.173272915 ChemAxon smiles [H][C@@]12[C@H](O)CCN1CC=C2COC(=O)[C@](O)(C(C)C)[C@@H](C)O ChemAxon formula C15H25NO5 ChemAxon inchi InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12-,13-,15+/m1/s1 ChemAxon inchikey SFVVQRJOGUKCEG-OPQSFPLASA-N ChemAxon polar_surface_area 90.23 ChemAxon refractivity 77.94 ChemAxon polarizability 31.65 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 5 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 93354 Specdb::MsMs 93355 Specdb::MsMs 93356 Specdb::MsMs 157101 Specdb::MsMs 157102 Specdb::MsMs 157103 5941 Borage Type 1 specific Borago officinalis 13363 hepatotoxic 984 A role played by a chemical compound exihibiting itself through the ability to induce damage to the liver in animals.