1.0 2010-04-08 22:06:10 UTC 2025-11-18 22:55:46 UTC FDB004293 Steridonic acid Stearidonic acid, also known as SDA or stearidonate, belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Stearidonic acid is a very hydrophobic molecule, practically insoluble in water, and relatively neutral. It is biosynthesized from linolenic acid by the enzyme delta-6-desaturase. Natural sources of this fatty acid are in the blackcurrant and echium, and the cyanobacterium spirulina (a rich source of vitamins and minerals). Stearidonic acid is found in dietary plant oils which are metabolized to longer-chain, more unsaturated (n-3) polyunsaturated fatty acids (PUFA). These oils appear to possess hypotriglyceridemic properties typically associated with fish oils (PMID: 15173404). Stearidonic acid may be used as a precursor to increase the eicosapentaenoic acid (EPA) content of human lipids and that combinations of gamma-linolenic acid and stearidonic acid can be used to manipulate the fatty acid compositions of lipid pools in subtle ways. Such effects may offer new strategies for manipulation of cell composition to influence cellular responses and functions in desirable ways (PMID: 15120716). C18H28O2 276.4137 276.20893014 (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid stearidonic acid 20290-75-9 CC\C=C/C\C=C/C\C=C/C\C=C/CCCCC(O)=O InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12- JIWBIWFOSCKQMA-LTKCOYKYSA-N belongs to the class of organic compounds known as lineolic acids and derivatives. These are derivatives of lineolic acid. Lineolic acid is a polyunsaturated omega-6 18 carbon long fatty acid, with two CC double bonds at the 9- and 12-positions. Lineolic acids and derivatives Organic compounds Lipids and lipid-like molecules Fatty Acyls Lineolic acids and derivatives Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Long-chain fatty acids Monocarboxylic acids and derivatives Organic oxides Straight chain fatty acids Unsaturated fatty acids Aliphatic acyclic compound Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Hydrocarbon derivative Long-chain fatty acid Monocarboxylic acid or derivatives Octadecanoid Organic oxide Organic oxygen compound Organooxygen compound Straight chain fatty acid Unsaturated fatty acid Polyunsaturated fatty acids Unsaturated fatty acids long-chain fatty acid octadecatetraenoic acid omega-3 fatty acid logp 6.19 ALOGPS logs -5.74 ALOGPS solubility 5.02e-04 g/l ALOGPS logp 5.7 ChemAxon pka_strongest_acidic 4.92 ChemAxon iupac (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoic acid ChemAxon average_mass 276.4137 ChemAxon mono_mass 276.20893014 ChemAxon smiles CC\C=C/C\C=C/C\C=C/C\C=C/CCCCC(O)=O ChemAxon formula C18H28O2 ChemAxon inchi InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12- ChemAxon inchikey JIWBIWFOSCKQMA-LTKCOYKYSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 90.75 ChemAxon polarizability 33.11 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 15577 Specdb::CMs 39036 Specdb::CMs 162103 Specdb::MsMs 103929 Specdb::MsMs 103930 Specdb::MsMs 103931 Specdb::MsMs 170097 Specdb::MsMs 170098 Specdb::MsMs 170099 Specdb::MsMs 438634 Specdb::MsMs 1476225 Specdb::MsMs 1476226 Specdb::MsMs 1476227 Specdb::MsMs 1476228 Specdb::MsMs 1476229 Specdb::MsMs 1476230 Specdb::MsMs 1476231 Specdb::MsMs 1476232 Specdb::MsMs 1476233 Specdb::MsMs 1476234 Specdb::MsMs 1476235 Specdb::MsMs 1476236 Specdb::MsMs 1476237 Specdb::MsMs 1476238 Specdb::MsMs 1476239 Specdb::MsMs 1476240 Specdb::MsMs 1476241 Specdb::MsMs 1476242 HMDB0006547 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Borage Type 1 specific Borago officinalis 13363 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823