1.0 2010-04-08 22:06:11 UTC 2025-11-18 22:55:49 UTC FDB004306 2-Methyl-6-vinylpyrazine 2-methyl-6-vinylpyrazine is a member of the class of compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. 2-methyl-6-vinylpyrazine is soluble (in water) and a moderately basic compound (based on its pKa). 2-methyl-6-vinylpyrazine can be found in kohlrabi, which makes 2-methyl-6-vinylpyrazine a potential biomarker for the consumption of this food product. 2-ethenyl-6-methylpyrazine 2-Vinyl-6-methylpyrazine 6-methyl-2-vinylpyrazine Pyrazine, 2-ethenyl-6-methyl- Pyrazine, 2-methyl-6-vinyl- C7H8N2 120.1518 120.068748266 2-ethenyl-6-methylpyrazine 2-ethenyl-6-methylpyrazine CC1=NC(C=C)=CN=C1 InChI=1S/C7H8N2/c1-3-7-5-8-4-6(2)9-7/h3-5H,1H2,2H3 KZXOOWGVLDEHDT-UHFFFAOYSA-N belongs to the class of organic compounds known as pyrazines. Pyrazines are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. Pyrazines Organic compounds Organoheterocyclic compounds Diazines Pyrazines Aromatic heteromonocyclic compounds Azacyclic compounds Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds Aromatic heteromonocyclic compound Azacycle Heteroaromatic compound Hydrocarbon derivative Organic nitrogen compound Organonitrogen compound Organopnictogen compound Pyrazine logp 0.99 ALOGPS logs -0.41 ALOGPS solubility 4.66e+01 g/l ALOGPS logp 0.64 ChemAxon pka_strongest_basic 1.43 ChemAxon iupac 2-ethenyl-6-methylpyrazine ChemAxon average_mass 120.1518 ChemAxon mono_mass 120.068748266 ChemAxon smiles CC1=NC(C=C)=CN=C1 ChemAxon formula C7H8N2 ChemAxon inchi InChI=1S/C7H8N2/c1-3-7-5-8-4-6(2)9-7/h3-5H,1H2,2H3 ChemAxon inchikey KZXOOWGVLDEHDT-UHFFFAOYSA-N ChemAxon polar_surface_area 25.78 ChemAxon refractivity 35.57 ChemAxon polarizability 13.03 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 35141 Specdb::MsMs 47985 Specdb::MsMs 47986 Specdb::MsMs 47987 Specdb::MsMs 136623 Specdb::MsMs 136624 Specdb::MsMs 136625 Kohlrabi Type 1 specific Brassica oleracea var. gongylodes 109379 0.004 0.004 0.004 mg/100 g Tortilla chip Type 2 specific