1.0 2010-04-08 22:06:12 UTC 2025-11-18 22:55:58 UTC FDB004342 Hex-cis-3-enol acetate Trans-3-hexenyl acetate is a member of the class of compounds known as carboxylic acid esters. Carboxylic acid esters are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). Thus, trans-3-hexenyl acetate is considered to be a fatty ester lipid molecule. Trans-3-hexenyl acetate is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Trans-3-hexenyl acetate has a banana, fruity, and green taste. C8H14O2 142.1956 142.099379692 (3E)-hex-3-en-1-yl acetate cis-3-hexenylacetate 3681-82-1 CC\C=C\CCOC(C)=O InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4+ NPFVOOAXDOBMCE-SNAWJCMRSA-N belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). Carboxylic acid esters Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Carboxylic acid derivatives Aliphatic acyclic compounds Carbonyl compounds Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Aliphatic acyclic compound Carbonyl group Carboxylic acid ester Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Wax monoesters logp 2.47 ALOGPS logs -2.16 ALOGPS solubility 9.79e-01 g/l ALOGPS logp 1.77 ChemAxon pka_strongest_basic -7 ChemAxon iupac (3E)-hex-3-en-1-yl acetate ChemAxon average_mass 142.1956 ChemAxon mono_mass 142.099379692 ChemAxon smiles CC\C=C\CCOC(C)=O ChemAxon formula C8H14O2 ChemAxon inchi InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4+ ChemAxon inchikey NPFVOOAXDOBMCE-SNAWJCMRSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 41.6 ChemAxon polarizability 16.67 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 11698 Specdb::CMs 136541 Specdb::CMs 144275 Specdb::MsIr 5502 Specdb::MsIr 5503 Specdb::MsMs 73296 Specdb::MsMs 73297 Specdb::MsMs 73298 Specdb::MsMs 132444 Specdb::MsMs 132445 Specdb::MsMs 132446 Specdb::MsMs 2378697 Specdb::MsMs 2378698 Specdb::MsMs 2378699 Specdb::MsMs 2556252 Specdb::MsMs 2556253 Specdb::MsMs 2556254 HMDB0032533 Broccoli Type 1 specific Brassica oleracea var. italica 36774