1.0 2010-04-08 22:06:20 UTC 2025-11-18 22:57:04 UTC FDB004657 Citrullin Citrullin, also known as cit or 2-amino-5-uredovaleric acid, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Citrullin is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Citrullin can be found in a number of food items such as cow milk, sesame, orange bell pepper, and pepper (c. frutescens), which makes citrullin a potential biomarker for the consumption of these food products. Citrulina Citrulline, (DL) DL -2-Amino-5-ureidovaleric acid DL-2-Amino-5-ureidovaleric acid DL-Ornithine, N(5)-(aminocarbonyl)- L -2-Amino-5-ureidovaleric acid L-Ornithine, N(5)-(aminocarbonyl)- N(5)-(aminocarbonyl)ornithine N(5)-carbamoyl-DL-ornithine N(5)-carbamoylornithine Ornithine, N5-carbamoyl-, DL- C6H13N3O3 175.1857 175.095691297 2-amino-5-[(C-hydroxycarbonimidoyl)amino]pentanoic acid 2-amino-5-(C-hydroxycarbonimidoylamino)pentanoic acid 627-77-0 NC(CCCNC(O)=N)C(O)=O InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) RHGKLRLOHDJJDR-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Fatty acids and conjugates Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Ureas Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Carbonic acid derivative Carbonyl group Carboxylic acid Fatty acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Urea citrullines logp -3.27 ALOGPS logs -0.90 ALOGPS solubility 2.18e+01 g/l ALOGPS logp -4.6 ChemAxon pka_strongest_acidic 0.012 ChemAxon pka_strongest_basic 15 ChemAxon iupac 2-amino-5-[(C-hydroxycarbonimidoyl)amino]pentanoic acid ChemAxon average_mass 175.1857 ChemAxon mono_mass 175.095691297 ChemAxon smiles NC(CCCNC(O)=N)C(O)=O ChemAxon formula C6H13N3O3 ChemAxon inchi InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) ChemAxon inchikey RHGKLRLOHDJJDR-UHFFFAOYSA-N ChemAxon polar_surface_area 119.43 ChemAxon refractivity 52.27 ChemAxon polarizability 17.48 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 6 ChemAxon donor_count 5 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 2365 Specdb::NmrOneD 3058 Specdb::MsMs 21320 Specdb::MsMs 21321 Specdb::MsMs 21322 Specdb::MsMs 22871 Specdb::MsMs 22872 Specdb::MsMs 22873 Specdb::MsMs 2236072 Specdb::MsMs 2237294 Specdb::MsMs 2240288 Specdb::MsMs 2241404 Specdb::MsMs 2242404 Specdb::MsMs 2243472 Specdb::MsMs 2245222 Specdb::MsMs 2249392 Specdb::MsMs 3426666 Specdb::MsMs 3426667 Specdb::MsMs 3426668 Specdb::MsMs 3426669 Specdb::MsMs 3426670 Specdb::MsMs 3426671 Specdb::CMs 108374 Specdb::CMs 120929 Specdb::CMs 867663 Specdb::CMs 867664 Specdb::CMs 867665 Specdb::CMs 867666 Specdb::CMs 867667 Specdb::CMs 867668 Specdb::CMs 867669 Specdb::CMs 867670 Beer Type 2 specific 4.6 4.6 4.6 mg/100 g Cow milk, pasteurized, vitamin A + D added, 0% fat Type 2 specific Cow milk, pasteurized, vitamin A + D added, 1% fat Type 2 specific Cow milk, pasteurized, vitamin A + D added, 2% fat Type 2 specific Cow milk, pasteurized, vitamin D added, 3.25% fat Type 2 specific Green bell pepper Type 1 specific Capsicum annuum 4072 Orange bell pepper Type 1 specific Capsicum annuum 4072 Pepper Type 1 specific Capsicum annuum 4072 Pepper (C. frutescens) Type 1 specific Capsicum annuum var. annuum 40321 Red bell pepper Type 1 specific Capsicum annuum 4072 Sesame Type 1 specific Sesamum orientale 4182 Yellow bell pepper Type 1 specific Capsicum annuum 4072