1.0 2010-04-08 22:06:21 UTC 2025-11-18 22:57:09 UTC FDB004688 Vanillic acid 4-beta-D-glucoside Vanillic acid 4-beta-d-glucoside, also known as vanillate 4-β-D-glucoside, is a member of the class of compounds known as hydrolyzable tannins. Hydrolyzable tannins are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Vanillic acid 4-beta-d-glucoside is soluble (in water) and a weakly acidic compound (based on its pKa). Vanillic acid 4-beta-d-glucoside can be found in a number of food items such as sweet marjoram, orange bell pepper, yellow bell pepper, and pepper (c. annuum), which makes vanillic acid 4-beta-d-glucoside a potential biomarker for the consumption of these food products. C14H18O9 330.289 330.09508216 3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid 3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid [H][C@]1(CO)O[C@@]([H])(OC2=C(OC)C=C(C=C2)C(O)=O)[C@]([H])(O)[C@@]([H])(O)[C@]1([H])O InChI=1S/C14H18O9/c1-21-8-4-6(13(19)20)2-3-7(8)22-14-12(18)11(17)10(16)9(5-15)23-14/h2-4,9-12,14-18H,5H2,1H3,(H,19,20)/t9-,10-,11+,12-,14-/m1/s1 JYFOSWJYZIVJPO-YGEZULPYSA-N belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Hydrolyzable tannins Organic compounds Phenylpropanoids and polyketides Tannins Hydrolyzable tannins Aromatic heteromonocyclic compounds Acetals Alkyl aryl ethers Anisoles Benzoic acids Benzoyl derivatives Carboxylic acids Hexoses Hydrocarbon derivatives M-methoxybenzoic acids and derivatives Methoxybenzenes Monocarboxylic acids and derivatives O-glycosyl compounds Organic oxides Oxacyclic compounds Oxanes Phenolic glycosides Phenoxy compounds Polyols Primary alcohols Secondary alcohols Sugar acids and derivatives Acetal Alcohol Alkyl aryl ether Anisole Aromatic heteromonocyclic compound Benzenoid Benzoic acid Benzoic acid or derivatives Benzoyl Carboxylic acid Carboxylic acid derivative Ether Glycosyl compound Hexose monosaccharide Hydrocarbon derivative Hydrolyzable tannin M-methoxybenzoic acid or derivatives Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Monosaccharide O-glycosyl compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Oxane Phenol ether Phenolic glycoside Phenoxy compound Polyol Primary alcohol Secondary alcohol Sugar acid tannin logp -0.97 ALOGPS logs -1.45 ALOGPS solubility 1.16e+01 g/l ALOGPS logp -1.1 ChemAxon pka_strongest_acidic 4.1 ChemAxon pka_strongest_basic -3 ChemAxon iupac 3-methoxy-4-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}benzoic acid ChemAxon average_mass 330.289 ChemAxon mono_mass 330.09508216 ChemAxon smiles [H][C@]1(CO)O[C@@]([H])(OC2=C(OC)C=C(C=C2)C(O)=O)[C@]([H])(O)[C@@]([H])(O)[C@]1([H])O ChemAxon formula C14H18O9 ChemAxon inchi InChI=1S/C14H18O9/c1-21-8-4-6(13(19)20)2-3-7(8)22-14-12(18)11(17)10(16)9(5-15)23-14/h2-4,9-12,14-18H,5H2,1H3,(H,19,20)/t9-,10-,11+,12-,14-/m1/s1 ChemAxon inchikey JYFOSWJYZIVJPO-YGEZULPYSA-N ChemAxon polar_surface_area 145.91 ChemAxon refractivity 73.9 ChemAxon polarizability 31.2 ChemAxon rotatable_bond_count 5 ChemAxon acceptor_count 9 ChemAxon donor_count 5 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 78795 Specdb::MsMs 78796 Specdb::MsMs 78797 Specdb::MsMs 139245 Specdb::MsMs 139246 Specdb::MsMs 139247 Specdb::MsMs 3600836 Specdb::MsMs 3600837 Specdb::MsMs 3600838 Specdb::MsMs 3600839 Specdb::MsMs 3600840 Specdb::MsMs 3600841 Common thyme Type 1 specific Thymus vulgaris 49992 Green bell pepper Type 1 specific Capsicum annuum 4072 Orange bell pepper Type 1 specific Capsicum annuum 4072 Pepper Type 1 specific Capsicum annuum 4072 Red bell pepper Type 1 specific Capsicum annuum 4072 Rosemary Type 1 specific Rosmarinus officinalis 39367 Sweet basil Type 1 specific Ocimum basilicum 39350 Sweet marjoram Type 1 specific Origanum majorana 268884 Yellow bell pepper Type 1 specific Capsicum annuum 4072