1.0 2010-04-08 22:06:26 UTC 2025-11-18 22:57:45 UTC FDB004884 trans-2-Methoxycinnamic acid Trans-2-methoxycinnamic acid is a member of the class of compounds known as coumaric acids. Coumaric acids are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Trans-2-methoxycinnamic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Trans-2-methoxycinnamic acid can be found in chinese cinnamon, which makes trans-2-methoxycinnamic acid a potential biomarker for the consumption of this food product. C10H10O3 178.1846 178.062994186 (2E)-3-(2-methoxyphenyl)prop-2-enoic acid (2E)-3-(2-methoxyphenyl)prop-2-enoic acid [H]\C(=C(\[H])C1=CC=CC=C1OC)C(O)=O InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+ FEGVSPGUHMGGBO-VOTSOKGWSA-N belongs to the class of organic compounds known as coumaric acids. These are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 (ortho-), C3 (meta-), or C4 (para-) carbon atom of the benzene ring. Coumaric acids Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds Alkyl aryl ethers Anisoles Carbonyl compounds Carboxylic acids Cinnamic acids Hydrocarbon derivatives Methoxybenzenes Monocarboxylic acids and derivatives Organic oxides Phenoxy compounds Styrenes Alkyl aryl ether Anisole Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid Carboxylic acid derivative Cinnamic acid Coumaric acid Ether Hydrocarbon derivative Methoxybenzene Monocarboxylic acid or derivatives Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene logp 2.38 ALOGPS logs -2.45 ALOGPS solubility 6.38e-01 g/l ALOGPS logp 1.98 ChemAxon pka_strongest_acidic 4.14 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (2E)-3-(2-methoxyphenyl)prop-2-enoic acid ChemAxon average_mass 178.1846 ChemAxon mono_mass 178.062994186 ChemAxon smiles [H]\C(=C(\[H])C1=CC=CC=C1OC)C(O)=O ChemAxon formula C10H10O3 ChemAxon inchi InChI=1S/C10H10O3/c1-13-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+ ChemAxon inchikey FEGVSPGUHMGGBO-VOTSOKGWSA-N ChemAxon polar_surface_area 46.53 ChemAxon refractivity 49.52 ChemAxon polarizability 18.22 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 1465 Specdb::CMs 1466 Specdb::MsMs 109629 Specdb::MsMs 109630 Specdb::MsMs 109631 Specdb::MsMs 177102 Specdb::MsMs 177103 Specdb::MsMs 177104 Specdb::MsMs 3601085 Specdb::MsMs 3601086 Specdb::MsMs 3601087 Specdb::MsMs 3601088 Specdb::MsMs 3601089 Specdb::MsMs 3601090 Chinese cinnamon Type 1 specific Cinnamomum aromaticum 119260