1.0 2010-04-08 22:06:28 UTC 2025-11-18 22:57:53 UTC FDB004944 Lupinic acid Lupinic acid, also known as lupinate, is a member of the class of compounds known as lupinine-type alkaloids. Lupinine-type alkaloids are lupin alkaloids with a structure based on the lupinine skeleton, which is a bicyclic compound consisting of a quinolizidine. Lupinic acid is soluble (in water) and a weakly acidic compound (based on its pKa). Lupinic acid can be found in watermelon, which makes lupinic acid a potential biomarker for the consumption of this food product. C10H17NO2 183.2475 183.125928793 octahydro-1H-quinolizine-1-carboxylic acid octahydro-1H-quinolizine-1-carboxylic acid OC(=O)C1CCCN2CCCCC12 InChI=1S/C10H17NO2/c12-10(13)8-4-3-7-11-6-2-1-5-9(8)11/h8-9H,1-7H2,(H,12,13) ZYQJGZAVMHNFNY-UHFFFAOYSA-N belongs to the class of organic compounds known as lupinine-type alkaloids. These are lupin alkaloids with a structure based on the lupinine skeleton, which is a bicyclic compound consisting of a quinolizidine. Lupinine-type alkaloids Organic compounds Alkaloids and derivatives Lupin alkaloids Lupinine-type alkaloids Aliphatic heteropolycyclic compounds Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Piperidinecarboxylic acids Quinolizidines Quinolizines Trialkylamines Aliphatic heteropolycyclic compound Amine Amino acid Amino acid or derivatives Azacycle Carbonyl group Carboxylic acid Carboxylic acid derivative Hydrocarbon derivative Lupinine Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperidine Piperidinecarboxylic acid Quinolizidine Quinolizine Tertiary aliphatic amine Tertiary amine logp -0.96 ALOGPS logs -0.18 ALOGPS solubility 1.22e+02 g/l ALOGPS logp -1.4 ChemAxon pka_strongest_acidic 3.8 ChemAxon pka_strongest_basic 10.16 ChemAxon iupac octahydro-1H-quinolizine-1-carboxylic acid ChemAxon average_mass 183.2475 ChemAxon mono_mass 183.125928793 ChemAxon smiles OC(=O)C1CCCN2CCCCC12 ChemAxon formula C10H17NO2 ChemAxon inchi InChI=1S/C10H17NO2/c12-10(13)8-4-3-7-11-6-2-1-5-9(8)11/h8-9H,1-7H2,(H,12,13) ChemAxon inchikey ZYQJGZAVMHNFNY-UHFFFAOYSA-N ChemAxon polar_surface_area 40.54 ChemAxon refractivity 50.03 ChemAxon polarizability 20.2 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 67476 Specdb::MsMs 67477 Specdb::MsMs 67478 Specdb::MsMs 125313 Specdb::MsMs 125314 Specdb::MsMs 125315 Specdb::MsMs 3601223 Specdb::MsMs 3601224 Specdb::MsMs 3601225 Specdb::MsMs 3602570 Specdb::MsMs 3602571 Specdb::MsMs 3602572 Watermelon Type 1 specific Citrullus lanatus 3654