1.0 2010-04-08 22:06:31 UTC 2019-11-26 03:00:21 UTC FDB005075 2-trans-O-Feruloylglucaric acid 2-trans-o-feruloylglucaric acid belongs to glucuronic acid derivatives class of compounds. Those are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. 2-trans-o-feruloylglucaric acid is slightly soluble (in water) and a moderately acidic compound (based on its pKa). 2-trans-o-feruloylglucaric acid can be found in sweet orange, which makes 2-trans-o-feruloylglucaric acid a potential biomarker for the consumption of this food product. C16H18O11 386.3075 386.084911418 (2S,3S,4S,5R)-2,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}hexanedioic acid (2S,3S,4S,5R)-2,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}hexanedioic acid COC1=C(O)C=CC(\C=C\C(=O)O[C@H]([C@@H](O)[C@H](O)[C@H](O)C(O)=O)C(O)=O)=C1 InChI=1S/C16H18O11/c1-26-9-6-7(2-4-8(9)17)3-5-10(18)27-14(16(24)25)12(20)11(19)13(21)15(22)23/h2-6,11-14,17,19-21H,1H3,(H,22,23)(H,24,25)/b5-3+/t11-,12-,13-,14+/m0/s1 JZRAOXRUPYISEN-GLJYKRHASA-N belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Glucuronic acid derivatives Organic compounds Organic oxygen compounds Organooxygen compounds Carbohydrates and carbohydrate conjugates Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Alkyl aryl ethers Alpha hydroxy acids and derivatives Anisoles Beta hydroxy acids and derivatives Carbonyl compounds Carboxylic acids Cinnamic acid esters Coumaric acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Monosaccharides Organic oxides Phenoxy compounds Polyols Secondary alcohols Styrenes Tricarboxylic acids and derivatives 1-hydroxy-2-unsubstituted benzenoid Alcohol Alkyl aryl ether Alpha,beta-unsaturated carboxylic ester Alpha-hydroxy acid Anisole Aromatic homomonocyclic compound Benzenoid Beta-hydroxy acid Carbonyl group Carboxylic acid Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Cinnamic acid or derivatives Coumaric acid or derivatives Enoate ester Ether Fatty acid ester Fatty acyl Glucuronic acid or derivatives Hydrocarbon derivative Hydroxy acid Hydroxycinnamic acid or derivatives Methoxybenzene Methoxyphenol Monocyclic benzene moiety Monosaccharide Organic oxide Phenol Phenol ether Phenoxy compound Polyol Secondary alcohol Styrene Tricarboxylic acid or derivatives logp 0.71 ALOGPS logs -2.34 ALOGPS solubility 1.78e+00 g/l ALOGPS logp -0.52 ChemAxon pka_strongest_acidic 2.79 ChemAxon pka_strongest_basic -3.7 ChemAxon iupac (2S,3S,4S,5R)-2,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}hexanedioic acid ChemAxon average_mass 386.3075 ChemAxon mono_mass 386.084911418 ChemAxon smiles COC1=C(O)C=CC(\C=C\C(=O)O[C@H]([C@@H](O)[C@H](O)[C@H](O)C(O)=O)C(O)=O)=C1 ChemAxon formula C16H18O11 ChemAxon inchi InChI=1S/C16H18O11/c1-26-9-6-7(2-4-8(9)17)3-5-10(18)27-14(16(24)25)12(20)11(19)13(21)15(22)23/h2-6,11-14,17,19-21H,1H3,(H,22,23)(H,24,25)/b5-3+/t11-,12-,13-,14+/m0/s1 ChemAxon inchikey JZRAOXRUPYISEN-GLJYKRHASA-N ChemAxon polar_surface_area 191.05 ChemAxon refractivity 86.15 ChemAxon polarizability 35.61 ChemAxon rotatable_bond_count 10 ChemAxon acceptor_count 10 ChemAxon donor_count 6 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 101757 Specdb::MsMs 101758 Specdb::MsMs 101759 Specdb::MsMs 167439 Specdb::MsMs 167440 Specdb::MsMs 167441 Specdb::MsMs 3601346 Specdb::MsMs 3601347 Specdb::MsMs 3601348 Specdb::MsMs 3601349 Specdb::MsMs 3601350 Specdb::MsMs 3601351 Sweet orange Type 1 specific Citrus sinensis 2711