1.0 2010-04-08 22:06:32 UTC 2025-11-18 22:58:18 UTC FDB005127 N,N-Dimethyl-3-methylaniline N,n-dimethyl-3-methylaniline is a member of the class of compounds known as aminotoluenes. Aminotoluenes are organic aromatic compounds containing a benzene that carries a single methyl group and one amino group. N,n-dimethyl-3-methylaniline is slightly soluble (in water) and a very strong basic compound (based on its pKa). N,n-dimethyl-3-methylaniline can be found in sweet orange, which makes n,n-dimethyl-3-methylaniline a potential biomarker for the consumption of this food product. Benzenamine, N,N,3-trimethyl- Benzene, 1-(dimethylamino)-3-methyl- Benzeneamine,N,N,3-trimethyl- Dimethyl-m-toluidine Dimetil-m-toluidina M-methyl-n,n-dimethylaniline M-toluidine, n,n-dimethyl- M, n,n-trimethylaniline M,n,n-trimethylaniline N, N-Dimethyl-3-methylaniline N, n-dimethyl-m-methylaniline N,N-Dimethyl-3-methylaniline N,N-Dimethyl-3-toluidine N,n-dimethyl-m-ethylaniline N,n-dimethyl-m-methylaniline N,n-dimethyl-m-toluidine N,N,3-Trimethylaniline N,N,3-Trimethylbenzenamine C9H13N 135.2062 135.104799421 N,N,3-trimethylaniline M-toluidine-N,N-dimethyl 88-05-1 CN(C)C1=CC(C)=CC=C1 InChI=1S/C9H13N/c1-8-5-4-6-9(7-8)10(2)3/h4-7H,1-3H3 CWOMTHDOJCARBY-UHFFFAOYSA-N belongs to the class of organic compounds known as aminotoluenes. These are organic aromatic compounds containing a benzene that carries a single methyl group and one amino group. Aminotoluenes Organic compounds Benzenoids Benzene and substituted derivatives Toluenes Aromatic homomonocyclic compounds Aniline and substituted anilines Dialkylarylamines Hydrocarbon derivatives Organopnictogen compounds Amine Aminotoluene Aniline or substituted anilines Aromatic homomonocyclic compound Dialkylarylamine Hydrocarbon derivative Organic nitrogen compound Organonitrogen compound Organopnictogen compound Tertiary aliphatic/aromatic amine Tertiary amine logp 2.58 ALOGPS logs -1.25 ALOGPS solubility 7.63e+00 g/l ALOGPS logp 2.59 ChemAxon pka_strongest_basic 5.15 ChemAxon iupac N,N,3-trimethylaniline ChemAxon average_mass 135.2062 ChemAxon mono_mass 135.104799421 ChemAxon smiles CN(C)C1=CC(C)=CC=C1 ChemAxon formula C9H13N ChemAxon inchi InChI=1S/C9H13N/c1-8-5-4-6-9(7-8)10(2)3/h4-7H,1-3H3 ChemAxon inchikey CWOMTHDOJCARBY-UHFFFAOYSA-N ChemAxon polar_surface_area 3.24 ChemAxon refractivity 45.53 ChemAxon polarizability 16.45 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 56907 Specdb::MsMs 56908 Specdb::MsMs 56909 Specdb::MsMs 112440 Specdb::MsMs 112441 Specdb::MsMs 112442 Specdb::MsMs 3601391 Specdb::MsMs 3601392 Specdb::MsMs 3601393 Specdb::MsMs 3601394 Specdb::MsMs 3601395 Specdb::MsMs 3601396 Sweet orange Type 1 specific Citrus sinensis 2711