1.0 2010-04-08 22:06:36 UTC 2025-11-18 22:58:39 UTC FDB005268 Cucurbitin Cucurbitin is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Cucurbitin is soluble (in water) and a moderately acidic compound (based on its pKa). Cucurbitin can be found in cucumber and muskmelon, which makes cucurbitin a potential biomarker for the consumption of these food products. Cucurbitin is an amino acid and a carboxypyrrolidine that is found in Cucurbita seeds. Cucurbitin causes degenerative changes in the reproductive organs of parasitic flatworms called flukes . C5H10N2O2 130.1451 130.074227574 3-aminopyrrolidine-3-carboxylic acid 3-aminopyrrolidine-3-carboxylic acid NC1(CCNC1)C(O)=O InChI=1S/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9) DWAKXSZUASEUHH-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Pyrrolidine carboxylic acids Aliphatic heteromonocyclic compound Alpha-amino acid Amine Amino acid Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine Pyrrolidine Pyrrolidine carboxylic acid Pyrrolidine carboxylic acid or derivatives Secondary aliphatic amine Secondary amine logp -3.19 ALOGPS logs 0.30 ALOGPS solubility 2.62e+02 g/l ALOGPS logp -3.8 ChemAxon pka_strongest_acidic 1.69 ChemAxon pka_strongest_basic 10.68 ChemAxon iupac 3-aminopyrrolidine-3-carboxylic acid ChemAxon average_mass 130.1451 ChemAxon mono_mass 130.074227574 ChemAxon smiles NC1(CCNC1)C(O)=O ChemAxon formula C5H10N2O2 ChemAxon inchi InChI=1S/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9) ChemAxon inchikey DWAKXSZUASEUHH-UHFFFAOYSA-N ChemAxon polar_surface_area 75.35 ChemAxon refractivity 31.33 ChemAxon polarizability 12.43 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 93135 Specdb::MsMs 93136 Specdb::MsMs 93137 Specdb::MsMs 156864 Specdb::MsMs 156865 Specdb::MsMs 156866 Specdb::MsMs 3601541 Specdb::MsMs 3601542 Specdb::MsMs 3601543 Specdb::MsMs 3601544 Specdb::MsMs 3601545 Specdb::MsMs 3601546 Cucumber Type 1 specific Cucumis sativus 3659 Muskmelon Type 1 specific Cucumis melo 3656 Anti-helmintic 72 A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Pesticide 1210 Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. Schistosomicide 1303