1.0 2010-04-08 22:06:41 UTC 2025-11-18 22:59:15 UTC FDB005441 Norvaline Norvaline, also known as alpha-aminovaleric acid or A-aminovalerate, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Norvaline is soluble (in water) and a moderately acidic compound (based on its pKa). Norvaline can be synthesized from valeric acid. Norvaline can also be synthesized into 3-hydroxynorvaline and 2-amino-5-phosphonopentanoic acid. Norvaline can be found in blackcurrant and common buckwheat, which makes norvaline a potential biomarker for the consumption of these food products. Norvaline (abbreviated as Nva) is an amino acid with the formula CH3(CH2)2CH(NH2)CO2H. The compound is an isomer of the more common amino acid valine. Like most other α-amino acids, norvaline is chiral. It is a white, water-soluble solid . (2S)-2-aminopentanoic acid (S)-(+)-2-Aminopentanoic acid (S)-2-Aminopentanoic acid (S)-2-Aminovaleric acid α-aminovaleric acid α-l-aminopentanoic acid 2-AMINO-PENTANOIC ACID 2-Aminopentanoic acid 2-Aminovaleric acid Alpha-l-aminopentanoic acid L-2-Aminopentanoic acid L-2-Aminovaleric acid L-norvaline L-Norvaline (9CI) Norvaline (van) Norvaline, l- NVA Pentanoic acid, 2-amino- Pentanoic acid, 2-amino-, (S)- RON Valeric acid, 2-amino- C5H11NO2 117.1463 117.078978601 2-aminopentanoic acid Nva 760-78-1 CCCC(N)C(O)=O InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) SNDPXSYFESPGGJ-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic acyclic compounds Amino acids Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Methyl-branched fatty acids Monoalkylamines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic acyclic compound Alpha-amino acid Amine Amino acid Branched fatty acid Carbonyl group Carboxylic acid Fatty acid Fatty acyl Hydrocarbon derivative Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Primary aliphatic amine Primary amine a small molecule non-proteinogenic alpha-amino acid logp -2.04 ALOGPS logs 0.26 ALOGPS solubility 2.12e+02 g/l ALOGPS melting_point 307 oC logp -1.9 ChemAxon pka_strongest_acidic 2.71 ChemAxon pka_strongest_basic 9.53 ChemAxon iupac 2-aminopentanoic acid ChemAxon average_mass 117.1463 ChemAxon mono_mass 117.078978601 ChemAxon smiles CCCC(N)C(O)=O ChemAxon formula C5H11NO2 ChemAxon inchi InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) ChemAxon inchikey SNDPXSYFESPGGJ-UHFFFAOYSA-N ChemAxon polar_surface_area 63.32 ChemAxon refractivity 29.62 ChemAxon polarizability 12.49 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::NmrOneD 191041 Specdb::NmrOneD 191042 Specdb::NmrOneD 191043 Specdb::NmrOneD 191044 Specdb::NmrOneD 191045 Specdb::NmrOneD 191046 Specdb::NmrOneD 191047 Specdb::NmrOneD 191048 Specdb::NmrOneD 191049 Specdb::NmrOneD 191050 Specdb::NmrOneD 191051 Specdb::NmrOneD 191052 Specdb::NmrOneD 191053 Specdb::NmrOneD 191054 Specdb::NmrOneD 191055 Specdb::NmrOneD 191056 Specdb::NmrOneD 191057 Specdb::NmrOneD 191058 Specdb::NmrOneD 191059 Specdb::NmrOneD 191060 Specdb::CMs 104087 Specdb::CMs 116039 Specdb::CMs 116981 Specdb::CMs 875432 Specdb::CMs 875433 Specdb::CMs 875434 Specdb::MsMs 1325311 Specdb::MsMs 1325312 Specdb::MsMs 1325313 Specdb::MsMs 1439656 Specdb::MsMs 1439657 Specdb::MsMs 1439658 Specdb::MsMs 3430422 Specdb::MsMs 3430423 Specdb::MsMs 3430424 Specdb::MsMs 3431319 Specdb::MsMs 3431320 Specdb::MsMs 3431321 18314 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Blackcurrant Type 1 specific Ribes nigrum 78511 1.7 1.7 1.7 mg/100 g Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common buckwheat Type 1 specific Fagopyrum esculentum 3617 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823