1.0 2010-04-08 22:06:42 UTC 2025-11-18 22:59:20 UTC FDB005463 Cerebroside Cerebrosides is the common name for a group of glycosphingolipids called monoglycosylceramides which are important components in animal muscle and nerve cell membranes. They consist of a ceramide with a single sugar residue at the 1-hydroxyl moiety. The sugar residue can be either glucose or galactose; the two major types are therefore called glucocerebrosides and galactocerebrosides. Galactocerebrosides are typically found in neural tissue, while glucocerebrosides are found in other tissues. Cerebrosides Monoglycosylceramide Monoglycosylceramides C18H37NO2 299.4919 299.282429433 (2S,3R,4E)-2-aminooctadec-4-ene-1,3-diol sphingosine 123-78-4 [H]\C(CCCCCCCCCCCCC)=C(\[H])[C@@]([H])(O)[C@@]([H])(N)CO InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m0/s1 WWUZIQQURGPMPG-KRWOKUGFSA-N belongs to the class of organic compounds known as 1,2-aminoalcohols. These are organic compounds containing an alkyl chain with an amine group bound to the C1 atom and an alcohol group bound to the C2 atom. 1,2-aminoalcohols Organic compounds Organic nitrogen compounds Organonitrogen compounds Amines Aliphatic acyclic compounds Hydrocarbon derivatives Monoalkylamines Organopnictogen compounds Primary alcohols Secondary alcohols 1,2-aminoalcohol Alcohol Aliphatic acyclic compound Hydrocarbon derivative Organic oxygen compound Organooxygen compound Organopnictogen compound Primary alcohol Primary aliphatic amine Primary amine Secondary alcohol Sphing-4-enines (Sphingosines) Sphing-4-enines (Sphingosines) sphing-4-enine logp 5.15 ALOGPS logs -4.89 ALOGPS solubility 3.90e-03 g/l ALOGPS logp 4.57 ChemAxon pka_strongest_acidic 14.12 ChemAxon pka_strongest_basic 9.23 ChemAxon iupac (2S,3R,4E)-2-aminooctadec-4-ene-1,3-diol ChemAxon average_mass 299.4919 ChemAxon mono_mass 299.282429433 ChemAxon smiles [H]\C(CCCCCCCCCCCCC)=C(\[H])[C@@]([H])(O)[C@@]([H])(N)CO ChemAxon formula C18H37NO2 ChemAxon inchi InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-15,17-18,20-21H,2-13,16,19H2,1H3/b15-14+/t17-,18+/m0/s1 ChemAxon inchikey WWUZIQQURGPMPG-KRWOKUGFSA-N ChemAxon polar_surface_area 66.48 ChemAxon refractivity 91.89 ChemAxon polarizability 39.37 ChemAxon rotatable_bond_count 15 ChemAxon acceptor_count 3 ChemAxon donor_count 3 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::NmrTwoD 2059 Specdb::CMs 1978 Specdb::CMs 32100 Specdb::CMs 32101 Specdb::CMs 160781 Specdb::CMs 1055552 Specdb::CMs 1055554 Specdb::CMs 1055556 Specdb::CMs 1055558 Specdb::CMs 1055560 Specdb::CMs 1055562 Specdb::CMs 1055564 Specdb::CMs 1055566 Specdb::CMs 1055568 Specdb::CMs 1055570 Specdb::CMs 1055572 Specdb::CMs 1055574 Specdb::CMs 1055576 Specdb::CMs 1055578 Specdb::NmrOneD 5241 Specdb::NmrOneD 333438 Specdb::NmrOneD 333439 Specdb::NmrOneD 333440 Specdb::NmrOneD 333441 Specdb::NmrOneD 333442 Specdb::NmrOneD 333443 Specdb::NmrOneD 333444 Specdb::NmrOneD 333445 Specdb::NmrOneD 333446 Specdb::NmrOneD 333447 Specdb::NmrOneD 333448 Specdb::NmrOneD 333449 Specdb::NmrOneD 333450 Specdb::NmrOneD 333451 Specdb::NmrOneD 333452 Specdb::NmrOneD 333453 Specdb::NmrOneD 333454 Specdb::NmrOneD 333455 Specdb::NmrOneD 333456 Specdb::NmrOneD 333457 Specdb::MsMs 95370 Specdb::MsMs 95371 Specdb::MsMs 95372 Specdb::MsMs 159627 Specdb::MsMs 159628 Specdb::MsMs 159629 Specdb::MsMs 447488 Specdb::MsMs 451394 Specdb::MsMs 2236253 Specdb::MsMs 2248383 Specdb::MsMs 2250007 Specdb::MsMs 2250411 Specdb::MsMs 2251958 Specdb::MsMs 2385212 Specdb::MsMs 2385213 Specdb::MsMs 2385214 Specdb::MsMs 2577753 Specdb::MsMs 2577754 Specdb::MsMs 2577755 23079 Anatidae Type 1 specific Anatidae 8830 Beefalo Type 1 specific Bos taurus X Bison bison 297284 Bison Type 1 specific Bison bison 9901 Buffalo Type 1 specific Bubalus bubalis 89462 Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 Chicken Type 1 specific Gallus gallus 9031 Columbidae (Dove, Pigeon) Type 1 specific Columbidae 8930 Common bean Type 1 specific Phaseolus vulgaris 3885 Deer Type 1 specific Cervidae 9850 Domestic goat Type 1 specific Capra aegagrus hircus 9925 Domestic pig Type 1 specific Sus scrofa domestica 9825 Elk Type 1 specific Cervus canadensis 1574408 Emu Type 1 specific Dromaius novaehollandiae 8790 European rabbit Type 1 specific Oryctolagus 9984 Fig Type 1 specific Ficus carica 3494 Greylag goose Type 1 specific Anser anser 8843 Guinea hen Type 1 specific Numida meleagris 8996 Horse Type 1 specific Equus caballus 9796 Mallard duck Type 1 specific Anas platyrhynchos 8839 Mountain hare Type 1 specific Lepus timidus 62621 Mule deer Type 1 specific Odocoileus 9871 Ostrich Type 1 specific Struthio camelus 8801 Pheasant Type 1 specific Phasianus colchicus 9054 Pomegranate Type 1 specific Punica granatum 22663 Quail Type 1 specific Phasianidae 9005 Rabbit Type 1 specific Leporidae 9979 Rock ptarmigan Type 1 specific Lagopus muta 64668 Sheep (Mutton, Lamb) Type 1 specific Ovis aries 9940 Squab Type 1 specific Columba 8931 Turkey Type 1 specific Meleagris gallopavo 9103 Velvet duck Type 1 specific Melanitta fusca 371864 Wild boar Type 1 specific Sus scrofa 9823