1.0 2010-04-08 22:06:42 UTC 2025-11-18 22:59:22 UTC FDB005490 N,N-Dimethylanthranilic acid N,n-dimethylanthranilic acid is a member of the class of compounds known as aminobenzoic acids. Aminobenzoic acids are benzoic acids containing an amine group attached to the benzene moiety. N,n-dimethylanthranilic acid is soluble (in water) and a weakly acidic compound (based on its pKa). N,n-dimethylanthranilic acid can be found in fig, which makes n,n-dimethylanthranilic acid a potential biomarker for the consumption of this food product. N,N-Dimethylanthranilate N,N-Dimethylanthranilic acid C9H11NO2 165.1891 165.078978601 2-(dimethylamino)benzoic acid 2-(dimethylamino)benzoic acid 85-91-6 CN(C)C1=CC=CC=C1C(O)=O InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) DVVXXHVHGGWWPE-UHFFFAOYSA-N belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety. Aminobenzoic acids Organic compounds Benzenoids Benzene and substituted derivatives Benzoic acids and derivatives Aromatic homomonocyclic compounds Amino acids Aniline and substituted anilines Benzoic acids Benzoyl derivatives Carboxylic acids Dialkylarylamines Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Organooxygen compounds Organopnictogen compounds Vinylogous amides Amine Amino acid Amino acid or derivatives Aminobenzoic acid Aniline or substituted anilines Aromatic homomonocyclic compound Benzoic acid Benzoyl Carboxylic acid Carboxylic acid derivative Dialkylarylamine Hydrocarbon derivative Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Tertiary aliphatic/aromatic amine Tertiary amine Vinylogous amide logp 1.33 ALOGPS logs -1.19 ALOGPS solubility 1.06e+01 g/l ALOGPS logp 1.74 ChemAxon pka_strongest_acidic 4.65 ChemAxon pka_strongest_basic 1.5 ChemAxon iupac 2-(dimethylamino)benzoic acid ChemAxon average_mass 165.1891 ChemAxon mono_mass 165.078978601 ChemAxon smiles CN(C)C1=CC=CC=C1C(O)=O ChemAxon formula C9H11NO2 ChemAxon inchi InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) ChemAxon inchikey DVVXXHVHGGWWPE-UHFFFAOYSA-N ChemAxon polar_surface_area 40.54 ChemAxon refractivity 47.74 ChemAxon polarizability 17.14 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 3 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 59412 Specdb::MsMs 59413 Specdb::MsMs 59414 Specdb::MsMs 115539 Specdb::MsMs 115540 Specdb::MsMs 115541 Specdb::MsMs 3601829 Specdb::MsMs 3601830 Specdb::MsMs 3601831 Specdb::MsMs 3601832 Specdb::MsMs 3601833 Specdb::MsMs 3601834 Fig Type 1 specific Ficus carica 3494