1.0 2010-04-08 22:06:45 UTC 2025-11-18 22:59:31 UTC FDB005582 Isoflavones Isoflavones are a class of phytochemicals related to the isoflavonoids. Isoflavones are produced almost exclusively by the members of the Fabaceae (i.e., Leguminosae, or bean) family. Soy isoflavones consumption has been related to a lower incidence of breast cancer and other common cancers. [Wikipedia]. Isoflavones is found in soy bean. Isoflavone C15H10O2 222.243 222.068079562 3-phenyl-4H-chromen-4-one isoflavone 574-12-9 O=C1C(=COC2=CC=CC=C12)C1=CC=CC=C1 InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H GOMNOOKGLZYEJT-UHFFFAOYSA-N belongs to the class of organic compounds known as isoflavones. These are polycyclic compounds containing a 2-isoflavene skeleton which bears a ketone group at the C4 carbon atom. Isoflavones Organic compounds Phenylpropanoids and polyketides Isoflavonoids Isoflav-2-enes Aromatic heteropolycyclic compounds Benzene and substituted derivatives Chromones Heteroaromatic compounds Hydrocarbon derivatives Organic oxides Organooxygen compounds Oxacyclic compounds Pyranones and derivatives 1-benzopyran Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Heteroaromatic compound Hydrocarbon derivative Isoflavone Monocyclic benzene moiety Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Pyran Pyranone Isoflavonoids a small molecule isoflavones logp 3.51 ALOGPS logs -4.42 ALOGPS solubility 8.43e-03 g/l ALOGPS logp 3.34 ChemAxon pka_strongest_basic -5.3 ChemAxon iupac 3-phenyl-4H-chromen-4-one ChemAxon average_mass 222.243 ChemAxon mono_mass 222.068079562 ChemAxon smiles O=C1C(=COC2=CC=CC=C12)C1=CC=CC=C1 ChemAxon formula C15H10O2 ChemAxon inchi InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H ChemAxon inchikey GOMNOOKGLZYEJT-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 65.74 ChemAxon polarizability 23.64 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 26874 Specdb::CMs 113113 Specdb::CMs 126769 Specdb::MsMs 57840 Specdb::MsMs 57841 Specdb::MsMs 57842 Specdb::MsMs 113628 Specdb::MsMs 113629 Specdb::MsMs 113630 Specdb::MsMs 3440626 Specdb::MsMs 3440627 Specdb::MsMs 3440628 Specdb::MsMs 3440629 Specdb::MsMs 3440630 Specdb::MsMs 3440631 Adzuki bean Type 1 specific Vigna angularis 3914 0.59 0.59 0.59 mg/100 g Albacore tuna Type 1 specific Thunnus alalunga 8235 0.28 0.28 0.28 mg/100 g Alfalfa Type 1 specific Medicago sativa 3879 0.04 0.04 0.04 mg/100 g Almond Type 1 specific Prunus dulcis 3755 0.01 0.01 0.01 mg/100 g American cranberry Type 1 specific Vaccinium macrocarpon 13750 0.01 0.01 0.01 mg/100 g Apricot Type 1 specific Prunus armeniaca 36596 0.02 0.02 0.02 mg/100 g Arabica coffee Type 1 specific Coffea arabica 13443 0.04 0.04 0.04 mg/100 g Asparagus Type 1 specific Asparagus officinalis 4686 0.03 0.03 0.03 mg/100 g Baked beans Type 2 specific 0.01 0.01 0.01 mg/100 g Barley Type 1 specific Hordeum vulgare 4513 0.01 0.01 0.01 mg/100 g Bean Type 1 specific 0.01 0.01 0.01 mg/100 g Biscuit Type 2 specific 0.03 0.03 0.03 mg/100 g Black tea Type 1 0.04 0.05 0.02 mg/100 g Black-eyed pea Type 1 specific Vigna unguiculata ssp. unguiculata 3920 0.03 0.03 0.03 mg/100 g Blackcurrant Type 1 specific Ribes nigrum 78511 0.07 0.07 0.07 mg/100 g Breakfast cereal Type 2 specific 0.025 0.03 0.02 mg/100 g Broad bean Type 1 specific Vicia faba 3906 0.96 1.29 0.63 mg/100 g Broccoli Type 1 specific Brassica oleracea var. italica 36774 0.04 0.04 0.04 mg/100 g Cake Type 2 specific 0.24 0.28 0.2 mg/100 g Cashew nut Type 1 specific Anacardium occidentale 171929 0.01 0.01 0.01 mg/100 g Cattle (Beef, Veal) Type 1 specific Bos taurus 9913 1.5 1.86 1.14 mg/100 g Chickpea Type 1 specific Cicer arietinum 3827 0.2 0.38 0.02 mg/100 g Chili Type 2 specific 2.315 2.43 2.2 mg/100 g Coconut Type 1 specific Cocos nucifera 13894 0.02 0.02 0.02 mg/100 g Coffee Type 1 generic Coffea 13442 0.04 0.04 0.04 mg/100 g Common bean Type 1 specific Phaseolus vulgaris 3885 0.134375 0.59 0.01 mg/100 g Common grape Type 1 specific Vitis vinifera 29760 0.045 0.08 0.01 mg/100 g Common pea Type 1 specific Pisum sativum 3888 0.156667 0.44 0.01 mg/100 g Common walnut Type 1 specific Juglans regia 51240 0.03 0.03 0.03 mg/100 g Corn Type 1 specific Zea mays 4577 0.015 0.02 0.01 mg/100 g Couscous Type 2 specific 0.01 0.01 0.01 mg/100 g Cracker Type 2 specific 0.01 0.01 0.01 mg/100 g Crisp bread Type 2 specific 0.406667 1.19 0.01 mg/100 g Date Type 1 specific Phoenix dactylifera 42345 0.01 0.01 0.01 mg/100 g European chestnut Type 1 specific Castanea sativa 21020 0.01 0.01 0.01 mg/100 g European plum Type 1 specific Prunus domestica 3758 0.02 0.02 0.02 mg/100 g Fenugreek Type 1 specific Trigonella foenum-graecum 78534 0.02 0.02 0.02 mg/100 g Flaxseed Type 1 specific Linum usitatissimum 4006 0.07 0.07 0.07 mg/100 g Garlic Type 1 specific Allium sativum 4682 0.02 0.02 0.02 mg/100 g Gram bean Type 1 specific Vigna mungo 3915 0.02 0.02 0.02 mg/100 g Grapefruit Type 1 specific Citrus X paradisi 37656 0.06 0.06 0.06 mg/100 g Green tea Type 1 0.04 0.05 0.02 mg/100 g Hazelnut Type 1 specific Corylus 13450 0.03 0.03 0.03 mg/100 g Herbal tea Type 1 0.04 0.05 0.02 mg/100 g Hummus Type 2 specific 0.01 0.01 0.01 mg/100 g Lentils Type 1 generic Lens culinaris 3864 0.06 0.06 0.06 mg/100 g Lima bean Type 1 specific Phaseolus lunatus 3884 0.01 0.01 0.01 mg/100 g Margarine-like spread Type 2 specific 0.57 0.57 0.57 mg/100 g Miso Type 2 specific 27.07 41.45 1.52 mg/100 g Multigrain bread Type 2 specific 0.38 0.38 0.38 mg/100 g Mung bean Type 1 specific Vigna radiata 157791 0.066667 0.1 0.01 mg/100 g Natto Type 2 specific 82.29 82.29 82.29 mg/100 g Nutritional drink Type 2 specific 0.6 0.6 0.6 mg/100 g Olive Type 1 specific Olea europaea 4146 0.04 0.04 0.04 mg/100 g Other bread product Type 2 specific 0.55 0.7 0.4 mg/100 g Other fish product Type 2 specific 0.1 0.1 0.1 mg/100 g Other snack food Type 2 specific 29.646667 54.16 0.1 mg/100 g Other soy product Type 2 specific 51.295 131.53 9.13 mg/100 g Passion fruit Type 1 specific Passiflora edulis 78168 0.02 0.02 0.02 mg/100 g Pasta Type 2 specific 0.014 0.02 0.01 mg/100 g Pastry Type 2 specific 2.457143 5.31 0.47 mg/100 g Peanut Type 1 specific Arachis hypogaea 3818 0.595 2.09 0.01 mg/100 g Pigeon pea Type 1 specific Cajanus cajan 3821 0.56 0.56 0.56 mg/100 g Pistachio Type 1 specific Pistacia vera 55513 3.63 3.63 3.63 mg/100 g Pizza Type 2 specific 0.01 0.01 0.01 mg/100 g Potato Type 1 specific Solanum tuberosum 4113 0.01 0.01 0.01 mg/100 g Red tea Type 1 0.04 0.05 0.02 mg/100 g Rice Type 1 specific Oryza sativa 4530 0.07 0.07 0.07 mg/100 g Robusta coffee Type 1 specific Coffea canephora 49390 0.04 0.04 0.04 mg/100 g Salad dressing Type 2 specific 16.8 16.8 16.8 mg/100 g Salted butter Type 1 25.72 25.72 25.72 mg/100 g Sauce Type 2 specific 3.483333 9.9 0.2 mg/100 g Sausage Type 2 specific 0.916667 1.9 0.15 mg/100 g Scarlet bean Type 1 specific Phaseolus coccineus 3886 0.105 0.12 0.09 mg/100 g Semolina Type 2 specific 0.02 0.02 0.02 mg/100 g Snack bar Type 2 specific 15.28 26.9 0.13 mg/100 g Soup Type 2 specific 0.5825 1.23 0.1 mg/100 g Soy bean Type 1 specific Glycine max 3847 131.4348 650.5 12.5 mg/100 g Soy milk Type 2 specific 39.602222 196.05 0.7 mg/100 g Soy sauce Type 2 specific 0.64 1.18 0.1 mg/100 g Soy yogurt Type 2 specific 24.735 33.17 16.3 mg/100 g Sweet orange Type 1 specific Citrus sinensis 2711 0.01 0.01 0.01 mg/100 g Sweet potato Type 1 specific Ipomoea batatas 4120 0.01 0.01 0.01 mg/100 g Tea Type 1 specific Camellia sinensis 4442 0.04 0.05 0.02 mg/100 g Thunnus Type 1 specific Thunnus 8234 0.09 0.09 0.09 mg/100 g Tofu Type 2 specific 29.162941 83.2 13.1 mg/100 g Vegetable juice Type 2 specific 0.01 0.01 0.01 mg/100 g Vegetarian food Type 2 specific 21.6425 118.5 3.75 mg/100 g Wheat Type 1 specific Triticum 4564 0.025 0.03 0.02 mg/100 g Wheat bread Type 2 specific 0.49 1.48 0.02 mg/100 g White lupine Type 1 specific Lupinus albus 3870 0.25 0.25 0.25 mg/100 g Yogurt Type 2 specific 24.735 33.17 16.3 mg/100 g bitter