1.0 2010-04-08 22:06:53 UTC 2025-11-18 23:00:19 UTC FDB005888 Laurenoniolide Laurenoniolide belongs to germacranolides and derivatives class of compounds. Those are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Laurenoniolide is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Laurenoniolide can be found in sweet bay, which makes laurenoniolide a potential biomarker for the consumption of this food product. C17H22O4 290.359 290.151809188 (3aR,4R,11aS)-6,10-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-4-yl acetate laurenobiolide 35001-25-3 [H]\C1=C(C)/C[C@]2([H])OC(=O)C(=C)[C@@]2([H])[C@]([H])(OC(C)=O)\C([H])=C(C)\CC1 InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h7-8,14-16H,3,5-6,9H2,1-2,4H3/b10-8+,11-7+/t14-,15+,16+/m1/s1 ORJVLIMAQARNOU-SYQXSARVSA-N belongs to the class of organic compounds known as germacranolides and derivatives. These are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Germacranolides and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Carbonyl compounds Dicarboxylic acids and derivatives Enoate esters Gamma butyrolactones Germacrane sesquiterpenoids Hydrocarbon derivatives Organic oxides Oxacyclic compounds Tetrahydrofurans Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Dicarboxylic acid or derivatives Enoate ester Gamma butyrolactone Germacrane sesquiterpenoid Germacranolide Hydrocarbon derivative Lactone Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Sesquiterpenoid Tetrahydrofuran Germacrenes logp 3.31 ALOGPS logs -3.54 ALOGPS solubility 8.33e-02 g/l ALOGPS logp 2.91 ChemAxon pka_strongest_basic -6.6 ChemAxon iupac (3aR,4R,11aS)-6,10-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,7H,8H,11H,11aH-cyclodeca[b]furan-4-yl acetate ChemAxon average_mass 290.359 ChemAxon mono_mass 290.151809188 ChemAxon smiles [H]\C1=C(C)/C[C@]2([H])OC(=O)C(=C)[C@@]2([H])[C@]([H])(OC(C)=O)\C([H])=C(C)\CC1 ChemAxon formula C17H22O4 ChemAxon inchi InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h7-8,14-16H,3,5-6,9H2,1-2,4H3/b10-8+,11-7+/t14-,15+,16+/m1/s1 ChemAxon inchikey ORJVLIMAQARNOU-SYQXSARVSA-N ChemAxon polar_surface_area 52.6 ChemAxon refractivity 80.67 ChemAxon polarizability 31.03 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 101586 Specdb::MsMs 101587 Specdb::MsMs 101588 Specdb::MsMs 167229 Specdb::MsMs 167230 Specdb::MsMs 167231 Specdb::MsMs 3602234 Specdb::MsMs 3602235 Specdb::MsMs 3602236 Specdb::MsMs 3602237 Specdb::MsMs 3602238 Specdb::MsMs 3602239 Sweet bay Type 1 specific Laurus nobilis 85223