1.0 2010-04-08 22:06:53 UTC 2025-11-18 23:00:21 UTC FDB005895 Ridentin B Ridentin b belongs to eudesmanolides, secoeudesmanolides, and derivatives class of compounds. Those are terpenoids with a structure based on the eudesmanolide (a 3,5a,9-trimethyl-naphtho[1,2-b]furan-2-one derivative) or secoeudesmanolide (a 3,6-dimethyl-5-(pentan-2-yl)-1-benzofuran-2-one derivative) skeleton. Ridentin b is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Ridentin b can be found in sweet bay, which makes ridentin b a potential biomarker for the consumption of this food product. C15H20O4 264.3169 264.136159128 6,8-dihydroxy-5a-methyl-3,9-dimethylidene-dodecahydronaphtho[1,2-b]furan-2-one 6,8-dihydroxy-5a-methyl-3,9-dimethylidene-octahydronaphtho[1,2-b]furan-2-one CC12CCC3C(OC(=O)C3=C)C1C(=C)C(O)CC2O InChI=1S/C15H20O4/c1-7-9-4-5-15(3)11(17)6-10(16)8(2)12(15)13(9)19-14(7)18/h9-13,16-17H,1-2,4-6H2,3H3 CXFAEUSGWYVIJU-UHFFFAOYSA-N belongs to the class of organic compounds known as eudesmanolides, secoeudesmanolides, and derivatives. These are terpenoids with a structure based on the eudesmanolide (a 3,5a,9-trimethyl-naphtho[1,2-b]furan-2-one derivative) or secoeudesmanolide (a 3,6-dimethyl-5-(pentan-2-yl)-1-benzofuran-2-one derivative) skeleton. Eudesmanolides, secoeudesmanolides, and derivatives Organic compounds Lipids and lipid-like molecules Prenol lipids Terpene lactones Aliphatic heteropolycyclic compounds Carbonyl compounds Cyclic alcohols and derivatives Enoate esters Gamma butyrolactones Hydrocarbon derivatives Monocarboxylic acids and derivatives Naphthofurans Organic oxides Oxacyclic compounds Secondary alcohols Sesquiterpenoids Tetrahydrofurans Alcohol Aliphatic heteropolycyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cyclic alcohol Enoate ester Eudesmanolide Gamma butyrolactone Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Naphthofuran Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Secondary alcohol Sesquiterpenoid Tetrahydrofuran logp 0.75 ALOGPS logs -1.65 ALOGPS solubility 5.95e+00 g/l ALOGPS logp 0.9 ChemAxon pka_strongest_acidic 14.26 ChemAxon pka_strongest_basic -3 ChemAxon iupac 6,8-dihydroxy-5a-methyl-3,9-dimethylidene-dodecahydronaphtho[1,2-b]furan-2-one ChemAxon average_mass 264.3169 ChemAxon mono_mass 264.136159128 ChemAxon smiles CC12CCC3C(OC(=O)C3=C)C1C(=C)C(O)CC2O ChemAxon formula C15H20O4 ChemAxon inchi InChI=1S/C15H20O4/c1-7-9-4-5-15(3)11(17)6-10(16)8(2)12(15)13(9)19-14(7)18/h9-13,16-17H,1-2,4-6H2,3H3 ChemAxon inchikey CXFAEUSGWYVIJU-UHFFFAOYSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 69.11 ChemAxon polarizability 28.14 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 72012 Specdb::MsMs 72013 Specdb::MsMs 72014 Specdb::MsMs 130803 Specdb::MsMs 130804 Specdb::MsMs 130805 Specdb::MsMs 3602246 Specdb::MsMs 3602247 Specdb::MsMs 3602248 Specdb::MsMs 3602249 Specdb::MsMs 3602250 Specdb::MsMs 3602251 Sweet bay Type 1 specific Laurus nobilis 85223