1.0 2010-04-08 22:06:57 UTC 2025-11-18 23:00:43 UTC FDB006017 Neric acid Cis-geranic acid, also known as cis-geranate, is a member of the class of compounds known as acyclic monoterpenoids. Acyclic monoterpenoids are monoterpenes that do not contain a cycle. Thus, cis-geranic acid is considered to be a fatty acid lipid molecule. Cis-geranic acid is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cis-geranic acid can be found in ginger, which makes cis-geranic acid a potential biomarker for the consumption of this food product. Neric acid Z,E-3,7-di-methyl-2,6-octadienoic acid C10H16O2 168.2328 168.115029756 (2Z)-3,7-dimethylocta-2,6-dienoic acid (2Z)-3,7-dimethylocta-2,6-dienoic acid 37349-29-4 CC(C)=CCC\C(C)=C/C(O)=O InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7- ZHYZQXUYZJNEHD-CLFYSBASSA-N belongs to the class of organic compounds known as acyclic monoterpenoids. These are monoterpenes that do not contain a cycle. Acyclic monoterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Monoterpenoids Aliphatic acyclic compounds Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Medium-chain fatty acids Methyl-branched fatty acids Monocarboxylic acids and derivatives Organic oxides Unsaturated fatty acids Acyclic monoterpenoid Aliphatic acyclic compound Branched fatty acid Carbonyl group Carboxylic acid Carboxylic acid derivative Fatty acid Fatty acyl Hydrocarbon derivative Medium-chain fatty acid Methyl-branched fatty acid Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Unsaturated fatty acid Unsaturated fatty acids logp 2.72 ALOGPS logs -2.14 ALOGPS solubility 1.22e+00 g/l ALOGPS logp 2.82 ChemAxon pka_strongest_acidic 5.26 ChemAxon iupac (2Z)-3,7-dimethylocta-2,6-dienoic acid ChemAxon average_mass 168.2328 ChemAxon mono_mass 168.115029756 ChemAxon smiles CC(C)=CCC\C(C)=C/C(O)=O ChemAxon formula C10H16O2 ChemAxon inchi InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7- ChemAxon inchikey ZHYZQXUYZJNEHD-CLFYSBASSA-N ChemAxon polar_surface_area 37.3 ChemAxon refractivity 51.05 ChemAxon polarizability 19.42 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 2 ChemAxon donor_count 1 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 80859 Specdb::MsMs 80860 Specdb::MsMs 80861 Specdb::MsMs 141831 Specdb::MsMs 141832 Specdb::MsMs 141833 Specdb::MsMs 3602420 Specdb::MsMs 3602421 Specdb::MsMs 3602422 Specdb::MsMs 3602423 Specdb::MsMs 3602424 Specdb::MsMs 3602425 Lemon balm Type 1 specific Melissa officinalis 39338