1.0 2010-04-08 22:06:57 UTC 2025-11-18 23:00:47 UTC FDB006036 Piperitone oxide Piperitone oxide is a member of the class of compounds known as oxepanes. Oxepanes are compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms. Piperitone oxide is slightly soluble (in water) and an extremely weak acidic compound (based on its pKa). Piperitone oxide can be found in cornmint, orange mint, peppermint, and spearmint, which makes piperitone oxide a potential biomarker for the consumption of these food products. 1,2-Epoxy-p-menthane-3-one 3-Isopropyl-6-methyl-7-oxabicyclo[4.1.0]heptan-2-one 6-Methyl-3-(1-methylethyl)-7-oxabicyclo(4.1.0)heptan-2-one p-Menthan-3-one, 1,2-epoxy- Piperiton epoxid Piperitone 1-oxide Piperitone oxide Piperitoneoxide Pipertone, oxide C10H16O2 168.2328 168.115029756 6-methyl-3-(propan-2-yl)-7-oxabicyclo[4.1.0]heptan-2-one 3-isopropyl-6-methyl-7-oxabicyclo[4.1.0]heptan-2-one CC(C)C1CCC2(C)OC2C1=O InChI=1S/C10H16O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h6-7,9H,4-5H2,1-3H3 IAFONZHDZMCORS-UHFFFAOYSA-N belongs to the class of organic compounds known as oxepanes. Oxepanes are compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms. Oxepanes Organic compounds Organoheterocyclic compounds Oxepanes Aliphatic heteropolycyclic compounds Dialkyl ethers Epoxides Hydrocarbon derivatives Ketones Organic oxides Oxacyclic compounds Aliphatic heteropolycyclic compound Carbonyl group Dialkyl ether Ether Hydrocarbon derivative Ketone Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Oxepane Oxirane logp 1.96 ALOGPS logs -1.93 ALOGPS solubility 1.96e+00 g/l ALOGPS logp 2.26 ChemAxon pka_strongest_acidic 19.7 ChemAxon pka_strongest_basic -4.3 ChemAxon iupac 6-methyl-3-(propan-2-yl)-7-oxabicyclo[4.1.0]heptan-2-one ChemAxon average_mass 168.2328 ChemAxon mono_mass 168.115029756 ChemAxon smiles CC(C)C1CCC2(C)OC2C1=O ChemAxon formula C10H16O2 ChemAxon inchi InChI=1S/C10H16O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h6-7,9H,4-5H2,1-3H3 ChemAxon inchikey IAFONZHDZMCORS-UHFFFAOYSA-N ChemAxon polar_surface_area 29.6 ChemAxon refractivity 45.95 ChemAxon polarizability 19.05 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 81585 Specdb::MsMs 81586 Specdb::MsMs 81587 Specdb::MsMs 142716 Specdb::MsMs 142717 Specdb::MsMs 142718 Specdb::MsMs 3602447 Specdb::MsMs 3602448 Specdb::MsMs 3602449 Specdb::MsMs 3602450 Specdb::MsMs 3602451 Specdb::MsMs 3602452 Cornmint Type 1 specific Mentha arvensis 292239 272.75 272.75 272.75 mg/100 g Orange mint Type 1 specific Mentha aquatica 190902 Peppermint Type 1 specific Mentha X piperita 34256 Spearmint Type 1 specific Mentha spicata 29719 925.25 1805.0 45.5 mg/100 g