1.0 2010-04-08 22:06:57 UTC 2019-11-26 03:00:56 UTC FDB006044 (-)-Piperitenone oxide (-)-piperitenone oxide is slightly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). (-)-piperitenone oxide can be found in cornmint, which makes (-)-piperitenone oxide a potential biomarker for the consumption of this food product. C10H14O2 166.217 166.099379692 (1S,6R)-6-methyl-3-(propan-2-ylidene)-7-oxabicyclo[4.1.0]heptan-2-one (1S,6R)-6-methyl-3-(propan-2-ylidene)-7-oxabicyclo[4.1.0]heptan-2-one CC(C)=C1CC[C@@]2(C)O[C@@H]2C1=O InChI=1S/C10H14O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h9H,4-5H2,1-3H3/t9-,10?/m1/s1 AKASWINDKIEEBO-YHMJZVADSA-N belongs to the class of organic compounds known as oxepanes. Oxepanes are compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms. Oxepanes Organic compounds Organoheterocyclic compounds Oxepanes Aliphatic heteropolycyclic compounds Dialkyl ethers Epoxides Hydrocarbon derivatives Ketones Organic oxides Oxacyclic compounds Aliphatic heteropolycyclic compound Carbonyl group Dialkyl ether Ether Hydrocarbon derivative Ketone Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Oxepane Oxirane logp 1.61 ALOGPS logs -1.27 ALOGPS solubility 8.95e+00 g/l ALOGPS logp 2.07 ChemAxon pka_strongest_basic -4.2 ChemAxon iupac (1S,6R)-6-methyl-3-(propan-2-ylidene)-7-oxabicyclo[4.1.0]heptan-2-one ChemAxon average_mass 166.217 ChemAxon mono_mass 166.099379692 ChemAxon smiles CC(C)=C1CC[C@@]2(C)O[C@@H]2C1=O ChemAxon formula C10H14O2 ChemAxon inchi InChI=1S/C10H14O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h9H,4-5H2,1-3H3/t9-,10?/m1/s1 ChemAxon inchikey AKASWINDKIEEBO-YHMJZVADSA-N ChemAxon polar_surface_area 29.6 ChemAxon refractivity 46.56 ChemAxon polarizability 18.15 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 2 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 70332 Specdb::MsMs 70333 Specdb::MsMs 70334 Specdb::MsMs 128808 Specdb::MsMs 128809 Specdb::MsMs 128810 Cornmint Type 1 specific Mentha arvensis 292239