1.0 2010-04-08 22:07:00 UTC 2025-11-18 23:01:00 UTC FDB006150 3-Phenyl-4-propylpyridine 3-phenyl-4-propylpyridine is a member of the class of compounds known as phenylpyridines. Phenylpyridines are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. 3-phenyl-4-propylpyridine is practically insoluble (in water) and a very strong basic compound (based on its pKa). 3-phenyl-4-propylpyridine can be found in peppermint, which makes 3-phenyl-4-propylpyridine a potential biomarker for the consumption of this food product. C14H15N 197.281 197.120449487 3-phenyl-4-propylpyridine 3-phenyl-4-propylpyridine CCCC1=CC=NC=C1C1=CC=CC=C1 InChI=1S/C14H15N/c1-2-6-12-9-10-15-11-14(12)13-7-4-3-5-8-13/h3-5,7-11H,2,6H2,1H3 MDEOSZGDWLTQLL-UHFFFAOYSA-N belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. Phenylpyridines Organic compounds Organoheterocyclic compounds Pyridines and derivatives Phenylpyridines Aromatic heteromonocyclic compounds Azacyclic compounds Benzene and substituted derivatives Heteroaromatic compounds Hydrocarbon derivatives Organonitrogen compounds Organopnictogen compounds 3-phenylpyridine Aromatic heteromonocyclic compound Azacycle Benzenoid Heteroaromatic compound Hydrocarbon derivative Monocyclic benzene moiety Organic nitrogen compound Organonitrogen compound Organopnictogen compound logp 3.94 ALOGPS logs -3.88 ALOGPS solubility 2.62e-02 g/l ALOGPS logp 3.81 ChemAxon pka_strongest_basic 5.43 ChemAxon iupac 3-phenyl-4-propylpyridine ChemAxon average_mass 197.281 ChemAxon mono_mass 197.120449487 ChemAxon smiles CCCC1=CC=NC=C1C1=CC=CC=C1 ChemAxon formula C14H15N ChemAxon inchi InChI=1S/C14H15N/c1-2-6-12-9-10-15-11-14(12)13-7-4-3-5-8-13/h3-5,7-11H,2,6H2,1H3 ChemAxon inchikey MDEOSZGDWLTQLL-UHFFFAOYSA-N ChemAxon polar_surface_area 12.89 ChemAxon refractivity 63.28 ChemAxon polarizability 22.97 ChemAxon rotatable_bond_count 3 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 49341 Specdb::MsMs 49342 Specdb::MsMs 49343 Specdb::MsMs 144849 Specdb::MsMs 144850 Specdb::MsMs 144851 Specdb::MsMs 3602543 Specdb::MsMs 3602544 Specdb::MsMs 3602545 Specdb::MsMs 3602546 Specdb::MsMs 3602547 Specdb::MsMs 3602548 Peppermint Type 1 specific Mentha X piperita 34256