1.0 2010-04-08 22:07:06 UTC 2025-11-18 23:01:38 UTC FDB006350 Majaronin Majoranin, also known as 5,6,4'-trihydroxy-7,8,3'-trimethoxyflavone or mucroflavone b, is a member of the class of compounds known as 8-o-methylated flavonoids. 8-o-methylated flavonoids are flavonoids with methoxy groups attached to the C8 atom of the flavonoid backbone. Thus, majoranin is considered to be a flavonoid lipid molecule. Majoranin is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Majoranin can be found in a number of food items such as peppermint, herbs and spices, mentha (mint), and fats and oils, which makes majoranin a potential biomarker for the consumption of these food products. C18H16O8 360.3148 360.084517488 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-chromen-4-one thymonin 76844-67-2 COC1=C(O)C=CC(=C1)C1=CC(=O)C2=C(O)C(O)=C(OC)C(OC)=C2O1 InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)15(22)17(24-2)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 BAIRXMVFPKLWSE-UHFFFAOYSA-N belongs to the class of organic compounds known as 8-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C8 atom of the flavonoid backbone. 8-O-methylated flavonoids Organic compounds Phenylpropanoids and polyketides Flavonoids O-methylated flavonoids Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 3'-O-methylated flavonoids 4'-hydroxyflavonoids 5-hydroxyflavonoids 6-hydroxyflavonoids 7-O-methylated flavonoids Alkyl aryl ethers Anisoles Chromones Flavones Heteroaromatic compounds Hydrocarbon derivatives Methoxybenzenes Methoxyphenols Organic oxides Oxacyclic compounds Phenoxy compounds Pyranones and derivatives Vinylogous acids 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 3p-methoxyflavonoid-skeleton 4'-hydroxyflavonoid 5-hydroxyflavonoid 6-hydroxyflavonoid 7-methoxyflavonoid-skeleton 8-methoxyflavonoid-skeleton Alkyl aryl ether Anisole Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromone Ether Flavone Heteroaromatic compound Hydrocarbon derivative Hydroxyflavonoid Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Phenol Phenol ether Phenoxy compound Pyran Pyranone Vinylogous acid Flavones and Flavonols flavones trihydroxyflavone trimethoxyflavone logp 2.69 ALOGPS logs -3.72 ALOGPS solubility 6.92e-02 g/l ALOGPS logp 2.23 ChemAxon pka_strongest_acidic 8.92 ChemAxon pka_strongest_basic -4.4 ChemAxon iupac 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-chromen-4-one ChemAxon average_mass 360.3148 ChemAxon mono_mass 360.084517488 ChemAxon smiles COC1=C(O)C=CC(=C1)C1=CC(=O)C2=C(O)C(O)=C(OC)C(OC)=C2O1 ChemAxon formula C18H16O8 ChemAxon inchi InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)15(22)17(24-2)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 ChemAxon inchikey BAIRXMVFPKLWSE-UHFFFAOYSA-N ChemAxon polar_surface_area 114.68 ChemAxon refractivity 92.3 ChemAxon polarizability 35.48 ChemAxon rotatable_bond_count 4 ChemAxon acceptor_count 8 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::CMs 22474 Specdb::CMs 45321 Specdb::CMs 146372 Specdb::MsMs 55080 Specdb::MsMs 55081 Specdb::MsMs 55082 Specdb::MsMs 152049 Specdb::MsMs 152050 Specdb::MsMs 152051 Specdb::MsMs 2693780 Specdb::MsMs 2693781 Specdb::MsMs 2984921 Specdb::MsMs 2984922 Specdb::MsMs 2984923 HMDB0037334 Sweet marjoram Type 1 specific Origanum majorana 268884