1.0 2010-04-08 22:07:07 UTC 2025-11-18 23:01:46 UTC FDB006380 1-Rhamnono-1,4-lactone 1-rhamnono-1,4-lactone is a member of the class of compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. 1-rhamnono-1,4-lactone is soluble (in water) and a very weakly acidic compound (based on its pKa). 1-rhamnono-1,4-lactone can be found in rice, which makes 1-rhamnono-1,4-lactone a potential biomarker for the consumption of this food product. C6H10O5 162.1406 162.05282343 3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-one 3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-one CC(O)C1OC(=O)C(O)C1O InChI=1S/C6H10O5/c1-2(7)5-3(8)4(9)6(10)11-5/h2-5,7-9H,1H3 VASLEPDZAKCNJX-UHFFFAOYSA-N belongs to the class of organic compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Gamma butyrolactones Organic compounds Organoheterocyclic compounds Lactones Gamma butyrolactones Aliphatic heteromonocyclic compounds Carbonyl compounds Carboxylic acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Secondary alcohols Tetrahydrofurans Alcohol Aliphatic heteromonocyclic compound Carbonyl group Carboxylic acid derivative Carboxylic acid ester Gamma butyrolactone Hydrocarbon derivative Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle Secondary alcohol Tetrahydrofuran a small molecule logp -1.62 ALOGPS logs 0.59 ALOGPS solubility 6.31e+02 g/l ALOGPS logp -1.7 ChemAxon pka_strongest_acidic 11.63 ChemAxon pka_strongest_basic -3.1 ChemAxon iupac 3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-one ChemAxon average_mass 162.1406 ChemAxon mono_mass 162.05282343 ChemAxon smiles CC(O)C1OC(=O)C(O)C1O ChemAxon formula C6H10O5 ChemAxon inchi InChI=1S/C6H10O5/c1-2(7)5-3(8)4(9)6(10)11-5/h2-5,7-9H,1H3 ChemAxon inchikey VASLEPDZAKCNJX-UHFFFAOYSA-N ChemAxon polar_surface_area 86.99 ChemAxon refractivity 33.24 ChemAxon polarizability 14.67 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 46296 Specdb::MsMs 46297 Specdb::MsMs 46298 Specdb::MsMs 131415 Specdb::MsMs 131416 Specdb::MsMs 131417 Specdb::MsMs 3602900 Specdb::MsMs 3602901 Specdb::MsMs 3602902 Specdb::MsMs 3602903 Specdb::MsMs 3602904 Specdb::MsMs 3602905 Rice Type 1 specific Oryza sativa 4530