1.0 2010-04-08 22:07:10 UTC 2025-11-18 23:02:00 UTC FDB006480 LF Leucyl-phenylalanine, also known as (2s,3s)-(2-2h,3-2h)-leucine-(S)-phenylalanine or leu-phe, is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Leucyl-phenylalanine is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Leucyl-phenylalanine can be found primarily in blood, feces, and urine. C15H22N2O3 278.3468 278.16304258 2-(2-amino-4-methylpentanamido)-3-phenylpropanoic acid leu-phe 3063-05-6 CC(C)CC(N)C(=O)NC(CC1=CC=CC=C1)C(O)=O InChI=1S/C15H22N2O3/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20) KFKWRHQBZQICHA-UHFFFAOYSA-N belongs to the class of organic compounds known as dipeptides. These are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Dipeptides Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aromatic homomonocyclic compounds Alpha amino acid amides Amino acids Amphetamines and derivatives Carbonyl compounds Carboxylic acids Hydrocarbon derivatives Leucine and derivatives Monoalkylamines Monocarboxylic acids and derivatives N-acyl amines N-acyl-alpha amino acids Organic oxides Organopnictogen compounds Phenylalanine and derivatives Phenylpropanoic acids Secondary carboxylic acid amides 3-phenylpropanoic-acid Alpha-amino acid amide Alpha-amino acid or derivatives Alpha-dipeptide Amine Amino acid Amino acid or derivatives Amphetamine or derivatives Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxamide group Carboxylic acid Fatty acyl Fatty amide Hydrocarbon derivative Leucine or derivatives Monocarboxylic acid or derivatives Monocyclic benzene moiety N-acyl-alpha amino acid or derivatives N-acyl-alpha-amino acid N-acyl-amine Organic nitrogen compound Organic oxide Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Phenylalanine or derivatives Primary aliphatic amine Primary amine Secondary carboxylic acid amide logp -0.62 ALOGPS logs -3.13 ALOGPS solubility 2.08e-01 g/l ALOGPS logp -0.47 ChemAxon pka_strongest_acidic 3.95 ChemAxon pka_strongest_basic 8.43 ChemAxon iupac 2-(2-amino-4-methylpentanamido)-3-phenylpropanoic acid ChemAxon average_mass 278.3468 ChemAxon mono_mass 278.16304258 ChemAxon smiles CC(C)CC(N)C(=O)NC(CC1=CC=CC=C1)C(O)=O ChemAxon formula C15H22N2O3 ChemAxon inchi InChI=1S/C15H22N2O3/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20) ChemAxon inchikey KFKWRHQBZQICHA-UHFFFAOYSA-N ChemAxon polar_surface_area 92.42 ChemAxon refractivity 76.09 ChemAxon polarizability 30.45 ChemAxon rotatable_bond_count 7 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 76710 Specdb::MsMs 76711 Specdb::MsMs 76712 Specdb::MsMs 136614 Specdb::MsMs 136615 Specdb::MsMs 136616 Specdb::MsMs 3602990 Specdb::MsMs 3602991 Specdb::MsMs 3602992 Specdb::MsMs 3602993 Specdb::MsMs 3602994 Specdb::MsMs 3602995 Specdb::CMs 15304 Specdb::CMs 40093 HMDB0013243 Parsley Type 1 specific Petroselinum crispum 4043