1.0 2010-04-08 22:07:10 UTC 2025-11-18 23:02:03 UTC FDB006508 Phaseollin isoflavone Glabrone, also known as eurycarpin b or morusin hydroperoxide, is a member of the class of compounds known as pyranoisoflavonoids. Pyranoisoflavonoids are isoflavonoids that contain a pyran ring fused to either of the A, B, or C ring of the isoflavonoid skeleton. Thus, glabrone is considered to be a flavonoid lipid molecule. Glabrone is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Glabrone can be found in common bean and scarlet bean, which makes glabrone a potential biomarker for the consumption of these food products. C20H16O5 336.338 336.099773622 6-[(3R)-7-hydroxy-3,4-dihydro-2H-1-benzopyran-3-yl]-2,2-dimethyl-2H-chromen-5-ol phaseollinisoflavan CC1(C)OC2=C(C=C1)C(O)=C(C=C2)C1=COC2=C(C=CC(O)=C2)C1=O InChI=1S/C20H16O5/c1-20(2)8-7-14-16(25-20)6-5-12(18(14)22)15-10-24-17-9-11(21)3-4-13(17)19(15)23/h3-10,21-22H,1-2H3 COLMVFWKLOZOOP-UHFFFAOYSA-N belongs to the class of organic compounds known as pyranoisoflavonoids. These are isoflavonoids that contain a pyran ring fused to either of the A, B, or C ring of the isoflavonoid skeleton. Pyranoisoflavonoids Organic compounds Phenylpropanoids and polyketides Isoflavonoids Pyranoisoflavonoids Aromatic heteropolycyclic compounds 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 2,2-dimethyl-1-benzopyrans Alkyl aryl ethers Hydrocarbon derivatives Hydroxyisoflavonoids Isoflavanols Oxacyclic compounds 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 2,2-dimethyl-1-benzopyran Alkyl aryl ether Aromatic heteropolycyclic compound Benzenoid Benzopyran Chromane Ether Hydrocarbon derivative Hydroxyisoflavonoid Isoflavan Isoflavanol Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Pyranoisoflavonoid Isoflavanes Isoflavans hydroxyisoflavans isoflavans logp 4.09 ChemAxon pka_strongest_acidic 9.44 ChemAxon pka_strongest_basic -4.6 ChemAxon iupac 6-[(3R)-7-hydroxy-3,4-dihydro-2H-1-benzopyran-3-yl]-2,2-dimethyl-2H-chromen-5-ol ChemAxon average_mass 336.338 ChemAxon mono_mass 336.099773622 ChemAxon smiles CC1(C)OC2=C(C=C1)C(O)=C(C=C2)C1=COC2=C(C=CC(O)=C2)C1=O ChemAxon formula C20H16O5 ChemAxon inchi InChI=1S/C20H16O5/c1-20(2)8-7-14-16(25-20)6-5-12(18(14)22)15-10-24-17-9-11(21)3-4-13(17)19(15)23/h3-10,21-22H,1-2H3 ChemAxon inchikey COLMVFWKLOZOOP-UHFFFAOYSA-N ChemAxon polar_surface_area 58.92 ChemAxon refractivity 93.35 ChemAxon polarizability 35.94 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1219489 Specdb::MsMs 1219490 Specdb::MsMs 1219491 Specdb::MsMs 1335193 Specdb::MsMs 1335194 Specdb::MsMs 1335195 Common bean Type 1 specific Phaseolus vulgaris 3885 Scarlet bean Type 1 specific Phaseolus coccineus 3886