1.0 2010-04-08 22:07:12 UTC 2025-11-18 23:02:09 UTC FDB006553 Baikiain Baikiain, also known as 4,5-dehydropipecolic acid, (+-)-isomer, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Baikiain is soluble (in water) and a moderately acidic compound (based on its pKa). Baikiain can be found in date, which makes baikiain a potential biomarker for the consumption of this food product. C6H9NO2 127.1412 127.063328537 1,2,3,6-tetrahydropyridine-2-carboxylic acid 1,2,3,6-tetrahydropyridine-2-carboxylic acid OC(=O)C1CC=CCN1 InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h1-2,5,7H,3-4H2,(H,8,9) YCQPUTODZKESPK-UHFFFAOYSA-N belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Alpha amino acids Organic compounds Organic acids and derivatives Carboxylic acids and derivatives Amino acids, peptides, and analogues Aliphatic heteromonocyclic compounds Amino acids Azacyclic compounds Carbonyl compounds Carboxylic acids Dialkylamines Hydrocarbon derivatives Hydropyridines Monocarboxylic acids and derivatives Organic oxides Organopnictogen compounds Aliphatic heteromonocyclic compound Alpha-amino acid Amine Amino acid Azacycle Carbonyl group Carboxylic acid Hydrocarbon derivative Hydropyridine Monocarboxylic acid or derivatives Organic nitrogen compound Organic oxide Organic oxygen compound Organoheterocyclic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Secondary aliphatic amine Secondary amine logp -1.96 ALOGPS logs 0.06 ALOGPS solubility 1.46e+02 g/l ALOGPS logp -2.3 ChemAxon pka_strongest_acidic 1.96 ChemAxon pka_strongest_basic 9.92 ChemAxon iupac 1,2,3,6-tetrahydropyridine-2-carboxylic acid ChemAxon average_mass 127.1412 ChemAxon mono_mass 127.063328537 ChemAxon smiles OC(=O)C1CC=CCN1 ChemAxon formula C6H9NO2 ChemAxon inchi InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h1-2,5,7H,3-4H2,(H,8,9) ChemAxon inchikey YCQPUTODZKESPK-UHFFFAOYSA-N ChemAxon polar_surface_area 49.33 ChemAxon refractivity 33.63 ChemAxon polarizability 12.66 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 3 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 48681 Specdb::MsMs 48682 Specdb::MsMs 48683 Specdb::MsMs 114564 Specdb::MsMs 114565 Specdb::MsMs 114566 Specdb::MsMs 3603068 Specdb::MsMs 3603069 Specdb::MsMs 3603070 Specdb::MsMs 3603071 Specdb::MsMs 3603072 Specdb::MsMs 3603073 Date Type 1 specific Phoenix dactylifera 42345