1.0 2010-04-08 22:07:12 UTC 2025-11-18 23:02:15 UTC FDB006576 beta-Himachalene Beta-himachalene is a member of the class of compounds known as himachalane and lippifoliane sesquiterpenoids. Himachalane and lippifoliane sesquiterpenoids are diterpenoids with a structure based on either the himachalane or the lippifoliane skeleton. Thus, beta-himachalene is considered to be an isoprenoid lipid molecule. Beta-himachalene can be found in anise and ginger, which makes beta-himachalene a potential biomarker for the consumption of these food products. (6xi)-himachal-1(11),4-diene β-himachalene beta-Himachalene Himachalene C15H24 204.3511 204.187800768 3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzo[7]annulene β-himachalene CC1=CC2C(CC1)=C(C)CCCC2(C)C InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3 LCOSCMLXPAQCLQ-UHFFFAOYSA-N belongs to the class of organic compounds known as himachalane and lippifoliane sesquiterpenoids. These are sesquiterpenoids with a structure based on either the himachalane or the lippifoliane skeleton. Himachalane and lippifoliane sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homopolycyclic compounds Branched unsaturated hydrocarbons Cyclic olefins Polycyclic hydrocarbons Unsaturated aliphatic hydrocarbons Aliphatic homopolycyclic compound Branched unsaturated hydrocarbon Cyclic olefin Himachalane sesquiterpenoid Hydrocarbon Olefin Polycyclic hydrocarbon Unsaturated aliphatic hydrocarbon Unsaturated hydrocarbon Lippifoliane and himachalane sesquiterpenoids a sesquiterpenoid himachalene logp 5.63 ALOGPS logs -3.84 ALOGPS solubility 2.93e-02 g/l ALOGPS logp 4.42 ChemAxon iupac 3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1H-benzo[7]annulene ChemAxon average_mass 204.3511 ChemAxon mono_mass 204.187800768 ChemAxon smiles CC1=CC2C(CC1)=C(C)CCCC2(C)C ChemAxon formula C15H24 ChemAxon inchi InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3 ChemAxon inchikey LCOSCMLXPAQCLQ-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 68.26 ChemAxon polarizability 26 ChemAxon rotatable_bond_count 0 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 105711 Specdb::MsMs 105712 Specdb::MsMs 105713 Specdb::MsMs 172263 Specdb::MsMs 172264 Specdb::MsMs 172265 Specdb::MsMs 3603107 Specdb::MsMs 3603108 Specdb::MsMs 3603109 Specdb::MsMs 3603110 Specdb::MsMs 3603111 Specdb::MsMs 3603112 49210 Anise Type 1 specific Pimpinella anisum 271192 Ginger Type 1 specific Zingiber officinale 94328