1.0 2010-04-08 22:07:14 UTC 2025-11-18 23:02:26 UTC FDB006635 m-Methyl acetophenone M-methyl acetophenone is soluble (in water) and a weakly acidic compound (based on its pKa). M-methyl acetophenone can be found in pepper (spice), which makes M-methyl acetophenone a potential biomarker for the consumption of this food product. 1-(3-methylphenyl)-Ethanone 1-(3-Methylphenyl)ethanone 3-Methylacetophenone 3'-Methylacetophenone Acetophenone, 3'-methyl- Acetophenone, 3'-methyl- (8CI) Acetophenone, m-methyl- Ethanone, 1-(3-methylphenyl)- Ethanone, 1-(3-methylphenyl)- (9CI) M-methylacetophenone Methyl m-tolyl ketone C8H9AsNNaO4 281.0727 280.964523873 sodium hydrogen (3-acetamidophenyl)arsonate sodium hydrogen 3-acetamidophenylarsonate [Na+].CC(=O)NC1=CC=CC(=C1)[As](O)([O-])=O InChI=1S/C8H10AsNO4.Na/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)14;/h2-5H,1H3,(H,10,11)(H2,12,13,14);/q;+1/p-1 ZJJFOTCYYMAOMX-UHFFFAOYSA-M belongs to the class of organic compounds known as acetanilides. These are organic compounds containing an acetamide group conjugated to a phenyl group. Acetanilides Organic compounds Benzenoids Benzene and substituted derivatives Anilides Aromatic homomonocyclic compounds Acetamides Carbonyl compounds Hydrocarbon derivatives N-acetylarylamines Organic metalloid salts Organic oxides Organic sodium salts Organopnictogen compounds Oxygen-containing organoarsenic compounds Pentaorganoarsanes Secondary carboxylic acid amides Acetamide Acetanilide Aromatic homomonocyclic compound Carbonyl group Carboxamide group Carboxylic acid derivative Hydrocarbon derivative N-acetylarylamine N-arylamide Organic alkali metal salt Organic metalloid salt Organic nitrogen compound Organic oxide Organic oxygen compound Organic salt Organic sodium salt Organoarsenic compound Organonitrogen compound Organooxygen compound Organopnictogen compound Oxygen-containing organoarsenic compound Pentaorganoarsane Secondary carboxylic acid amide logp 0.33 ALOGPS logs -1.32 ALOGPS solubility 1.34e+01 g/l ALOGPS logp 0.25 ChemAxon pka_strongest_acidic 3.37 ChemAxon pka_strongest_basic -4.4 ChemAxon iupac sodium hydrogen (3-acetamidophenyl)arsonate ChemAxon average_mass 281.0727 ChemAxon mono_mass 280.964523873 ChemAxon smiles [Na+].CC(=O)NC1=CC=CC(=C1)[As](O)([O-])=O ChemAxon formula C8H9AsNNaO4 ChemAxon inchi InChI=1S/C8H10AsNO4.Na/c1-6(11)10-8-4-2-3-7(5-8)9(12,13)14;/h2-5H,1H3,(H,10,11)(H2,12,13,14);/q;+1/p-1 ChemAxon inchikey ZJJFOTCYYMAOMX-UHFFFAOYSA-M ChemAxon polar_surface_area 89.46 ChemAxon refractivity 45.79 ChemAxon polarizability 20.24 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge -1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 1301743 Specdb::MsMs 1301744 Specdb::MsMs 1301745 Specdb::MsMs 1416325 Specdb::MsMs 1416326 Specdb::MsMs 1416327 Pepper (Spice) Type 1 specific Piper nigrum 13216