1.0 2010-04-08 22:07:16 UTC 2025-11-18 23:02:41 UTC FDB006735 Luteic acid Luteic acid, also known as luteate, is a member of the class of compounds known as hydrolyzable tannins. Hydrolyzable tannins are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Luteic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Luteic acid can be found in guava, which makes luteic acid a potential biomarker for the consumption of this food product. Luteic acid is a natural phenol found in numerous fruits. It is a monolactonized tergalloyl group. Maximilian Nierenstein showed in 1945 that luteic acid was a molecule present in the myrobalanitannin, a tannin found in the fruit of Terminalia chebula and is an intermediary compound in the synthesis of ellagic acid. It can form from hexahydroxydiphenic acid. It is also present in the structure of the tannins alnusiin and bicornin . C14H8O9 320.2079 320.016831854 3,4,8,9,10-pentahydroxy-6-oxo-6H-benzo[c]chromene-1-carboxylic acid 3,4,8,9,10-pentahydroxy-6-oxobenzo[c]chromene-1-carboxylic acid OC(=O)C1=CC(O)=C(O)C2=C1C1=C(O)C(O)=C(O)C=C1C(=O)O2 InChI=1S/C14H8O9/c15-5-2-4-7(11(19)9(5)17)8-3(13(20)21)1-6(16)10(18)12(8)23-14(4)22/h1-2,15-19H,(H,20,21) FLZGFQFYDGHWLR-UHFFFAOYSA-N belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. Hydrolyzable tannins Organic compounds Phenylpropanoids and polyketides Tannins Hydrolyzable tannins Aromatic heteropolycyclic compounds 1-benzopyrans 1-hydroxy-2-unsubstituted benzenoids 1-hydroxy-4-unsubstituted benzenoids 2-benzopyrans 7,8-dihydroxycoumarins Carboxylic acids Gallic acid and derivatives Heteroaromatic compounds Hydrocarbon derivatives Isocoumarins and derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds Polyols Pyranones and derivatives 1-benzopyran 1-hydroxy-2-unsubstituted benzenoid 1-hydroxy-4-unsubstituted benzenoid 2-benzopyran 7,8-dihydroxycoumarin Aromatic heteropolycyclic compound Benzenoid Benzopyran Carboxylic acid Carboxylic acid derivative Coumarin Dihydroxybenzoic acid Gallic acid or derivatives Heteroaromatic compound Hydrocarbon derivative Hydrolyzable tannin Hydroxybenzoic acid Isocoumarin Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organoheterocyclic compound Organooxygen compound Oxacycle Polyol Pyran Pyranone logp 1.97 ALOGPS logs -2.75 ALOGPS solubility 5.74e-01 g/l ALOGPS logp 1.72 ChemAxon pka_strongest_acidic 3.45 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac 3,4,8,9,10-pentahydroxy-6-oxo-6H-benzo[c]chromene-1-carboxylic acid ChemAxon average_mass 320.2079 ChemAxon mono_mass 320.016831854 ChemAxon smiles OC(=O)C1=CC(O)=C(O)C2=C1C1=C(O)C(O)=C(O)C=C1C(=O)O2 ChemAxon formula C14H8O9 ChemAxon inchi InChI=1S/C14H8O9/c15-5-2-4-7(11(19)9(5)17)8-3(13(20)21)1-6(16)10(18)12(8)23-14(4)22/h1-2,15-19H,(H,20,21) ChemAxon inchikey FLZGFQFYDGHWLR-UHFFFAOYSA-N ChemAxon polar_surface_area 164.75 ChemAxon refractivity 74.1 ChemAxon polarizability 27.86 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 8 ChemAxon donor_count 6 ChemAxon physiological_charge -2 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 72510 Specdb::MsMs 72511 Specdb::MsMs 72512 Specdb::MsMs 131460 Specdb::MsMs 131461 Specdb::MsMs 131462 Specdb::MsMs 2832489 Specdb::MsMs 2832490 Specdb::MsMs 2832491 Specdb::MsMs 2850445 Specdb::MsMs 2850446 Specdb::MsMs 2850447 Specdb::CMs 51889 Specdb::CMs 61526 Specdb::CMs 147377 Specdb::CMs 147379 Specdb::CMs 147382 Specdb::CMs 147384 Specdb::CMs 147386 Specdb::CMs 147388 Specdb::CMs 147390 Specdb::CMs 148138 Specdb::CMs 279608 Guava Type 1 specific Psidium guajava 120290