1.0 2010-04-08 22:07:19 UTC 2025-11-18 23:02:52 UTC FDB006810 Sedridine Sedridine is a member of the class of compounds known as piperidines. Piperidines are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. Sedridine is soluble (in water) and an extremely weak acidic compound (based on its pKa). Sedridine can be found in pomegranate, which makes sedridine a potential biomarker for the consumption of this food product. (+-)-sedridine (R*,R*)-(+-)-alpha-Methyl-2-piperidineethanol 2-Piperidineethanol, alpha-methyl-, (R*,R*)-(+-)- Sedridine, (+-)- Sedridine, (+-)- (8CI) C8H17NO 143.2267 143.131014171 (2R)-1-[(2R)-piperidin-2-yl]propan-2-ol (2R)-1-[(2R)-piperidin-2-yl]propan-2-ol C[C@@H](O)C[C@H]1CCCCN1 InChI=1S/C8H17NO/c1-7(10)6-8-4-2-3-5-9-8/h7-10H,2-6H2,1H3/t7-,8-/m1/s1 GFKFBLJVPWRDEL-HTQZYQBOSA-N belongs to the class of organic compounds known as piperidines. Piperidines are compounds containing a piperidine ring, which is a saturated aliphatic six-member ring with one nitrogen atom and five carbon atoms. Piperidines Organic compounds Organoheterocyclic compounds Piperidines Aliphatic heteromonocyclic compounds 1,3-aminoalcohols Azacyclic compounds Dialkylamines Hydrocarbon derivatives Organopnictogen compounds Secondary alcohols 1,3-aminoalcohol Alcohol Aliphatic heteromonocyclic compound Amine Azacycle Hydrocarbon derivative Organic nitrogen compound Organic oxygen compound Organonitrogen compound Organooxygen compound Organopnictogen compound Piperidine Secondary alcohol Secondary aliphatic amine Secondary amine logp 0.83 ALOGPS logs -0.40 ALOGPS solubility 5.72e+01 g/l ALOGPS logp 0.5 ChemAxon pka_strongest_acidic 15.61 ChemAxon pka_strongest_basic 10.06 ChemAxon iupac (2R)-1-[(2R)-piperidin-2-yl]propan-2-ol ChemAxon average_mass 143.2267 ChemAxon mono_mass 143.131014171 ChemAxon smiles C[C@@H](O)C[C@H]1CCCCN1 ChemAxon formula C8H17NO ChemAxon inchi InChI=1S/C8H17NO/c1-7(10)6-8-4-2-3-5-9-8/h7-10H,2-6H2,1H3/t7-,8-/m1/s1 ChemAxon inchikey GFKFBLJVPWRDEL-HTQZYQBOSA-N ChemAxon polar_surface_area 32.26 ChemAxon refractivity 42.08 ChemAxon polarizability 17.3 ChemAxon rotatable_bond_count 2 ChemAxon acceptor_count 2 ChemAxon donor_count 2 ChemAxon physiological_charge 1 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 95397 Specdb::MsMs 95398 Specdb::MsMs 95399 Specdb::MsMs 159654 Specdb::MsMs 159655 Specdb::MsMs 159656 Specdb::MsMs 3603353 Specdb::MsMs 3603354 Specdb::MsMs 3603355 Specdb::MsMs 3603356 Specdb::MsMs 3603357 Specdb::MsMs 3603358 Pomegranate Type 1 specific Punica granatum 22663