1.0 2010-04-08 22:07:22 UTC 2025-11-18 23:03:13 UTC FDB006953 2-Hexen-4-olide 2-Hexen-4-olide is a member of the class of compounds known as butenolides. Butenolides are dihydrofurans with a carbonyl group at the C2 carbon atom. 2-hexen-4-olide is soluble (in water) and a very weakly acidic compound (based on its pKa). 2-hexen-4-olide is a spice tasting compound found in red raspberry, which makes 2-hexen-4-olide a potential biomarker for the consumption of this food product. 2-Hexen-1,4-lactone 4-Hydroxy-2-hexenoic acid gamma-lactone 4-Hydroxy-2-hexenoic acid lactone 4-Hydroxyhex-2-enoic acid lactone 5-Ethyl-(5H)-furan-2-one 5-Ethyl-2(5H)-furanone 5-Ethyl-5H-furan-2-one 5-Ethylfuran-2(5H)-one C6H8O2 112.1265 112.0524295 5-ethyl-2,5-dihydrofuran-2-one 5-ethyl-5H-furan-2-one 2407-43-4 CCC1OC(=O)C=C1 InChI=1S/C6H8O2/c1-2-5-3-4-6(7)8-5/h3-5H,2H2,1H3 GOUILHYTHSOMQJ-UHFFFAOYSA-N belongs to the class of organic compounds known as butenolides. These are dihydrofurans with a carbonyl group at the C2 carbon atom. Butenolides Organic compounds Organoheterocyclic compounds Dihydrofurans Furanones Aliphatic heteromonocyclic compounds Carbonyl compounds Enoate esters Hydrocarbon derivatives Lactones Monocarboxylic acids and derivatives Organic oxides Oxacyclic compounds 2-furanone Aliphatic heteromonocyclic compound Alpha,beta-unsaturated carboxylic ester Carbonyl group Carboxylic acid derivative Carboxylic acid ester Enoate ester Hydrocarbon derivative Lactone Monocarboxylic acid or derivatives Organic oxide Organic oxygen compound Organooxygen compound Oxacycle logp 1.33 ALOGPS logs -0.66 ALOGPS solubility 2.48e+01 g/l ALOGPS logp 1.48 ChemAxon pka_strongest_acidic 8.21 ChemAxon pka_strongest_basic -6.8 ChemAxon iupac 5-ethyl-2,5-dihydrofuran-2-one ChemAxon average_mass 112.1265 ChemAxon mono_mass 112.0524295 ChemAxon smiles CCC1OC(=O)C=C1 ChemAxon formula C6H8O2 ChemAxon inchi InChI=1S/C6H8O2/c1-2-5-3-4-6(7)8-5/h3-5H,2H2,1H3 ChemAxon inchikey GOUILHYTHSOMQJ-UHFFFAOYSA-N ChemAxon polar_surface_area 26.3 ChemAxon refractivity 30.19 ChemAxon polarizability 11.43 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 58281 Specdb::MsMs 58282 Specdb::MsMs 58283 Specdb::MsMs 114180 Specdb::MsMs 114181 Specdb::MsMs 114182 Specdb::MsMs 3603494 Specdb::MsMs 3603495 Specdb::MsMs 3603496 Specdb::MsMs 3603497 Specdb::MsMs 3603498 Specdb::MsMs 3603499 Asparagus Type 1 specific Asparagus officinalis 4686 Red raspberry Type 1 specific Rubus idaeus 32247 spice