1.0 2010-04-08 22:07:24 UTC 2025-11-18 23:03:23 UTC FDB007011 Selin-11-en-4-ol Selin-11-en-4-ol is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Selin-11-en-4-ol can be found in common oregano and common sage, which makes selin-11-en-4-ol a potential biomarker for the consumption of these food products. 11-Selinene-4-ol Eudesm-11-en-4-ol C15H26O 222.3663 222.198365454 (1R)-1,4a-dimethyl-7-(prop-1-en-2-yl)-decahydronaphthalen-1-ol (1R)-1,4a-dimethyl-7-(prop-1-en-2-yl)-octahydronaphthalen-1-ol CC(=C)C1CCC2(C)CCC[C@@](C)(O)C2C1 InChI=1S/C15H26O/c1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h12-13,16H,1,5-10H2,2-4H3/t12?,13?,14?,15-/m1/s1 DPQYOKVMVCQHMY-MLGYPOCJSA-N belongs to the class of organic compounds known as eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids. These are sesquiterpenoids with a structure based on the eudesmane skeleton. Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids Organic compounds Lipids and lipid-like molecules Prenol lipids Sesquiterpenoids Aliphatic homopolycyclic compounds Cyclic alcohols and derivatives Hydrocarbon derivatives Tertiary alcohols Alcohol Aliphatic homopolycyclic compound Cyclic alcohol Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoid Hydrocarbon derivative Organic oxygen compound Organooxygen compound Tertiary alcohol logp 4.04 ALOGPS logs -4.40 ALOGPS solubility 8.79e-03 g/l ALOGPS logp 3.61 ChemAxon pka_strongest_basic -0.46 ChemAxon iupac (1R)-1,4a-dimethyl-7-(prop-1-en-2-yl)-decahydronaphthalen-1-ol ChemAxon average_mass 222.3663 ChemAxon mono_mass 222.198365454 ChemAxon smiles CC(=C)C1CCC2(C)CCC[C@@](C)(O)C2C1 ChemAxon formula C15H26O ChemAxon inchi InChI=1S/C15H26O/c1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h12-13,16H,1,5-10H2,2-4H3/t12?,13?,14?,15-/m1/s1 ChemAxon inchikey DPQYOKVMVCQHMY-MLGYPOCJSA-N ChemAxon polar_surface_area 20.23 ChemAxon refractivity 68.28 ChemAxon polarizability 27.44 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 1 ChemAxon donor_count 1 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 86244 Specdb::MsMs 86245 Specdb::MsMs 86246 Specdb::MsMs 148503 Specdb::MsMs 148504 Specdb::MsMs 148505 Specdb::MsMs 3603554 Specdb::MsMs 3603555 Specdb::MsMs 3603556 Specdb::MsMs 3603557 Specdb::MsMs 3603558 Specdb::MsMs 3603559 Common oregano Type 1 specific Origanum vulgare 39352 Common sage Type 1 specific Salvia officinalis 38868