1.0 2010-04-08 22:07:42 UTC 2025-11-18 23:05:06 UTC FDB007615 1,3-Dimethyl-4-ethylbenzene 1,3-dimethyl-4-ethylbenzene is a member of the class of compounds known as M-xylenes. M-xylenes are aromatic compounds that contain a m-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 3-positions. 1,3-dimethyl-4-ethylbenzene can be found in corn, which makes 1,3-dimethyl-4-ethylbenzene a potential biomarker for the consumption of this food product. 1,3-Dimethyl-4-ethylbenzene 4-ethyl-1,3-dimethylbenzene C10H14 134.2182 134.109550448 1-ethyl-2,4-dimethylbenzene 1,3-dimethyl-4-ethylbenzene CCC1=C(C)C=C(C)C=C1 InChI=1S/C10H14/c1-4-10-6-5-8(2)7-9(10)3/h5-7H,4H2,1-3H3 MEMBJMDZWKVOTB-UHFFFAOYSA-N belongs to the class of organic compounds known as m-xylenes. These are aromatic compounds that contain a m-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 3-positions. m-Xylenes Organic compounds Benzenoids Benzene and substituted derivatives Xylenes Aromatic homomonocyclic compounds Aromatic hydrocarbons Unsaturated hydrocarbons Aromatic homomonocyclic compound Aromatic hydrocarbon Hydrocarbon M-xylene Unsaturated hydrocarbon liquid logp 4.32 ALOGPS logs -3.84 ALOGPS solubility 1.95e-02 g/l ALOGPS melting_point -62.9 oC logp 3.96 ChemAxon iupac 1-ethyl-2,4-dimethylbenzene ChemAxon average_mass 134.2182 ChemAxon mono_mass 134.109550448 ChemAxon smiles CCC1=C(C)C=C(C)C=C1 ChemAxon formula C10H14 ChemAxon inchi InChI=1S/C10H14/c1-4-10-6-5-8(2)7-9(10)3/h5-7H,4H2,1-3H3 ChemAxon inchikey MEMBJMDZWKVOTB-UHFFFAOYSA-N ChemAxon polar_surface_area 0 ChemAxon refractivity 45.78 ChemAxon polarizability 17.05 ChemAxon rotatable_bond_count 1 ChemAxon acceptor_count 0 ChemAxon donor_count 0 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 102549 Specdb::MsMs 102550 Specdb::MsMs 102551 Specdb::MsMs 168390 Specdb::MsMs 168391 Specdb::MsMs 168392 Specdb::MsMs 3604175 Specdb::MsMs 3604176 Specdb::MsMs 3604177 Specdb::MsMs 3604178 Specdb::MsMs 3604179 Specdb::MsMs 3604180 Corn Type 1 specific Zea mays 4577