1.0 2010-04-08 22:07:42 UTC 2025-11-18 23:05:06 UTC FDB007616 (S)-(+)-1-(p-Hydroxy-trans-cinnamoyl)-glycerol (s)-(+)-1-(p-hydroxy-trans-cinnamoyl)-glycerol is a member of the class of compounds known as coumaric acid esters. Coumaric acid esters are aromatic compounds containing an ester derivative of coumaric acid (s)-(+)-1-(p-hydroxy-trans-cinnamoyl)-glycerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). (s)-(+)-1-(p-hydroxy-trans-cinnamoyl)-glycerol can be found in corn, which makes (s)-(+)-1-(p-hydroxy-trans-cinnamoyl)-glycerol a potential biomarker for the consumption of this food product. 1-P-HYDROXY-TRANS-CINNAMOYL)-GLYCEROL C12H14O5 238.2366 238.084123558 2,3-dihydroxypropyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate 2,3-dihydroxypropyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate [H]C(O)(CO)COC(=O)\C=C\C1=CC=C(O)C=C1 InChI=1S/C12H14O5/c13-7-11(15)8-17-12(16)6-3-9-1-4-10(14)5-2-9/h1-6,11,13-15H,7-8H2/b6-3+ YUQSZTOOHLGKGG-ZZXKWVIFSA-N belongs to the class of organic compounds known as coumaric acid esters. These are aromatic compounds containing an ester derivative of coumaric acid. Coumaric acid esters Organic compounds Phenylpropanoids and polyketides Cinnamic acids and derivatives Hydroxycinnamic acids and derivatives Aromatic homomonocyclic compounds 1,2-diols 1-hydroxy-2-unsubstituted benzenoids 1-monoacylglycerols Carbonyl compounds Cinnamic acid esters Coumaric acids and derivatives Enoate esters Fatty acid esters Hydrocarbon derivatives Monocarboxylic acids and derivatives Organic oxides Primary alcohols Secondary alcohols Styrenes 1,2-diol 1-acyl-sn-glycerol 1-hydroxy-2-unsubstituted benzenoid Alcohol Alpha,beta-unsaturated carboxylic ester Aromatic homomonocyclic compound Benzenoid Carbonyl group Carboxylic acid derivative Carboxylic acid ester Cinnamic acid ester Coumaric acid ester Coumaric acid or derivatives Enoate ester Fatty acid ester Fatty acyl Glycerolipid Hydrocarbon derivative Monoacylglycerol Monocarboxylic acid or derivatives Monocyclic benzene moiety Monoradylglycerol Organic oxide Organic oxygen compound Organooxygen compound Phenol Primary alcohol Secondary alcohol Styrene logp 0.51 ALOGPS logs -2.41 ALOGPS solubility 9.23e-01 g/l ALOGPS logp 0.89 ChemAxon pka_strongest_acidic 9.4 ChemAxon pka_strongest_basic -3 ChemAxon iupac 2,3-dihydroxypropyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate ChemAxon average_mass 238.2366 ChemAxon mono_mass 238.084123558 ChemAxon smiles [H]C(O)(CO)COC(=O)\C=C\C1=CC=C(O)C=C1 ChemAxon formula C12H14O5 ChemAxon inchi InChI=1S/C12H14O5/c13-7-11(15)8-17-12(16)6-3-9-1-4-10(14)5-2-9/h1-6,11,13-15H,7-8H2/b6-3+ ChemAxon inchikey YUQSZTOOHLGKGG-ZZXKWVIFSA-N ChemAxon polar_surface_area 86.99 ChemAxon refractivity 62.06 ChemAxon polarizability 24.38 ChemAxon rotatable_bond_count 6 ChemAxon acceptor_count 4 ChemAxon donor_count 3 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 66084 Specdb::MsMs 66085 Specdb::MsMs 66086 Specdb::MsMs 123555 Specdb::MsMs 123556 Specdb::MsMs 123557 Specdb::MsMs 3604181 Specdb::MsMs 3604182 Specdb::MsMs 3604183 Specdb::MsMs 3604184 Specdb::MsMs 3604185 Specdb::MsMs 3604186 Corn Type 1 specific Zea mays 4577 4.5 4.5 4.5 mg/100 g