1.0 2010-04-08 22:07:44 UTC 2025-11-18 23:05:17 UTC FDB007715 10-Dehydrogingerdione 10-dehydrogingerdione is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. 10-dehydrogingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 10-dehydrogingerdione can be found in ginger, which makes 10-dehydrogingerdione a potential biomarker for the consumption of this food product. C21H30O4 346.4605 346.214409448 (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradeca-1,3-dien-5-one (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradeca-1,3-dien-5-one CCCCCCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 InChI=1S/C21H30O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h11-16,23-24H,3-10H2,1-2H3/b13-11-,19-16- NILVTWAPVHQVPS-PBYGQCEKSA-N belongs to the class of organic compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Methoxyphenols Organic compounds Benzenoids Phenols Methoxyphenols Aromatic homomonocyclic compounds 1-hydroxy-2-unsubstituted benzenoids Acryloyl compounds Alkyl aryl ethers Anisoles Enols Enones Hydrocarbon derivatives Ketones Methoxybenzenes Organic oxides Phenoxy compounds Styrenes Vinylogous acids 1-hydroxy-2-unsubstituted benzenoid Acryloyl-group Alkyl aryl ether Alpha,beta-unsaturated ketone Anisole Aromatic homomonocyclic compound Carbonyl group Enol Enone Ether Hydrocarbon derivative Ketone Methoxybenzene Methoxyphenol Monocyclic benzene moiety Organic oxide Organic oxygen compound Organooxygen compound Phenol ether Phenoxy compound Styrene Vinylogous acid logp 5.21 ALOGPS logs -5.01 ALOGPS solubility 3.37e-03 g/l ALOGPS logp 5.67 ChemAxon pka_strongest_acidic 8.42 ChemAxon pka_strongest_basic -4.8 ChemAxon iupac (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradeca-1,3-dien-5-one ChemAxon average_mass 346.4605 ChemAxon mono_mass 346.214409448 ChemAxon smiles CCCCCCCCCC(=O)\C=C(/O)\C=C/C1=CC(OC)=C(O)C=C1 ChemAxon formula C21H30O4 ChemAxon inchi InChI=1S/C21H30O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h11-16,23-24H,3-10H2,1-2H3/b13-11-,19-16- ChemAxon inchikey NILVTWAPVHQVPS-PBYGQCEKSA-N ChemAxon polar_surface_area 66.76 ChemAxon refractivity 104.1 ChemAxon polarizability 40.69 ChemAxon rotatable_bond_count 12 ChemAxon acceptor_count 4 ChemAxon donor_count 2 ChemAxon physiological_charge 0 ChemAxon formal_charge 0 ChemAxon Specdb::MsMs 55569 Specdb::MsMs 55570 Specdb::MsMs 55571 Specdb::MsMs 110754 Specdb::MsMs 110755 Specdb::MsMs 110756 Specdb::MsMs 3604265 Specdb::MsMs 3604266 Specdb::MsMs 3604267 Specdb::MsMs 3604268 Specdb::MsMs 3604269 Specdb::MsMs 3604270 Ginger Type 1 specific Zingiber officinale 94328 Anti prostaglandin 550 A chemical substance which inhibits the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. Anti-choleretic 179 Anti-inflammatory 370 A substance that reduces or suppresses inflammation.